# -*- coding: utf-8 -*-

# PLEASE DO NOT EDIT THIS FILE, IT IS GENERATED AND WILL BE OVERWRITTEN:
# https://github.com/ccxt/ccxt/blob/master/CONTRIBUTING.md#how-to-contribute-code

from ccxt.base.exchange import Exchange
from ccxt.abstract.okx import ImplicitAPI
import hashlib
from ccxt.base.types import Account, Any, Balances, BorrowInterest, Conversion, CrossBorrowRate, CrossBorrowRates, Currencies, Currency, DepositAddress, Greeks, Int, LedgerEntry, Leverage, LeverageTier, LongShortRatio, MarginModification, Market, Num, Option, OptionChain, Order, OrderBook, OrderRequest, CancellationRequest, OrderSide, OrderType, Position, Str, Strings, Ticker, Tickers, FundingRate, FundingRates, OpenInterests, Trade, TradingFeeInterface, Transaction, MarketInterface, TransferEntry
from typing import List
from ccxt.base.errors import ExchangeError
from ccxt.base.errors import AuthenticationError
from ccxt.base.errors import PermissionDenied
from ccxt.base.errors import AccountNotEnabled
from ccxt.base.errors import AccountSuspended
from ccxt.base.errors import ArgumentsRequired
from ccxt.base.errors import BadRequest
from ccxt.base.errors import BadSymbol
from ccxt.base.errors import OperationRejected
from ccxt.base.errors import ManualInteractionNeeded
from ccxt.base.errors import RestrictedLocation
from ccxt.base.errors import InsufficientFunds
from ccxt.base.errors import InvalidAddress
from ccxt.base.errors import InvalidOrder
from ccxt.base.errors import OrderNotFound
from ccxt.base.errors import ContractUnavailable
from ccxt.base.errors import NotSupported
from ccxt.base.errors import NetworkError
from ccxt.base.errors import DDoSProtection
from ccxt.base.errors import RateLimitExceeded
from ccxt.base.errors import ExchangeNotAvailable
from ccxt.base.errors import OnMaintenance
from ccxt.base.errors import InvalidNonce
from ccxt.base.errors import RequestTimeout
from ccxt.base.errors import CancelPending
from ccxt.base.decimal_to_precision import TICK_SIZE
from ccxt.base.precise import Precise


class okx(Exchange, ImplicitAPI):

    def describe(self) -> Any:
        return self.deep_extend(super(okx, self).describe(), {
            'id': 'okx',
            'name': 'OKX',
            'countries': ['CN', 'US'],
            'version': 'v5',
            'rateLimit': 100 * 1.10,  # 10% tolerance because of  #26973
            'pro': True,
            'certified': True,
            'has': {
                'CORS': None,
                'spot': True,
                'margin': True,
                'swap': True,
                'future': True,
                'option': True,
                'addMargin': True,
                'cancelAllOrders': False,
                'cancelAllOrdersAfter': True,
                'cancelOrder': True,
                'cancelOrders': True,
                'cancelOrdersForSymbols': True,
                'closeAllPositions': False,
                'closePosition': True,
                'createConvertTrade': True,
                'createDepositAddress': False,
                'createMarketBuyOrderWithCost': True,
                'createMarketSellOrderWithCost': True,
                'createOrder': True,
                'createOrders': True,
                'createOrderWithTakeProfitAndStopLoss': True,
                'createPostOnlyOrder': True,
                'createReduceOnlyOrder': True,
                'createStopLimitOrder': True,
                'createStopLossOrder': True,
                'createStopMarketOrder': True,
                'createStopOrder': True,
                'createTakeProfitOrder': True,
                'createTrailingPercentOrder': True,
                'createTriggerOrder': True,
                'editOrder': True,
                'fetchAccounts': True,
                'fetchAllGreeks': True,
                'fetchBalance': True,
                'fetchBidsAsks': None,
                'fetchBorrowInterest': True,
                'fetchBorrowRateHistories': True,
                'fetchBorrowRateHistory': True,
                'fetchCanceledOrders': True,
                'fetchClosedOrder': None,
                'fetchClosedOrders': True,
                'fetchConvertCurrencies': True,
                'fetchConvertQuote': True,
                'fetchConvertTrade': True,
                'fetchConvertTradeHistory': True,
                'fetchCrossBorrowRate': True,
                'fetchCrossBorrowRates': True,
                'fetchCurrencies': True,
                'fetchDeposit': True,
                'fetchDepositAddress': True,
                'fetchDepositAddresses': False,
                'fetchDepositAddressesByNetwork': True,
                'fetchDeposits': True,
                'fetchDepositsWithdrawals': False,
                'fetchDepositWithdrawFee': 'emulated',
                'fetchDepositWithdrawFees': True,
                'fetchFundingHistory': True,
                'fetchFundingInterval': True,
                'fetchFundingIntervals': False,
                'fetchFundingRate': True,
                'fetchFundingRateHistory': True,
                'fetchFundingRates': True,
                'fetchGreeks': True,
                'fetchIndexOHLCV': True,
                'fetchIsolatedBorrowRate': False,
                'fetchIsolatedBorrowRates': False,
                'fetchL3OrderBook': False,
                'fetchLedger': True,
                'fetchLedgerEntry': None,
                'fetchLeverage': True,
                'fetchLeverageTiers': False,
                'fetchLongShortRatio': False,
                'fetchLongShortRatioHistory': True,
                'fetchMarginAdjustmentHistory': True,
                'fetchMarketLeverageTiers': True,
                'fetchMarkets': True,
                'fetchMarkOHLCV': True,
                'fetchMarkPrice': True,
                'fetchMarkPrices': True,
                'fetchMySettlementHistory': False,
                'fetchMyTrades': True,
                'fetchOHLCV': True,
                'fetchOpenInterest': True,
                'fetchOpenInterestHistory': True,
                'fetchOpenInterests': True,
                'fetchOpenOrder': None,
                'fetchOpenOrders': True,
                'fetchOption': True,
                'fetchOptionChain': True,
                'fetchOrder': True,
                'fetchOrderBook': True,
                'fetchOrderBooks': False,
                'fetchOrders': False,
                'fetchOrderTrades': True,
                'fetchPosition': True,
                'fetchPositionHistory': 'emulated',
                'fetchPositions': True,
                'fetchPositionsForSymbol': True,
                'fetchPositionsHistory': True,
                'fetchPositionsRisk': False,
                'fetchPremiumIndexOHLCV': False,
                'fetchSettlementHistory': True,
                'fetchStatus': True,
                'fetchTicker': True,
                'fetchTickers': True,
                'fetchTime': True,
                'fetchTrades': True,
                'fetchTradingFee': True,
                'fetchTradingFees': False,
                'fetchTradingLimits': False,
                'fetchTransactionFee': False,
                'fetchTransactionFees': False,
                'fetchTransactions': False,
                'fetchTransfer': True,
                'fetchTransfers': True,
                'fetchUnderlyingAssets': True,
                'fetchVolatilityHistory': False,
                'fetchWithdrawal': True,
                'fetchWithdrawals': True,
                'fetchWithdrawalWhitelist': False,
                'reduceMargin': True,
                'repayCrossMargin': True,
                'sandbox': True,
                'setLeverage': True,
                'setMargin': False,
                'setMarginMode': True,
                'setPositionMode': True,
                'signIn': False,
                'transfer': True,
                'withdraw': True,
            },
            'timeframes': {
                '1m': '1m',
                '3m': '3m',
                '5m': '5m',
                '15m': '15m',
                '30m': '30m',
                '1h': '1H',
                '2h': '2H',
                '4h': '4H',
                '6h': '6H',
                '12h': '12H',
                '1d': '1D',
                '1w': '1W',
                '1M': '1M',
                '3M': '3M',
            },
            'hostname': 'www.okx.com',  # or aws.okx.com
            'urls': {
                'logo': 'https://user-images.githubusercontent.com/1294454/152485636-38b19e4a-bece-4dec-979a-5982859ffc04.jpg',
                'api': {
                    'rest': 'https://{hostname}',
                },
                'www': 'https://www.okx.com',
                'doc': 'https://www.okx.com/docs-v5/en/',
                'fees': 'https://www.okx.com/pages/products/fees.html',
                'referral': {
                    # old reflink 0% discount https://www.okx.com/join/1888677
                    # new reflink 20% discount https://www.okx.com/join/CCXT2023
                    'url': 'https://www.okx.com/join/CCXTCOM',
                    'discount': 0.2,
                },
                'test': {
                    'rest': 'https://{hostname}',
                },
            },
            'api': {
                'public': {
                    'get': {
                        # market
                        'market/tickers': 1,
                        'market/ticker': 1,
                        'market/books': 1 / 2,
                        'market/books-full': 2,
                        'market/candles': 1 / 2,
                        'market/history-candles': 1,
                        'market/trades': 1 / 5,
                        'market/history-trades': 2,
                        'market/option/instrument-family-trades': 1,
                        'market/platform-24-volume': 10,
                        'market/call-auction-detail': 1,
                        'market/books-sbe': 10,
                        'market/block-tickers': 1,
                        'market/block-ticker': 1,
                        'market/sprd-ticker': 1,
                        'market/sprd-candles': 1 / 2,
                        'market/sprd-history-candles': 1,
                        'market/index-tickers': 1,
                        'market/index-candles': 1,
                        'market/history-index-candles': 2,
                        'market/mark-price-candles': 1,
                        'market/history-mark-price-candles': 1,
                        'market/exchange-rate': 20,
                        'market/index-components': 1,
                        'market/open-oracle': 50,  # not documented
                        'market/books-lite': 5 / 3,  # deprecated
                        # public
                        'public/option-trades': 1,
                        'public/block-trades': 1,
                        'public/instruments': 1,
                        'public/estimated-price': 2,
                        'public/delivery-exercise-history': 1 / 2,
                        'public/estimated-settlement-info': 2,
                        'public/settlement-history': 1 / 2,
                        'public/funding-rate': 2,
                        'public/funding-rate-history': 2,
                        'public/open-interest': 1,
                        'public/price-limit': 1,
                        'public/opt-summary': 1,
                        'public/discount-rate-interest-free-quota': 10,
                        'public/time': 2,
                        'public/mark-price': 2,
                        'public/position-tiers': 2,
                        'public/interest-rate-loan-quota': 10,
                        'public/underlying': 1,
                        'public/insurance-fund': 2,
                        'public/convert-contract-coin': 2,
                        'public/instrument-tick-bands': 4,
                        'public/premium-history': 1,
                        'public/economic-calendar': 50,
                        'public/market-data-history': 4,
                        'public/vip-interest-rate-loan-quota': 10,  # not documented
                        # rubik
                        'rubik/stat/trading-data/support-coin': 4,
                        'rubik/stat/contracts/open-interest-history': 2,
                        'rubik/stat/taker-volume': 4,
                        'rubik/stat/taker-volume-contract': 4,
                        'rubik/stat/margin/loan-ratio': 4,
                        'rubik/stat/contracts/long-short-account-ratio-contract-top-trader': 4,
                        'rubik/stat/contracts/long-short-account-ratio-contract': 4,
                        'rubik/stat/contracts/long-short-account-ratio': 4,
                        'rubik/stat/contracts/open-interest-volume': 4,
                        'rubik/stat/option/open-interest-volume': 4,
                        'rubik/stat/option/open-interest-volume-ratio': 4,
                        'rubik/stat/option/open-interest-volume-expiry': 4,
                        'rubik/stat/option/open-interest-volume-strike': 4,
                        'rubik/stat/option/taker-block-volume': 4,
                        # system
                        'system/status': 50,
                        # sprd
                        'sprd/spreads': 1,
                        'sprd/books': 1,
                        'sprd/public-trades': 1,
                        'sprd/ticker': 1,  # not documented
                        'tradingBot/grid/ai-param': 1,
                        'tradingBot/grid/min-investment': 1,
                        'tradingBot/public/rsi-back-testing': 1,
                        'tradingBot/grid/grid-quantity': 4,
                        'asset/exchange-list': 5 / 3,
                        'finance/staking-defi/eth/apy-history': 5 / 3,
                        'finance/staking-defi/sol/apy-history': 5 / 3,
                        'finance/savings/lending-rate-summary': 5 / 3,
                        'finance/savings/lending-rate-history': 5 / 3,
                        'finance/fixed-loan/lending-offers': 10 / 3,  # not documented
                        'finance/fixed-loan/lending-apy-history': 10 / 3,  # not documented
                        'finance/fixed-loan/pending-lending-volume': 10 / 3,  # not documented
                        # public broker
                        'finance/sfp/dcd/products': 2 / 3,  # not documented
                        # copytrading
                        'copytrading/public-config': 4,
                        'copytrading/public-lead-traders': 4,
                        'copytrading/public-weekly-pnl': 4,
                        'copytrading/public-pnl': 4,
                        'copytrading/public-stats': 4,
                        'copytrading/public-preference-currency': 4,
                        'copytrading/public-current-subpositions': 4,
                        'copytrading/public-subpositions-history': 4,
                        'copytrading/public-copy-traders': 4,
                        'support/announcements': 4,
                        'support/announcements-types': 20,
                    },
                    'post': {
                        'tradingBot/grid/min-investment': 1,  # public
                    },
                },
                'private': {
                    'get': {
                        # rfq
                        'rfq/counterparties': 4,
                        'rfq/maker-instrument-settings': 4,
                        'rfq/mmp-config': 4,
                        'rfq/rfqs': 10,
                        'rfq/quotes': 10,
                        'rfq/trades': 4,
                        'rfq/public-trades': 4,
                        # sprd
                        'sprd/order': 1,
                        'sprd/orders-pending': 2,
                        'sprd/orders-history': 1,
                        'sprd/orders-history-archive': 1,
                        'sprd/trades': 1,
                        # trade
                        'trade/order': 1 / 3,
                        'trade/orders-pending': 1 / 3,
                        'trade/orders-history': 1 / 2,
                        'trade/orders-history-archive': 1,
                        'trade/fills': 1 / 3,
                        'trade/fills-history': 2,
                        'trade/fills-archive': 2,  # not documented
                        'trade/order-algo': 1,
                        'trade/orders-algo-pending': 1,
                        'trade/orders-algo-history': 1,
                        'trade/easy-convert-currency-list': 20,
                        'trade/easy-convert-history': 20,
                        'trade/one-click-repay-currency-list': 20,
                        'trade/one-click-repay-currency-list-v2': 20,
                        'trade/one-click-repay-history': 20,
                        'trade/one-click-repay-history-v2': 20,
                        'trade/account-rate-limit': 1,
                        # asset
                        'asset/currencies': 5 / 3,
                        'asset/balances': 5 / 3,
                        'asset/non-tradable-assets': 5 / 3,
                        'asset/asset-valuation': 10,
                        'asset/transfer-state': 1,
                        'asset/bills': 5 / 3,
                        'asset/bills-history': 10,
                        'asset/deposit-lightning': 5,  # not documented
                        'asset/deposit-address': 5 / 3,
                        'asset/deposit-history': 5 / 3,
                        'asset/withdrawal-history': 5 / 3,
                        'asset/deposit-withdraw-status': 20,
                        'asset/monthly-statement': 2,
                        'asset/convert/currencies': 5 / 3,
                        'asset/convert/currency-pair': 5 / 3,
                        'asset/convert/history': 5 / 3,
                        # account
                        'account/instruments': 1,
                        'account/balance': 2,
                        'account/positions': 2,
                        'account/positions-history': 2,
                        'account/account-position-risk': 2,
                        'account/bills': 2,
                        'account/bills-archive': 4,
                        'account/bills-history-archive': 2,
                        'account/config': 4,
                        'account/max-size': 1,
                        'account/max-avail-size': 1,
                        'account/leverage-info': 1,
                        'account/adjust-leverage-info': 4,
                        'account/max-loan': 1,
                        'account/trade-fee': 4,
                        'account/interest-accrued': 4,
                        'account/interest-rate': 4,
                        'account/max-withdrawal': 1,
                        'account/risk-state': 2,
                        'account/interest-limits': 4,
                        'account/spot-borrow-repay-history': 4,
                        'account/greeks': 2,
                        'account/position-tiers': 2,
                        'account/set-account-switch-precheck': 4,
                        'account/collateral-assets': 4,
                        'account/mmp-config': 4,
                        'account/move-positions-history': 10,
                        'account/precheck-set-delta-neutral': 20,
                        'account/quick-margin-borrow-repay-history': 4,
                        'account/borrow-repay-history': 4,
                        'account/vip-interest-accrued': 4,  # not documented
                        'account/vip-interest-deducted': 4,  # not documented
                        'account/vip-loan-order-list': 4,  # not documented
                        'account/vip-loan-order-detail': 4,  # not documented
                        'account/fixed-loan/borrowing-limit': 4,  # not documented
                        'account/fixed-loan/borrowing-quote': 5,  # not documented
                        'account/fixed-loan/borrowing-orders-list': 5,  # not documented
                        'account/spot-manual-borrow-repay': 30,  # not documented
                        'account/set-auto-repay': 4,  # not documented
                        # subaccount
                        'users/subaccount/list': 10,
                        'account/subaccount/balances': 10 / 3,
                        'asset/subaccount/balances': 10 / 3,
                        'account/subaccount/max-withdrawal': 1,
                        'asset/subaccount/bills': 5 / 3,
                        'asset/subaccount/managed-subaccount-bills': 5 / 3,
                        'users/entrust-subaccount-list': 10,
                        'account/subaccount/interest-limits': 4,
                        'users/subaccount/apikey': 10,
                        # grid trading
                        'tradingBot/grid/orders-algo-pending': 1,
                        'tradingBot/grid/orders-algo-history': 1,
                        'tradingBot/grid/orders-algo-details': 1,
                        'tradingBot/grid/sub-orders': 1,
                        'tradingBot/grid/positions': 1,
                        'tradingBot/grid/ai-param': 1,
                        'tradingBot/signal/signals': 1,
                        'tradingBot/signal/orders-algo-details': 1,
                        'tradingBot/signal/orders-algo-pending': 1,
                        'tradingBot/signal/orders-algo-history': 1,
                        'tradingBot/signal/positions': 1,
                        'tradingBot/signal/positions-history': 2,
                        'tradingBot/signal/sub-orders': 1,
                        'tradingBot/signal/event-history': 1,
                        'tradingBot/recurring/orders-algo-pending': 1,
                        'tradingBot/recurring/orders-algo-history': 1,
                        'tradingBot/recurring/orders-algo-details': 1,
                        'tradingBot/recurring/sub-orders': 1,
                        # earn
                        'finance/savings/balance': 5 / 3,
                        'finance/savings/lending-history': 5 / 3,
                        'finance/staking-defi/offers': 10 / 3,
                        'finance/staking-defi/orders-active': 10 / 3,
                        'finance/staking-defi/orders-history': 10 / 3,
                        # eth staking
                        'finance/staking-defi/eth/product-info': 10 / 3,
                        'finance/staking-defi/eth/balance': 5 / 3,
                        'finance/staking-defi/eth/purchase-redeem-history': 5 / 3,
                        'finance/staking-defi/sol/product-info': 10 / 3,
                        'finance/staking-defi/sol/balance': 5 / 3,
                        'finance/staking-defi/sol/purchase-redeem-history': 5 / 3,
                        'finance/flexible-loan/borrow-currencies': 4,
                        'finance/flexible-loan/collateral-assets': 4,
                        'finance/flexible-loan/max-collateral-redeem-amount': 4,
                        'finance/flexible-loan/loan-info': 4,
                        'finance/flexible-loan/loan-history': 4,
                        'finance/flexible-loan/interest-accrued': 4,
                        # copytrading
                        'copytrading/current-subpositions': 1,
                        'copytrading/subpositions-history': 1,
                        'copytrading/instruments': 4,
                        'copytrading/profit-sharing-details': 4,
                        'copytrading/total-profit-sharing': 4,
                        'copytrading/unrealized-profit-sharing-details': 4,
                        'copytrading/total-unrealized-profit-sharing': 4,
                        'copytrading/config': 4,
                        'copytrading/copy-settings': 4,
                        'copytrading/current-lead-traders': 4,
                        'copytrading/batch-leverage-info': 4,  # not documented
                        'copytrading/lead-traders-history': 4,  # not documented
                        # broker
                        'broker/dma/subaccount-info': 2,
                        'broker/dma/subaccount-trade-fee': 10,
                        'broker/dma/subaccount/apikey': 10,
                        'broker/dma/rebate-per-orders': 300,
                        'broker/fd/rebate-per-orders': 300,
                        'broker/fd/if-rebate': 5,
                        'broker/nd/info': 10,  # not documented
                        'broker/nd/subaccount-info': 10,  # not documented
                        'broker/nd/subaccount/apikey': 10,  # not documented
                        'asset/broker/nd/subaccount-deposit-address': 5 / 3,  # not documented
                        'asset/broker/nd/subaccount-deposit-history': 4,  # not documented
                        'asset/broker/nd/subaccount-withdrawal-history': 4,  # not documented
                        'broker/nd/rebate-daily': 100,  # not documented
                        'broker/nd/rebate-per-orders': 300,  # not documented
                        'finance/sfp/dcd/order': 2,  # not documented
                        'finance/sfp/dcd/orders': 2,  # not documented
                        # affiliate
                        'affiliate/invitee/detail': 1,
                        'users/partner/if-rebate': 1,  # not documented
                        'support/announcements': 4,
                    },
                    'post': {
                        # rfq
                        'rfq/create-rfq': 4,
                        'rfq/cancel-rfq': 4,
                        'rfq/cancel-batch-rfqs': 10,
                        'rfq/cancel-all-rfqs': 10,
                        'rfq/execute-quote': 15,
                        'rfq/maker-instrument-settings': 4,
                        'rfq/mmp-reset': 4,
                        'rfq/mmp-config': 100,
                        'rfq/create-quote': 0.4,
                        'rfq/cancel-quote': 0.4,
                        'rfq/cancel-batch-quotes': 10,
                        'rfq/cancel-all-quotes': 10,
                        'rfq/cancel-all-after': 10,
                        # sprd
                        'sprd/order': 1,
                        'sprd/cancel-order': 1,
                        'sprd/mass-cancel': 1,
                        'sprd/amend-order': 1,
                        'sprd/cancel-all-after': 10,
                        # trade
                        'trade/order': 1 / 3,
                        'trade/batch-orders': 1 / 15,
                        'trade/cancel-order': 1 / 3,
                        'trade/cancel-batch-orders': 1 / 15,
                        'trade/amend-order': 1 / 3,
                        'trade/amend-batch-orders': 1 / 150,
                        'trade/close-position': 1,
                        'trade/fills-archive': 172800,  # not documented
                        'trade/cancel-advance-algos': 1,  # not documented
                        'trade/easy-convert': 20,
                        'trade/one-click-repay': 20,
                        'trade/one-click-repay-v2': 20,
                        'trade/mass-cancel': 4,
                        'trade/cancel-all-after': 10,
                        'trade/order-precheck': 4,
                        'trade/order-algo': 1,
                        'trade/cancel-algos': 1,
                        'trade/amend-algos': 1,
                        # asset
                        'asset/transfer': 5,
                        'asset/withdrawal': 5 / 3,
                        'asset/withdrawal-lightning': 5,  # not documented
                        'asset/cancel-withdrawal': 5 / 3,
                        'asset/convert-dust-assets': 10,
                        'asset/monthly-statement': 1296000,  # 20 req/month, 10/20*30*24*60*60 = 1296000
                        'asset/convert/estimate-quote': 50,
                        'asset/convert/trade': 1,
                        # account
                        'account/bills-history-archive': 72000,  # 12 req/day
                        'account/set-position-mode': 4,
                        'account/set-leverage': 1,
                        'account/position/margin-balance': 1,
                        'account/set-fee-type': 4,
                        'account/set-greeks': 4,
                        'account/set-isolated-mode': 4,
                        'account/spot-manual-borrow-repay': 30,
                        'account/set-auto-repay': 4,
                        'account/quick-margin-borrow-repay': 4,  # not documented
                        'account/borrow-repay': 5 / 3,  # not documented
                        'account/simulated_margin': 10,  # not documented
                        'account/position-builder': 10,
                        'account/position-builder-graph': 50,
                        'account/set-riskOffset-type': 2,
                        'account/activate-option': 4,
                        'account/set-auto-loan': 4,
                        'account/account-level-switch-preset': 4,
                        'account/set-account-level': 4,
                        'account/set-collateral-assets': 4,
                        'account/mmp-reset': 4,
                        'account/mmp-config': 50,
                        'account/fixed-loan/borrowing-order': 5,  # not documented
                        'account/fixed-loan/amend-borrowing-order': 5,  # not documented
                        'account/fixed-loan/manual-reborrow': 5,  # not documented
                        'account/fixed-loan/repay-borrowing-order': 5,  # not documented
                        'account/move-positions': 10,
                        'account/set-auto-earn': 10,
                        'account/set-settle-currency': 1,
                        'account/set-trading-config': 20,
                        # subaccount
                        'asset/subaccount/transfer': 10,
                        'account/subaccount/set-loan-allocation': 4,  # not documented
                        'users/subaccount/create-subaccount': 10,
                        'users/subaccount/apikey': 10,
                        'users/subaccount/modify-apikey': 10,
                        'users/subaccount/subaccount-apikey': 10,  # not documented
                        'users/subaccount/delete-apikey': 10,
                        'users/subaccount/set-transfer-out': 10,
                        # grid trading
                        'tradingBot/grid/order-algo': 1,
                        'tradingBot/grid/amend-algo-basic-param': 1,
                        'tradingBot/grid/amend-order-algo': 1,
                        'tradingBot/grid/stop-order-algo': 1,
                        'tradingBot/grid/close-position': 1,
                        'tradingBot/grid/cancel-close-order': 1,
                        'tradingBot/grid/order-instant-trigger': 1,
                        'tradingBot/grid/withdraw-income': 1,
                        'tradingBot/grid/compute-margin-balance': 1,
                        'tradingBot/grid/margin-balance': 1,
                        'tradingBot/grid/min-investment': 1,  # public
                        'tradingBot/grid/adjust-investment': 1,
                        'tradingBot/signal/create-signal': 1,
                        'tradingBot/signal/order-algo': 1,
                        'tradingBot/signal/stop-order-algo': 1,
                        'tradingBot/signal/margin-balance': 1,
                        'tradingBot/signal/amendTPSL': 1,
                        'tradingBot/signal/set-instruments': 1,
                        'tradingBot/signal/close-position': 1,
                        'tradingBot/signal/sub-order': 1,
                        'tradingBot/signal/cancel-sub-order': 1,
                        'tradingBot/recurring/order-algo': 1,
                        'tradingBot/recurring/amend-order-algo': 1,
                        'tradingBot/recurring/stop-order-algo': 1,
                        # earn
                        'finance/savings/purchase-redempt': 5 / 3,
                        'finance/savings/set-lending-rate': 5 / 3,
                        'finance/staking-defi/purchase': 5,
                        'finance/staking-defi/redeem': 5,
                        'finance/staking-defi/cancel': 5,
                        # eth staking
                        'finance/staking-defi/eth/purchase': 5,
                        'finance/staking-defi/eth/redeem': 5,
                        'finance/staking-defi/eth/cancel-redeem': 5,
                        'finance/staking-defi/sol/purchase': 5,
                        'finance/staking-defi/sol/redeem': 5,
                        'finance/staking-defi/sol/cancel-redeem': 5,
                        'finance/flexible-loan/max-loan': 4,
                        'finance/flexible-loan/adjust-collateral': 4,
                        # copytrading
                        'copytrading/algo-order': 1,
                        'copytrading/close-subposition': 1,
                        'copytrading/set-instruments': 4,
                        'copytrading/amend-profit-sharing-ratio': 4,
                        'copytrading/first-copy-settings': 4,
                        'copytrading/amend-copy-settings': 4,
                        'copytrading/stop-copy-trading': 4,
                        'copytrading/batch-set-leverage': 4,  # not documented
                        # broker
                        'broker/nd/create-subaccount': 0.25,  # not documented
                        'broker/nd/delete-subaccount': 1,  # not documented
                        'broker/nd/subaccount/apikey': 0.25,  # not documented
                        'broker/nd/subaccount/modify-apikey': 1,  # not documented
                        'broker/nd/subaccount/delete-apikey': 1,  # not documented
                        'broker/nd/set-subaccount-level': 4,  # not documented
                        'broker/nd/set-subaccount-fee-rate': 4,  # not documented
                        'broker/nd/set-subaccount-assets': 0.25,  # not documented
                        'asset/broker/nd/subaccount-deposit-address': 1,  # not documented
                        'asset/broker/nd/modify-subaccount-deposit-address': 5 / 3,  # not documented
                        'broker/nd/rebate-per-orders': 36000,  # not documented
                        'finance/sfp/dcd/quote': 10,  # not documented
                        'finance/sfp/dcd/order': 10,  # not documented
                        'broker/nd/report-subaccount-ip': 0.25,  # not documented
                        'broker/dma/subaccount/apikey': 1 / 4,
                        'broker/dma/trades': 36000,
                        'broker/fd/rebate-per-orders': 36000,
                    },
                },
            },
            'fees': {
                'trading': {
                    'taker': self.parse_number('0.0015'),
                    'maker': self.parse_number('0.0010'),
                },
                'spot': {
                    'taker': self.parse_number('0.0015'),
                    'maker': self.parse_number('0.0010'),
                },
                'future': {
                    'taker': self.parse_number('0.0005'),
                    'maker': self.parse_number('0.0002'),
                },
                'swap': {
                    'taker': self.parse_number('0.00050'),
                    'maker': self.parse_number('0.00020'),
                },
            },
            'requiredCredentials': {
                'apiKey': True,
                'secret': True,
                'password': True,
            },
            'exceptions': {
                'exact': {
                    # Public error codes from 50000-53999
                    # General Class
                    '1': ExchangeError,  # Operation failed
                    '2': ExchangeError,  # Bulk operation partially succeeded
                    '4088': ManualInteractionNeeded,  # {"code":"4088","data":[],"msg":"You can’t trade or deposit until you’ve verified your identity again. Head to Identity Verification to complete it."}
                    '50000': BadRequest,  # Body can not be empty
                    '50001': OnMaintenance,  # Matching engine upgrading. Please try again later
                    '50002': BadRequest,  # Json data format error
                    '50004': RequestTimeout,  # Endpoint request timeout(does not indicate success or failure of order, please check order status)
                    '50005': ExchangeNotAvailable,  # API is offline or unavailable
                    '50006': BadRequest,  # Invalid Content_Type, please use "application/json" format
                    '50007': AccountSuspended,  # Account blocked
                    '50008': AuthenticationError,  # User does not exist
                    '50009': AccountSuspended,  # Account is suspended due to ongoing liquidation
                    '50010': ExchangeError,  # User ID can not be empty
                    '50011': RateLimitExceeded,  # Request too frequent
                    '50012': ExchangeError,  # Account status invalid
                    '50013': ExchangeNotAvailable,  # System is busy, please try again later
                    '50014': BadRequest,  # Parameter {0} can not be empty
                    '50015': ExchangeError,  # Either parameter {0} or {1} is required
                    '50016': ExchangeError,  # Parameter {0} does not match parameter {1}
                    '50017': ExchangeError,  # The position is frozen due to ADL. Operation restricted
                    '50018': ExchangeError,  # Currency {0} is frozen due to ADL. Operation restricted
                    '50019': ExchangeError,  # The account is frozen due to ADL. Operation restricted
                    '50020': ExchangeError,  # The position is frozen due to liquidation. Operation restricted
                    '50021': ExchangeError,  # Currency {0} is frozen due to liquidation. Operation restricted
                    '50022': ExchangeError,  # The account is frozen due to liquidation. Operation restricted
                    '50023': ExchangeError,  # Funding fee frozen. Operation restricted
                    '50024': BadRequest,  # Parameter {0} and {1} can not exist at the same time
                    '50025': ExchangeError,  # Parameter {0} count exceeds the limit {1}
                    '50026': ExchangeNotAvailable,  # System error, please try again later.
                    '50027': PermissionDenied,  # The account is restricted from trading
                    '50028': ExchangeError,  # Unable to take the order, please reach out to support center for details
                    '50044': BadRequest,  # Must select one broker type
                    '50061': ExchangeError,  # You've reached the maximum order rate limit for self account.
                    '50062': ExchangeError,  # This feature is currently unavailable.
                    # API Class
                    '50100': ExchangeError,  # API frozen, please contact customer service
                    '50101': AuthenticationError,  # Broker id of APIKey does not match current environment
                    '50102': InvalidNonce,  # Timestamp request expired
                    '50103': AuthenticationError,  # Request header "OK_ACCESS_KEY" can not be empty
                    '50104': AuthenticationError,  # Request header "OK_ACCESS_PASSPHRASE" can not be empty
                    '50105': AuthenticationError,  # Request header "OK_ACCESS_PASSPHRASE" incorrect
                    '50106': AuthenticationError,  # Request header "OK_ACCESS_SIGN" can not be empty
                    '50107': AuthenticationError,  # Request header "OK_ACCESS_TIMESTAMP" can not be empty
                    '50108': ExchangeError,  # Exchange ID does not exist
                    '50109': ExchangeError,  # Exchange domain does not exist
                    '50110': PermissionDenied,  # Invalid IP
                    '50111': AuthenticationError,  # Invalid OK_ACCESS_KEY
                    '50112': AuthenticationError,  # Invalid OK_ACCESS_TIMESTAMP
                    '50113': AuthenticationError,  # Invalid signature
                    '50114': AuthenticationError,  # Invalid authorization
                    '50115': BadRequest,  # Invalid request method
                    # Trade Class
                    '51000': BadRequest,  # Parameter {0} error
                    '51001': BadSymbol,  # Instrument ID does not exist
                    '51002': BadSymbol,  # Instrument ID does not match underlying index
                    '51003': BadRequest,  # Either client order ID or order ID is required
                    '51004': InvalidOrder,  # Order amount exceeds current tier limit
                    '51005': InvalidOrder,  # Order amount exceeds the limit
                    '51006': InvalidOrder,  # Order price out of the limit
                    '51007': InvalidOrder,  # Order placement failed. Order amount should be at least 1 contract(showing up when placing an order with less than 1 contract)
                    '51008': InsufficientFunds,  # Order placement failed due to insufficient balance or margin
                    '51009': AccountSuspended,  # Order placement function is blocked by the platform
                    '51010': AccountNotEnabled,  # Account level too low {"code":"1","data":[{"clOrdId":"uJrfGFth9F","ordId":"","sCode":"51010","sMsg":"The current account mode does not support self API interface. ","tag":""}],"msg":"Operation failed."}
                    '51011': InvalidOrder,  # Duplicated order ID
                    '51012': BadSymbol,  # Token does not exist
                    '51014': BadSymbol,  # Index does not exist
                    '51015': BadSymbol,  # Instrument ID does not match instrument type
                    '51016': InvalidOrder,  # Duplicated client order ID
                    '51017': ExchangeError,  # Borrow amount exceeds the limit
                    '51018': ExchangeError,  # User with option account can not hold net short positions
                    '51019': ExchangeError,  # No net long positions can be held under isolated margin mode in options
                    '51020': InvalidOrder,  # Order amount should be greater than the min available amount
                    '51021': ContractUnavailable,  # Contract to be listed
                    '51022': ContractUnavailable,  # Contract suspended
                    '51023': ExchangeError,  # Position does not exist
                    '51024': AccountSuspended,  # Unified accountblocked
                    '51025': ExchangeError,  # Order count exceeds the limit
                    '51026': BadSymbol,  # Instrument type does not match underlying index
                    '51027': ContractUnavailable,  # Contract expired
                    '51028': ContractUnavailable,  # Contract under delivery
                    '51029': ContractUnavailable,  # Contract is being settled
                    '51030': ContractUnavailable,  # Funding fee is being settled
                    '51031': InvalidOrder,  # This order price is not within the closing price range
                    '51046': InvalidOrder,  # The take profit trigger price must be higher than the order price
                    '51047': InvalidOrder,  # The stop loss trigger price must be lower than the order price
                    '51051': InvalidOrder,  # Your SL price should be lower than the primary order price
                    '51072': InvalidOrder,  # As a spot lead trader, you need to set tdMode to 'spot_isolated' when configured buying lead trade pairs
                    '51073': InvalidOrder,  # As a spot lead trader, you need to use '/copytrading/close-subposition' for selling assets through lead trades
                    '51074': InvalidOrder,  # Only the tdMode for lead trade pairs configured by spot lead traders can be set to 'spot_isolated'
                    '51090': InvalidOrder,  # You can't modify the amount of an SL order placed with a TP limit order.
                    '51091': InvalidOrder,  # All TP orders in one order must be of the same type.
                    '51092': InvalidOrder,  # TP order prices(tpOrdPx) in one order must be different.
                    '51093': InvalidOrder,  # TP limit order prices(tpOrdPx) in one order can't be –1(market price).
                    '51094': InvalidOrder,  # You can't place TP limit orders in spot, margin, or options trading.
                    '51095': InvalidOrder,  # To place TP limit orders at self endpoint, you must place an SL order at the same time.
                    '51096': InvalidOrder,  # cxlOnClosePos needs to be True to place a TP limit order
                    '51098': InvalidOrder,  # You can't add a new TP order to an SL order placed with a TP limit order.
                    '51099': InvalidOrder,  # You can't place TP limit orders lead trader.
                    '51100': InvalidOrder,  # Trading amount does not meet the min tradable amount
                    '51101': InvalidOrder,  # Entered amount exceeds the max pending order amount(Cont) per transaction
                    '51102': InvalidOrder,  # Entered amount exceeds the max pending count
                    '51103': InvalidOrder,  # Entered amount exceeds the max pending order count of the underlying asset
                    '51104': InvalidOrder,  # Entered amount exceeds the max pending order amount(Cont) of the underlying asset
                    '51105': InvalidOrder,  # Entered amount exceeds the max order amount(Cont) of the contract
                    '51106': InvalidOrder,  # Entered amount exceeds the max order amount(Cont) of the underlying asset
                    '51107': InvalidOrder,  # Entered amount exceeds the max holding amount(Cont)
                    '51108': InvalidOrder,  # Positions exceed the limit for closing out with the market price
                    '51109': InvalidOrder,  # No available offer
                    '51110': InvalidOrder,  # You can only place a limit order after Call Auction has started
                    '51111': BadRequest,  # Maximum {0} orders can be placed in bulk
                    '51112': InvalidOrder,  # Close order size exceeds your available size
                    '51113': RateLimitExceeded,  # Market-price liquidation requests too frequent
                    '51115': InvalidOrder,  # Cancel all pending close-orders before liquidation
                    '51116': InvalidOrder,  # Order price or trigger price exceeds {0}
                    '51117': InvalidOrder,  # Pending close-orders count exceeds limit
                    '51118': InvalidOrder,  # Total amount should exceed the min amount per order
                    '51119': InsufficientFunds,  # Order placement failed due to insufficient balance
                    '51120': InvalidOrder,  # Order quantity is less than {0}, please try again
                    '51121': InvalidOrder,  # Order count should be the integer multiples of the lot size
                    '51122': InvalidOrder,  # Order price should be higher than the min price {0}
                    '51124': InvalidOrder,  # You can only place limit orders during call auction
                    '51125': InvalidOrder,  # Currently there are reduce + reverse position pending orders in margin trading. Please cancel all reduce + reverse position pending orders and continue
                    '51126': InvalidOrder,  # Currently there are reduce only pending orders in margin trading.Please cancel all reduce only pending orders and continue
                    '51127': InsufficientFunds,  # Available balance is 0
                    '51128': InvalidOrder,  # Multi-currency margin account can not do cross-margin trading
                    '51129': InvalidOrder,  # The value of the position and buy order has reached the position limit, and no further buying is allowed
                    '51130': BadSymbol,  # Fixed margin currency error
                    '51131': InsufficientFunds,  # Insufficient balance
                    '51132': InvalidOrder,  # Your position amount is negative and less than the minimum trading amount
                    '51133': InvalidOrder,  # Reduce-only feature is unavailable for the spot transactions by multi-currency margin account
                    '51134': InvalidOrder,  # Closing failed. Please check your holdings and pending orders
                    '51135': InvalidOrder,  # Your closing price has triggered the limit price, and the max buy price is {0}
                    '51136': InvalidOrder,  # Your closing price has triggered the limit price, and the min sell price is {0}
                    '51137': InvalidOrder,  # Your opening price has triggered the limit price, and the max buy price is {0}
                    '51138': InvalidOrder,  # Your opening price has triggered the limit price, and the min sell price is {0}
                    '51139': InvalidOrder,  # Reduce-only feature is unavailable for the spot transactions by simple account
                    '51155': RestrictedLocation,  # {"code":"1","data":[{"clOrdId":"e847xxx","ordId":"","sCode":"51155","sMsg":"You can't trade self pair or borrow self crypto due to local compliance restrictions. ","tag":"e847xxx","ts":"1753979177157"}],"inTime":"1753979177157408","msg":"All operations failed","outTime":"1753979177157874"}
                    '51156': BadRequest,  # You're leading trades in long/short mode and can't use self API endpoint to close positions
                    '51159': BadRequest,  # You're leading trades in buy/sell mode. If you want to place orders using self API endpoint, the orders must be in the same direction existing positions and open orders.
                    '51162': InvalidOrder,  # You have {instrument} open orders. Cancel these orders and try again
                    '51163': InvalidOrder,  # You hold {instrument} positions. Close these positions and try again
                    '51166': InvalidOrder,  # Currently, we don't support leading trades with self instrument
                    '51174': InvalidOrder,  # The number of {param0} pending orders reached the upper limit of {param1}(orders).
                    '51185': InvalidOrder,  # The maximum value allowed per order is {maxOrderValue} USD
                    '51201': InvalidOrder,  # Value of per market order cannot exceed 100,000 USDT
                    '51202': InvalidOrder,  # Market - order amount exceeds the max amount
                    '51203': InvalidOrder,  # Order amount exceeds the limit {0}
                    '51204': InvalidOrder,  # The price for the limit order can not be empty
                    '51205': InvalidOrder,  # Reduce-Only is not available
                    '51250': InvalidOrder,  # Algo order price is out of the available range
                    '51251': InvalidOrder,  # Algo order type error(when user place an iceberg order)
                    '51252': InvalidOrder,  # Algo order price is out of the available range
                    '51253': InvalidOrder,  # Average amount exceeds the limit of per iceberg order
                    '51254': InvalidOrder,  # Iceberg average amount error(when user place an iceberg order)
                    '51255': InvalidOrder,  # Limit of per iceberg order: Total amount/1000 < x <= Total amount
                    '51256': InvalidOrder,  # Iceberg order price variance error
                    '51257': InvalidOrder,  # Trail order callback rate error
                    '51258': InvalidOrder,  # Trail - order placement failed. The trigger price of a sell order should be higher than the last transaction price
                    '51259': InvalidOrder,  # Trail - order placement failed. The trigger price of a buy order should be lower than the last transaction price
                    '51260': InvalidOrder,  # Maximum {0} pending trail - orders can be held at the same time
                    '51261': InvalidOrder,  # Each user can hold up to {0} pending stop - orders at the same time
                    '51262': InvalidOrder,  # Maximum {0} pending iceberg orders can be held at the same time
                    '51263': InvalidOrder,  # Maximum {0} pending time-weighted orders can be held at the same time
                    '51264': InvalidOrder,  # Average amount exceeds the limit of per time-weighted order
                    '51265': InvalidOrder,  # Time-weighted order limit error
                    '51267': InvalidOrder,  # Time-weighted order strategy initiative rate error
                    '51268': InvalidOrder,  # Time-weighted order strategy initiative range error
                    '51269': InvalidOrder,  # Time-weighted order interval error, the interval should be {0}<= x<={1}
                    '51270': InvalidOrder,  # The limit of time-weighted order price variance is 0 < x <= 1%
                    '51271': InvalidOrder,  # Sweep ratio should be 0 < x <= 100%
                    '51272': InvalidOrder,  # Price variance should be 0 < x <= 1%
                    '51273': InvalidOrder,  # Total amount should be more than {0}
                    '51274': InvalidOrder,  # Total quantity of time-weighted order must be larger than single order limit
                    '51275': InvalidOrder,  # The amount of single stop-market order can not exceed the upper limit
                    '51276': InvalidOrder,  # Stop - Market orders cannot specify a price
                    '51277': InvalidOrder,  # TP trigger price can not be higher than the last price
                    '51278': InvalidOrder,  # SL trigger price can not be lower than the last price
                    '51279': InvalidOrder,  # TP trigger price can not be lower than the last price
                    '51280': InvalidOrder,  # SL trigger price can not be higher than the last price
                    '51321': InvalidOrder,  # You're leading trades. Currently, we don't support leading trades with arbitrage, iceberg, or TWAP bots
                    '51322': InvalidOrder,  # You're leading trades that have been filled at market price. We've canceled your open stop orders to close your positions
                    '51323': BadRequest,  # You're already leading trades with take profit or stop loss settings. Cancel your existing stop orders to proceed
                    '51324': BadRequest,  # As a lead trader, you hold positions in {instrument}. To close your positions, place orders in the amount that equals the available amount for closing
                    '51325': InvalidOrder,  # As a lead trader, you must use market price when placing stop orders
                    '51327': InvalidOrder,  # closeFraction is only available for futures and perpetual swaps
                    '51328': InvalidOrder,  # closeFraction is only available for reduceOnly orders
                    '51329': InvalidOrder,  # closeFraction is only available in NET mode
                    '51330': InvalidOrder,  # closeFraction is only available for stop market orders
                    '51400': OrderNotFound,  # Cancellation failed order does not exist
                    '51401': OrderNotFound,  # Cancellation failed order is already canceled
                    '51402': OrderNotFound,  # Cancellation failed order is already completed
                    '51403': InvalidOrder,  # Cancellation failed order type does not support cancellation
                    '51404': InvalidOrder,  # Order cancellation unavailable during the second phase of call auction
                    '51405': ExchangeError,  # Cancellation failed do not have any pending orders
                    '51406': ExchangeError,  # Canceled - order count exceeds the limit {0}
                    '51407': BadRequest,  # Either order ID or client order ID is required
                    '51408': ExchangeError,  # Pair ID or name does not match the order info
                    '51409': ExchangeError,  # Either pair ID or pair name ID is required
                    '51410': CancelPending,  # Cancellation failed order is already under cancelling status
                    '51500': ExchangeError,  # Either order price or amount is required
                    '51501': ExchangeError,  # Maximum {0} orders can be modified
                    '51502': InsufficientFunds,  # Order modification failed for insufficient margin or balance
                    '51503': ExchangeError,  # Order modification failed order does not exist
                    '51506': ExchangeError,  # Order modification unavailable for the order type
                    '51508': ExchangeError,  # Orders are not allowed to be modified during the call auction
                    '51509': ExchangeError,  # Modification failed order has been canceled
                    '51510': ExchangeError,  # Modification failed order has been completed
                    '51511': ExchangeError,  # Modification failed order price did not meet the requirement for Post Only
                    '51600': ExchangeError,  # Status not found
                    '51601': ExchangeError,  # Order status and order ID cannot exist at the same time
                    '51602': ExchangeError,  # Either order status or order ID is required
                    '51603': OrderNotFound,  # Order does not exist
                    '51732': AuthenticationError,  # Required user KYC level not met
                    '51733': AuthenticationError,  # User is under risk control
                    '51734': AuthenticationError,  # User KYC Country is not supported
                    '51735': ExchangeError,  # Sub-account is not supported
                    '51736': InsufficientFunds,  # Insufficient {ccy} balance
                    # Data class
                    '52000': ExchangeError,  # No updates
                    # SPOT/MARGIN error codes 54000-54999
                    '54000': ExchangeError,  # Margin transactions unavailable
                    '54001': ExchangeError,  # Only Multi-currency margin account can be set to borrow coins automatically
                    '54008': InvalidOrder,  # This operation is disabled by the 'mass cancel order' endpoint. Please enable it using self endpoint.
                    '54009': InvalidOrder,  # The range of {param0} should be [{param1}, {param2}].
                    '54011': InvalidOrder,  # 200 Pre-market trading contracts are only allowed to reduce the number of positions within 1 hour before delivery. Please modify or cancel the order.
                    '54072': ExchangeError,  # This contract is currently view-only and not tradable.
                    '54073': BadRequest,  # Couldn’t place order, as {param0} is at risk of depegging. Switch settlement currencies and try again.
                    '54074': ExchangeError,  # Your settings failed have positions, bot or open orders for USD contracts.
                    # Trading bot Error Code from 55100 to 55999
                    '55100': InvalidOrder,  # Take profit % should be within the range of {parameter1}-{parameter2}
                    '55101': InvalidOrder,  # Stop loss % should be within the range of {parameter1}-{parameter2}
                    '55102': InvalidOrder,  # Take profit % should be greater than the current bot’s PnL%
                    '55103': InvalidOrder,  # Stop loss % should be less than the current bot’s PnL%
                    '55104': InvalidOrder,  # Only futures grid supports take profit or stop loss based on profit percentage
                    '55111': InvalidOrder,  # This signal name is in use, please try a new name
                    '55112': InvalidOrder,  # This signal does not exist
                    '55113': InvalidOrder,  # Create signal strategies with leverage greater than the maximum leverage of the instruments
                    # FUNDING error codes 58000-58999
                    '58000': ExchangeError,  # Account type {0} does not supported when getting the sub-account balance
                    '58001': AuthenticationError,  # Incorrect trade password
                    '58002': PermissionDenied,  # Please activate Savings Account first
                    '58003': ExchangeError,  # Currency type is not supported by Savings Account
                    '58004': AccountSuspended,  # Account blocked(transfer & withdrawal endpoint: either end of the account does not authorize the transfer)
                    '58005': ExchangeError,  # The redeemed amount must be no greater than {0}
                    '58006': ExchangeError,  # Service unavailable for token {0}
                    '58007': ExchangeError,  # Abnormal Assets interface. Please try again later
                    '58100': ExchangeError,  # The trading product triggers risk control, and the platform has suspended the fund transfer-out function with related users. Please wait patiently
                    '58101': AccountSuspended,  # Transfer suspended(transfer endpoint: either end of the account does not authorize the transfer)
                    '58102': RateLimitExceeded,  # Too frequent transfer(transfer too frequently)
                    '58103': ExchangeError,  # Parent account user id does not match sub-account user id
                    '58104': ExchangeError,  # Since your P2P transaction is abnormal, you are restricted from making fund transfers. Please contact customer support to remove the restriction
                    '58105': ExchangeError,  # Since your P2P transaction is abnormal, you are restricted from making fund transfers. Please transfer funds on our website or app to complete identity verification
                    '58106': ExchangeError,  # Please enable the account for spot contract
                    '58107': ExchangeError,  # Please enable the account for futures contract
                    '58108': ExchangeError,  # Please enable the account for option contract
                    '58109': ExchangeError,  # Please enable the account for swap contract
                    '58110': ExchangeError,  # The contract triggers risk control, and the platform has suspended the fund transfer function of it. Please wait patiently
                    '58111': ExchangeError,  # Funds transfer unavailable perpetual contract is charging the funding fee. Please try again later
                    '58112': ExchangeError,  # Your fund transfer failed. Please try again later
                    '58114': ExchangeError,  # Transfer amount must be more than 0
                    '58115': ExchangeError,  # Sub-account does not exist
                    '58116': ExchangeError,  # Transfer amount exceeds the limit
                    '58117': ExchangeError,  # Account assets are abnormal, please deal with negative assets before transferring
                    '58125': BadRequest,  # Non-tradable assets can only be transferred from sub-accounts to main accounts
                    '58126': BadRequest,  # Non-tradable assets can only be transferred between funding accounts
                    '58127': BadRequest,  # Main account API Key does not support current transfer 'type' parameter. Please refer to the API documentation.
                    '58128': BadRequest,  # Sub-account API Key does not support current transfer 'type' parameter. Please refer to the API documentation.
                    '58200': ExchangeError,  # Withdrawal from {0} to {1} is unavailable for self currency
                    '58201': ExchangeError,  # Withdrawal amount exceeds the daily limit
                    '58202': ExchangeError,  # The minimum withdrawal amount for NEO is 1, and the amount must be an integer
                    '58203': InvalidAddress,  # Please add a withdrawal address
                    '58204': AccountSuspended,  # Withdrawal suspended
                    '58205': ExchangeError,  # Withdrawal amount exceeds the upper limit
                    '58206': ExchangeError,  # Withdrawal amount is lower than the lower limit
                    '58207': InvalidAddress,  # Withdrawal failed due to address error
                    '58208': ExchangeError,  # Withdrawal failed. Please link your email
                    '58209': ExchangeError,  # Withdrawal failed. Withdraw feature is not available for sub-accounts
                    '58210': ExchangeError,  # Withdrawal fee exceeds the upper limit
                    '58211': ExchangeError,  # Withdrawal fee is lower than the lower limit(withdrawal endpoint: incorrect fee)
                    '58212': ExchangeError,  # Withdrawal fee should be {0}% of the withdrawal amount
                    '58213': AuthenticationError,  # Please set trading password before withdrawal
                    '58221': BadRequest,  # Missing label of withdrawal address.
                    '58222': BadRequest,  # Illegal withdrawal address.
                    '58224': BadRequest,  # This type of crypto does not support on-chain withdrawing to OKX addresses. Please withdraw through internal transfers.
                    '58227': BadRequest,  # Withdrawal of non-tradable assets can be withdrawn all at once only
                    '58228': BadRequest,  # Withdrawal of non-tradable assets requires that the API Key must be bound to an IP
                    '58229': InsufficientFunds,  # Insufficient funding account balance to pay fees {fee} USDT
                    '58300': ExchangeError,  # Deposit-address count exceeds the limit
                    '58350': InsufficientFunds,  # Insufficient balance
                    # Account error codes 59000-59999
                    '59000': ExchangeError,  # Your settings failed have positions or open orders
                    '59001': ExchangeError,  # Switching unavailable have borrowings
                    '59100': ExchangeError,  # You have open positions. Please cancel all open positions before changing the leverage
                    '59101': ExchangeError,  # You have pending orders with isolated positions. Please cancel all the pending orders and adjust the leverage
                    '59102': ExchangeError,  # Leverage exceeds the maximum leverage. Please adjust the leverage
                    '59103': InsufficientFunds,  # Leverage is too low and no sufficient margin in your account. Please adjust the leverage
                    '59104': ExchangeError,  # The leverage is too high. The borrowed position has exceeded the maximum position of self leverage. Please adjust the leverage
                    '59105': ExchangeError,  # Leverage can not be less than {0}. Please adjust the leverage
                    '59106': ExchangeError,  # The max available margin corresponding to your order tier is {0}. Please adjust your margin and place a new order
                    '59107': ExchangeError,  # You have pending orders under the service, please modify the leverage after canceling all pending orders
                    '59108': InsufficientFunds,  # Low leverage and insufficient margin, please adjust the leverage
                    '59109': ExchangeError,  # Account equity less than the required margin amount after adjustment. Please adjust the leverage
                    '59128': InvalidOrder,  # As a lead trader, you can't lead trades in {instrument} with leverage higher than {num}
                    '59200': InsufficientFunds,  # Insufficient account balance
                    '59201': InsufficientFunds,  # Negative account balance
                    '59216': BadRequest,  # The position doesn't exist. Please try again
                    '59260': PermissionDenied,  # You are not a spot lead trader yet. Complete the application on our website or app first.
                    '59262': PermissionDenied,  # You are not a contract lead trader yet. Complete the application on our website or app first.
                    '59300': ExchangeError,  # Margin call failed. Position does not exist
                    '59301': ExchangeError,  # Margin adjustment failed for exceeding the max limit
                    '59313': ExchangeError,  # Unable to repay. You haven't borrowed any {ccy} {ccyPair} in Quick margin mode.
                    '59401': ExchangeError,  # Holdings already reached the limit
                    '59410': OperationRejected,  # You can only borrow self crypto if it supports borrowing and borrowing is enabled.
                    '59411': InsufficientFunds,  # Manual borrowing failed. Your account's free margin is insufficient
                    '59412': OperationRejected,  # Manual borrowing failed. The amount exceeds your borrowing limit.
                    '59413': OperationRejected,  # You didn't borrow self crypto. No repayment needed.
                    '59414': BadRequest,  # Manual borrowing failed. The minimum borrowing limit is {param0}.needed.
                    '59500': ExchangeError,  # Only the APIKey of the main account has permission
                    '59501': ExchangeError,  # Only 50 APIKeys can be created per account
                    '59502': ExchangeError,  # Note name cannot be duplicate with the currently created APIKey note name
                    '59503': ExchangeError,  # Each APIKey can bind up to 20 IP addresses
                    '59504': ExchangeError,  # The sub account does not support the withdrawal function
                    '59505': ExchangeError,  # The passphrase format is incorrect
                    '59506': ExchangeError,  # APIKey does not exist
                    '59507': ExchangeError,  # The two accounts involved in a transfer must be two different sub accounts under the same parent account
                    '59508': AccountSuspended,  # The sub account of {0} is suspended
                    '59515': ExchangeError,  # You are currently not on the custody whitelist. Please contact customer service for assistance.
                    '59516': ExchangeError,  # Please create the Copper custody funding account first.
                    '59517': ExchangeError,  # Please create the Komainu custody funding account first.
                    '59518': ExchangeError,  # You can’t create a sub-account using the API; please use the app or web.
                    '59519': ExchangeError,  # You can’t use self function/feature while it's frozen, due to: {freezereason}
                    '59642': BadRequest,  # Lead and copy traders can only use margin-free or single-currency margin account modes
                    '59643': ExchangeError,  # Couldn’t switch account modes’re currently copying spot trades
                    '59683': ExchangeError,  # Set self crypto collateral crypto before selecting it settlement currency.
                    '59684': BadRequest,  # Borrowing isn’t supported for self currency.
                    '59686': BadRequest,  # This crypto can’t be set settlement currency.
                    # WebSocket error Codes from 60000-63999
                    '60001': AuthenticationError,  # "OK_ACCESS_KEY" can not be empty
                    '60002': AuthenticationError,  # "OK_ACCESS_SIGN" can not be empty
                    '60003': AuthenticationError,  # "OK_ACCESS_PASSPHRASE" can not be empty
                    '60004': AuthenticationError,  # Invalid OK_ACCESS_TIMESTAMP
                    '60005': AuthenticationError,  # Invalid OK_ACCESS_KEY
                    '60006': InvalidNonce,  # Timestamp request expired
                    '60007': AuthenticationError,  # Invalid sign
                    '60008': AuthenticationError,  # Login is not supported for public channels
                    '60009': AuthenticationError,  # Login failed
                    '60010': AuthenticationError,  # Already logged in
                    '60011': AuthenticationError,  # Please log in
                    '60012': BadRequest,  # Illegal request
                    '60013': BadRequest,  # Invalid args
                    '60014': RateLimitExceeded,  # Requests too frequent
                    '60015': NetworkError,  # Connection closed was no data transmission in the last 30 seconds
                    '60016': ExchangeNotAvailable,  # Buffer is full, cannot write data
                    '60017': BadRequest,  # Invalid url path
                    '60018': BadRequest,  # The {0} {1} {2} {3} {4} does not exist
                    '60019': BadRequest,  # Invalid op {op}
                    '60020': ExchangeError,  # APIKey subscription amount exceeds the limit
                    '60021': AccountNotEnabled,  # This operation does not support multiple accounts login
                    '60022': AuthenticationError,  # Bulk login partially succeeded
                    '60023': DDoSProtection,  # Bulk login requests too frequent
                    '60024': AuthenticationError,  # Wrong passphrase
                    '60025': ExchangeError,  # Token subscription amount exceeds the limit
                    '60026': AuthenticationError,  # Batch login by APIKey and token simultaneously is not supported
                    '60027': ArgumentsRequired,  # Parameter {0} can not be empty
                    '60028': NotSupported,  # The current operation is not supported by self URL
                    '60029': AccountNotEnabled,  # Only users who are VIP5 and above in trading fee tier are allowed to subscribe to books-l2-tbt channel
                    '60030': AccountNotEnabled,  # Only users who are VIP4 and above in trading fee tier are allowed to subscribe to books50-l2-tbt channel
                    '60031': AuthenticationError,  # The WebSocket endpoint does not support multiple account batch login,
                    '60032': AuthenticationError,  # API key doesn't exist,
                    '63999': ExchangeError,  # Internal system error
                    '64000': BadRequest,  # Subscription parameter uly is unavailable anymore, please replace uly with instFamily. More details can refer to: https://www.okx.com/help-center/changes-to-v5-api-websocket-subscription-parameter-and-url,
                    '64001': BadRequest,  # This channel has been migrated to the business URL. Please subscribe using the new URL. More details can refer to: https://www.okx.com/help-center/changes-to-v5-api-websocket-subscription-parameter-and-url,
                    '64002': BadRequest,  # This channel is not supported by business URL. Please use "/private" URL(for private channels), or "/public" URL(for public channels). More details can refer to: https://www.okx.com/help-center/changes-to-v5-api-websocket-subscription-parameter-and-url,
                    '64003': AccountNotEnabled,  # Your trading fee tier doesnt meet the requirement to access self channel
                    '70010': BadRequest,  # Timestamp parameters need to be in Unix timestamp format in milliseconds.
                    '70013': BadRequest,  # endTs needs to be bigger than or equal to beginTs.
                    '70016': BadRequest,  # Please specify your instrument settings for at least one instType.
                    '70060': BadRequest,  # The account doesn’t exist or the position side is incorrect. To and from accounts must be under the same main account.
                    '70061': BadRequest,  # To move position, please enter a position that’s opposite to your current side and is smaller than or equal to your current size.
                    '70062': BadRequest,  # account has reached the maximum number of position transfers allowed per day.
                    '70064': BadRequest,  # Position does not exist.
                    '70065': BadRequest,  # Couldn’t move position. Execution price cannot be determined
                    '70066': BadRequest,  # Moving positions isn't supported in spot mode. Switch to any other account mode and try again.
                    '70067': BadRequest,  # Moving positions isn't supported in margin trading.
                    '1009': BadRequest,  # Request message exceeds the maximum frame length
                    '4001': AuthenticationError,  # Login Failed
                    '4002': BadRequest,  # Invalid Request
                    '4003': RateLimitExceeded,  # APIKey subscription amount exceeds the limit 100
                    '4004': NetworkError,  # No data received in 30s
                    '4005': ExchangeNotAvailable,  # Buffer is full, cannot write data
                    '4006': BadRequest,  # Abnormal disconnection
                    '4007': AuthenticationError,  # API key has been updated or deleted. Please reconnect.
                    '4008': RateLimitExceeded,  # The number of subscribed channels exceeds the maximum limit.
                },
                'broad': {
                    'Internal Server Error': ExchangeNotAvailable,  # {"code":500,"data":{},"detailMsg":"","error_code":"500","error_message":"Internal Server Error","msg":"Internal Server Error"}
                    'server error': ExchangeNotAvailable,  # {"code":500,"data":{},"detailMsg":"","error_code":"500","error_message":"server error 1236805249","msg":"server error 1236805249"}
                },
            },
            'httpExceptions': {
                '429': ExchangeNotAvailable,  # https://github.com/ccxt/ccxt/issues/9612
            },
            'precisionMode': TICK_SIZE,
            'options': {
                'sandboxMode': False,
                'defaultNetwork': 'ERC20',
                'defaultNetworks': {
                    'ETH': 'ERC20',
                    'BTC': 'BTC',
                    'USDT': 'TRC20',
                },
                'networks': {
                    'BTC': 'Bitcoin',
                    'BTCLN': 'Lightning',
                    'BTCLIGHTNING': 'Lightning',
                    'BSC': 'BSC',
                    'BEP20': 'BSC',
                    'BRC20': 'BRC20',
                    'ETH': 'ERC20',
                    'ERC20': 'ERC20',
                    'TRX': 'TRC20',
                    'TRC20': 'TRC20',
                    'CRC20': 'Crypto',
                    'ACA': 'Acala',
                    'ALGO': 'Algorand',
                    'APT': 'Aptos',
                    'SCROLL': 'Scroll',
                    'ARBONE': 'Arbitrum One',
                    'AVAXC': 'Avalanche C-Chain',
                    'AVAXX': 'Avalanche X-Chain',
                    'BASE': 'Base',
                    'SUI': 'SUI',
                    'ZKSYNCERA': 'zkSync Era',
                    'LINEA': 'Linea',
                    'AR': 'Arweave',
                    'ASTR': 'Astar',
                    'BCH': 'BitcoinCash',
                    'BSV': 'Bitcoin SV',
                    'ADA': 'Cardano',
                    'CSPR': 'Casper',
                    'CELO': 'CELO',
                    'XCH': 'Chia',
                    # 'CHZ': 'Chiliz', TBD: Chiliz 2.0 Chain vs Chiliz Chain
                    'ATOM': 'Cosmos',
                    'DGB': 'Digibyte',
                    'DOGE': 'Dogecoin',
                    'EGLD': 'Elrond',
                    'CFX': 'Conflux',  # CFX_EVM is different
                    'EOS': 'EOS',
                    'CORE': 'CORE',
                    'ETC': 'Ethereum Classic',
                    'ETHW': 'EthereumPow',
                    # 'FTM': 'Fantom', 'Sonic' TBD
                    'FIL': 'Filecoin',
                    'ONE': 'Harmony',
                    'HBAR': 'Hedera',
                    'ICX': 'ICON',
                    'ICP': 'Dfinity',
                    'IOST': 'IOST',
                    'IOTA': 'MIOTA',
                    'KLAY': 'Klaytn',
                    'KSM': 'Kusama',
                    'LSK': 'Lisk',
                    'LTC': 'Litecoin',
                    'METIS': 'Metis',
                    'MINA': 'Mina',
                    'GLRM': 'Moonbeam',
                    'MOVR': 'Moonriver',
                    'NANO': 'Nano',
                    'NEAR': 'NEAR',
                    'NULS': 'NULS',
                    'OASYS': 'OASYS',
                    'ONT': 'Ontology',
                    'OPTIMISM': 'Optimism',
                    # 'OP': 'Optimism', or Optimism(V2), TBD
                    'LAT': 'PlatON',
                    'DOT': 'Polkadot',
                    'MATIC': 'Polygon',
                    'RVN': 'Ravencoin',
                    'XRP': 'Ripple',
                    'SC': 'Siacoin',
                    'SOL': 'Solana',
                    'STX': 'l-Stacks',
                    'XLM': 'Stellar Lumens',
                    'XTZ': 'Tezos',
                    'TON': 'TON',
                    'THETA': 'Theta',
                    'WAX': 'Wax',
                    'ZIL': 'Zilliqa',
                    # non-supported known network: CRP. KAVA, TAIKO, BOB, GNO, BLAST, RSK, SEI, MANTLE, HYPE, RUNE, OSMO, XIN, WEMIX, HT, FSN, NEO, TLOS, CANTO, SCRT, AURORA, XMR
                    # others:
                    # "OKTC",
                    # "X Layer",
                    # "Polygon(Bridged)",
                    # "BTCK-OKTC",
                    # "ETHK-OKTC",
                    # "Starknet",
                    # "LTCK-OKTC",
                    # "XRPK-OKTC",
                    # "BCHK-OKTC",
                    # "ETCK-OKTC",
                    # "Endurance Smart Chain",
                    # "Berachain",
                    # "CELO-TOKEN",
                    # "CFX_EVM",
                    # "Cortex",
                    # "DAIK-OKTC",
                    # "Dora Vota Mainnet",
                    # "DOTK-OKTC",
                    # "DYDX",
                    # "AELF",
                    # "Enjin Relay Chain",
                    # "FEVM",
                    # "FILK-OKTC",
                    # "Flare",
                    # "Gravity Alpha Mainnet",
                    # "INJ",
                    # "Story",
                    # "LINKK-OKTC",
                    # "Terra",
                    # "Terra Classic",
                    # "Terra Classic(USTC)",
                    # "MERLIN Network",
                    # "Layer 3",
                    # "PI",
                    # "Ronin",
                    # "Quantum",
                    # "SHIBK-OKTC",
                    # "SUSHIK-OKTC",
                    # "Celestia",
                    # "TRXK-OKTC",
                    # "UNIK-OKTC",
                    # "Venom",
                    # "WBTCK-OKTC",
                    # "ZetaChain",
                },
                'networksById': {
                    'ERC20': 'ERC20',
                    'TRC20': 'TRC20',
                    'BEP20': 'BEP20',
                },
                'fetchOpenInterestHistory': {
                    'timeframes': {
                        '5m': '5m',
                        '1h': '1H',
                        '8h': '8H',
                        '1d': '1D',
                        '5M': '5m',
                        '1H': '1H',
                        '8H': '8H',
                        '1D': '1D',
                    },
                },
                'fetchOHLCV': {
                    # 'type': 'Candles',  # Candles or HistoryCandles, IndexCandles, MarkPriceCandles
                    'timezone': 'UTC',  # UTC, HK
                },
                'fetchPositions': {
                    'method': 'privateGetAccountPositions',  # privateGetAccountPositions or privateGetAccountPositionsHistory
                },
                'createOrder': 'privatePostTradeBatchOrders',  # or 'privatePostTradeOrder' or 'privatePostTradeOrderAlgo'
                'createMarketBuyOrderRequiresPrice': False,
                'fetchMarkets': {
                    'types': ['spot', 'future', 'swap', 'option'],  # spot, future, swap, option
                },
                'timeDifference': 0,  # the difference between system clock and exchange server clock
                'adjustForTimeDifference': False,  # controls the adjustment logic upon instantiation
                'defaultType': 'spot',  # 'funding', 'spot', 'margin', 'future', 'swap', 'option'
                # 'fetchBalance': {
                #     'type': 'spot',  # 'funding', 'trading', 'spot'
                # },
                'fetchLedger': {
                    'method': 'privateGetAccountBills',  # privateGetAccountBills, privateGetAccountBillsArchive, privateGetAssetBills
                },
                # 6: Funding account, 18: Trading account
                'fetchOrder': {
                    'method': 'privateGetTradeOrder',  # privateGetTradeOrdersAlgoHistory
                },
                'fetchOpenOrders': {
                    'method': 'privateGetTradeOrdersPending',  # privateGetTradeOrdersAlgoPending
                },
                'cancelOrders': {
                    'method': 'privatePostTradeCancelBatchOrders',  # privatePostTradeCancelAlgos
                },
                'fetchCanceledOrders': {
                    'method': 'privateGetTradeOrdersHistory',  # privateGetTradeOrdersAlgoHistory
                },
                'fetchClosedOrders': {
                    'method': 'privateGetTradeOrdersHistory',  # privateGetTradeOrdersAlgoHistory
                },
                'withdraw': {
                    # a funding password credential is required by the exchange for the
                    # withdraw call(not to be confused with the api password credential)
                    'password': None,
                    'pwd': None,  # password or pwd both work
                },
                'algoOrderTypes': {
                    'conditional': True,
                    'trigger': True,
                    'oco': True,
                    'move_order_stop': True,
                    'iceberg': True,
                    'twap': True,
                },
                'accountsByType': {
                    'funding': '6',
                    'trading': '18',  # unified trading account
                    'spot': '18',
                    'future': '18',
                    'futures': '18',
                    'margin': '18',
                    'swap': '18',
                    'option': '18',
                },
                'accountsById': {
                    '6': 'funding',
                    '18': 'trading',  # unified trading account
                },
                'exchangeType': {
                    'spot': 'SPOT',
                    'margin': 'MARGIN',
                    'swap': 'SWAP',
                    'future': 'FUTURES',
                    'futures': 'FUTURES',  # deprecated
                    'option': 'OPTION',
                    'SPOT': 'SPOT',
                    'MARGIN': 'MARGIN',
                    'SWAP': 'SWAP',
                    'FUTURES': 'FUTURES',
                    'OPTION': 'OPTION',
                },
                'brokerId': '6b9ad766b55dBCDE',
            },
            'features': {
                'default': {
                    'sandbox': True,
                    'createOrder': {
                        'marginMode': True,
                        'triggerPrice': True,
                        'triggerPriceType': {
                            'last': True,
                            'mark': True,
                            'index': True,
                        },
                        'triggerDirection': False,
                        'stopLossPrice': True,
                        'takeProfitPrice': True,
                        'attachedStopLossTakeProfit': {
                            'triggerPriceType': {
                                'last': True,
                                'mark': True,
                                'index': True,
                            },
                            'price': True,
                        },
                        'timeInForce': {
                            'IOC': True,
                            'FOK': True,
                            'PO': True,
                            'GTD': False,
                        },
                        'hedged': True,
                        'trailing': True,
                        'iceberg': True,  # todo implement
                        'leverage': False,
                        'selfTradePrevention': True,  # todo implement
                        'marketBuyByCost': True,
                        'marketBuyRequiresPrice': False,
                    },
                    'createOrders': {
                        'max': 20,
                    },
                    'fetchMyTrades': {
                        'marginMode': False,
                        'daysBack': 90,
                        'limit': 100,
                        'untilDays': 10000,
                        'symbolRequired': False,
                    },
                    'fetchOrder': {
                        'marginMode': False,
                        'trigger': True,
                        'trailing': True,
                        'symbolRequired': True,
                    },
                    'fetchOpenOrders': {
                        'marginMode': False,
                        'limit': 100,
                        'trigger': True,
                        'trailing': True,
                        'symbolRequired': False,
                    },
                    'fetchOrders': None,  # not supported
                    'fetchClosedOrders': {
                        'marginMode': False,
                        'limit': 100,
                        'daysBack': 90,  # 3 months
                        'daysBackCanceled': 1 / 12,  # 2 hour
                        'untilDays': None,
                        'trigger': True,
                        'trailing': True,
                        'symbolRequired': False,
                    },
                    'fetchOHLCV': {
                        'limit': 300,  # regular candles(recent & historical) both have 300 max
                        'mark': 100,
                        'index': 100,
                    },
                },
                'spot': {
                    'extends': 'default',
                    'fetchCurrencies': {
                        'private': True,
                    },
                },
                'swap': {
                    'linear': {
                        'extends': 'default',
                    },
                    'inverse': {
                        'extends': 'default',
                    },
                },
                'future': {
                    'linear': {
                        'extends': 'default',
                    },
                    'inverse': {
                        'extends': 'default',
                    },
                },
            },
            'currencies': {
                'USD': self.safe_currency_structure({'id': 'USD', 'code': 'USD', 'precision': self.parse_number('0.0001')}),
                'EUR': self.safe_currency_structure({'id': 'EUR', 'code': 'EUR', 'precision': self.parse_number('0.0001')}),
                'AED': self.safe_currency_structure({'id': 'AED', 'code': 'AED', 'precision': self.parse_number('0.0001')}),
                'GBP': self.safe_currency_structure({'id': 'GBP', 'code': 'GBP', 'precision': self.parse_number('0.0001')}),
                'AUD': self.safe_currency_structure({'id': 'AUD', 'code': 'AUD', 'precision': self.parse_number('0.0001')}),
            },
            'commonCurrencies': {
                # the exchange refers to ERC20 version of Aeternity(AEToken)
                'AE': 'AET',  # https://github.com/ccxt/ccxt/issues/4981
            },
            'rollingWindowSize': 0.0,  # okx always receives rateLimitExceeded with rolling window
        })

    def handle_market_type_and_params(self, methodName: str, market: Market = None, params={}, defaultValue=None) -> Any:
        instType = self.safe_string(params, 'instType')
        params = self.omit(params, 'instType')
        type = self.safe_string(params, 'type')
        if (type is None) and (instType is not None):
            params['type'] = instType
        return super(okx, self).handle_market_type_and_params(methodName, market, params, defaultValue)

    def convert_to_instrument_type(self, type):
        exchangeTypes = self.safe_dict(self.options, 'exchangeType', {})
        return self.safe_string(exchangeTypes, type, type)

    def create_expired_option_market(self, symbol: str):
        # support expired option contracts
        quote = 'USD'
        optionParts = symbol.split('-')
        symbolBase = symbol.split('/')
        base = None
        if symbol.find('/') > -1:
            base = self.safe_string(symbolBase, 0)
        else:
            base = self.safe_string(optionParts, 0)
        settle = base
        expiry = self.safe_string(optionParts, 2)
        strike = self.safe_string(optionParts, 3)
        optionType = self.safe_string(optionParts, 4)
        datetime = self.convert_expire_date(expiry)
        timestamp = self.parse8601(datetime)
        return {
            'id': base + '-' + quote + '-' + expiry + '-' + strike + '-' + optionType,
            'symbol': base + '/' + quote + ':' + settle + '-' + expiry + '-' + strike + '-' + optionType,
            'base': base,
            'quote': quote,
            'settle': settle,
            'baseId': base,
            'quoteId': quote,
            'settleId': settle,
            'active': False,
            'type': 'option',
            'linear': None,
            'inverse': None,
            'spot': False,
            'swap': False,
            'future': False,
            'option': True,
            'margin': False,
            'contract': True,
            'contractSize': self.parse_number('1'),
            'expiry': timestamp,
            'expiryDatetime': datetime,
            'optionType': 'call' if (optionType == 'C') else 'put',
            'strike': self.parse_number(strike),
            'precision': {
                'amount': None,
                'price': None,
            },
            'limits': {
                'amount': {
                    'min': None,
                    'max': None,
                },
                'price': {
                    'min': None,
                    'max': None,
                },
                'cost': {
                    'min': None,
                    'max': None,
                },
            },
            'info': None,
        }

    def safe_market(self, marketId: Str = None, market: Market = None, delimiter: Str = None, marketType: Str = None) -> MarketInterface:
        isOption = (marketId is not None) and ((marketId.find('-C') > -1) or (marketId.find('-P') > -1))
        if isOption and not (marketId in self.markets_by_id):
            # handle expired option contracts
            return self.create_expired_option_market(marketId)
        return super(okx, self).safe_market(marketId, market, delimiter, marketType)

    def fetch_status(self, params={}):
        """
        the latest known information on the availability of the exchange API

        https://www.okx.com/docs-v5/en/#status-get-status

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `status structure <https://docs.ccxt.com/?id=exchange-status-structure>`
        """
        response = self.publicGetSystemStatus(params)
        #
        # Note, if there is no maintenance around, the 'data' array is empty
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "begin": "1621328400000",
        #                 "end": "1621329000000",
        #                 "href": "https://www.okx.com/support/hc/en-us/articles/360060882172",
        #                 "scheDesc": "",
        #                 "serviceType": "1",  # 0 WebSocket, 1 Spot/Margin, 2 Futures, 3 Perpetual, 4 Options, 5 Trading service
        #                 "state": "scheduled",  # ongoing, completed, canceled
        #                 "system": "classic",  # classic, unified
        #                 "title": "Classic Spot System Upgrade"
        #             },
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        dataLength = len(data)
        update: dict = {
            'updated': None,
            'status': 'ok' if (dataLength == 0) else 'maintenance',
            'eta': None,
            'url': None,
            'info': response,
        }
        for i in range(0, len(data)):
            event = data[i]
            state = self.safe_string(event, 'state')
            update['eta'] = self.safe_integer(event, 'end')
            update['url'] = self.safe_string(event, 'href')
            if state == 'ongoing':
                update['status'] = 'maintenance'
            elif state == 'scheduled':
                update['status'] = 'ok'
            elif state == 'completed':
                update['status'] = 'ok'
            elif state == 'canceled':
                update['status'] = 'ok'
        return update

    def fetch_time(self, params={}) -> Int:
        """
        fetches the current integer timestamp in milliseconds from the exchange server

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-system-time

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns int: the current integer timestamp in milliseconds from the exchange server
        """
        response = self.publicGetPublicTime(params)
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {"ts": "1621247923668"}
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        return self.safe_integer(first, 'ts')

    def fetch_accounts(self, params={}) -> List[Account]:
        """
        fetch all the accounts associated with a profile

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-account-configuration

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `account structures <https://docs.ccxt.com/?id=account-structure>` indexed by the account type
        """
        response = self.privateGetAccountConfig(params)
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "acctLv": "2",
        #                 "acctStpMode": "cancel_maker",
        #                 "autoLoan": False,
        #                 "ctIsoMode": "automatic",
        #                 "enableSpotBorrow": False,
        #                 "greeksType": "PA",
        #                 "feeType": "0",
        #                 "ip": "",
        #                 "type": "0",
        #                 "kycLv": "3",
        #                 "label": "v5 test",
        #                 "level": "Lv1",
        #                 "levelTmp": "",
        #                 "liquidationGear": "-1",
        #                 "mainUid": "44705892343619584",
        #                 "mgnIsoMode": "automatic",
        #                 "opAuth": "1",
        #                 "perm": "read_only,withdraw,trade",
        #                 "posMode": "long_short_mode",
        #                 "roleType": "0",
        #                 "spotBorrowAutoRepay": False,
        #                 "spotOffsetType": "",
        #                 "spotRoleType": "0",
        #                 "spotTraderInsts": [],
        #                 "traderInsts": [],
        #                 "uid": "44705892343619584",
        #                 "settleCcy": "USDT",
        #                 "settleCcyList": ["USD", "USDC", "USDG"],
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        result = []
        for i in range(0, len(data)):
            account = data[i]
            accountId = self.safe_string(account, 'uid')
            type = self.safe_string(account, 'acctLv')
            result.append({
                'id': accountId,
                'type': type,
                'currency': None,
                'info': account,
                'code': None,
            })
        return result

    def nonce(self):
        return self.milliseconds() - self.options['timeDifference']

    def fetch_markets(self, params={}) -> List[Market]:
        """
        retrieves data on all markets for okx

        https://www.okx.com/docs-v5/en/#rest-api-public-data-get-instruments

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict[]: an array of objects representing market data
        """
        if self.options['adjustForTimeDifference']:
            self.load_time_difference()
        types = ['spot', 'future', 'swap', 'option']
        fetchMarketsOption = self.safe_dict(self.options, 'fetchMarkets')
        if fetchMarketsOption is not None:
            types = self.safe_list(fetchMarketsOption, 'types', types)
        else:
            types = self.safe_list(self.options, 'fetchMarkets', types)  # backward-support
        promises = []
        result = []
        for i in range(0, len(types)):
            promises.append(self.fetch_markets_by_type(types[i], params))
        promises = promises
        for i in range(0, len(promises)):
            result = self.array_concat(result, promises[i])
        return result

    def parse_market(self, market: dict) -> Market:
        #
        #     {
        #         "alias": "",  # self_week, next_week, quarter, next_quarter
        #         "baseCcy": "BTC",
        #         "category": "1",
        #         "ctMult": "",
        #         "ctType": "",  # inverse, linear
        #         "ctVal": "",
        #         "ctValCcy": "",
        #         "expTime": "",
        #         "instId": "BTC-USDT",  # BTC-USD-210521, CSPR-USDT-SWAP, BTC-USD-210517-44000-C
        #         "instType": "SPOT",  # SPOT, FUTURES, SWAP, OPTION
        #         "lever": "10",
        #         "listTime": "1548133413000",
        #         "lotSz": "0.00000001",
        #         "minSz": "0.00001",
        #         "optType": "",
        #         "quoteCcy": "USDT",
        #         "settleCcy": "",
        #         "state": "live",
        #         "stk": "",
        #         "tickSz": "0.1",
        #         "uly": ""
        #     }
        #
        #     {
        #         "alias": "",
        #         "baseCcy": "",
        #         "category": "1",
        #         "ctMult": "0.1",
        #         "ctType": "",
        #         "ctVal": "1",
        #         "ctValCcy": "BTC",
        #         "expTime": "1648195200000",
        #         "instId": "BTC-USD-220325-194000-P",
        #         "instType": "OPTION",
        #         "lever": "",
        #         "listTime": "1631262612280",
        #         "contTdSwTime": "1631262812280",
        #         "lotSz": "1",
        #         "minSz": "1",
        #         "optType": "P",
        #         "quoteCcy": "",
        #         "settleCcy": "BTC",
        #         "state": "live",
        #         "stk": "194000",
        #         "tickSz": "0.0005",
        #         "uly": "BTC-USD"
        #     }
        #
        # for swap "preopen" markets, only `instId` and `instType` are present
        #
        #         instId: "ETH-USD_UM-SWAP",
        #         instType: "SWAP",
        #         state: "preopen",
        #
        id = self.safe_string(market, 'instId')
        type = self.safe_string_lower(market, 'instType')
        if type == 'futures':
            type = 'future'
        spot = (type == 'spot')
        future = (type == 'future')
        swap = (type == 'swap')
        option = (type == 'option')
        contract = swap or future or option
        baseId = self.safe_string(market, 'baseCcy', '')  # defaulting to '' because some weird preopen markets have empty baseId
        quoteId = self.safe_string(market, 'quoteCcy', '')
        settleId = self.safe_string(market, 'settleCcy')
        settle = self.safe_currency_code(settleId)
        underlying = self.safe_string(market, 'uly')
        if (underlying is not None) and not spot:
            parts = underlying.split('-')
            baseId = self.safe_string(parts, 0)
            quoteId = self.safe_string(parts, 1)
        if ((baseId == '') or (quoteId == '')) and spot:  # to fix weird preopen markets
            instId = self.safe_string(market, 'instId', '')
            parts = instId.split('-')
            baseId = self.safe_string(parts, 0)
            quoteId = self.safe_string(parts, 1)
        base = self.safe_currency_code(baseId)
        quote = self.safe_currency_code(quoteId)
        symbol = base + '/' + quote
        # handle preopen empty markets
        if base == '' or quote == '':
            symbol = id
        expiry = None
        strikePrice = None
        optionType = None
        if contract:
            if settle is not None:
                symbol = symbol + ':' + settle
            if future:
                expiry = self.safe_integer(market, 'expTime')
                if expiry is not None:
                    ymd = self.yymmdd(expiry)
                    symbol = symbol + '-' + ymd
            elif option:
                expiry = self.safe_integer(market, 'expTime')
                strikePrice = self.safe_string(market, 'stk')
                optionType = self.safe_string(market, 'optType')
                if expiry is not None:
                    ymd = self.yymmdd(expiry)
                    symbol = symbol + '-' + ymd + '-' + strikePrice + '-' + optionType
                    optionType = 'put' if (optionType == 'P') else 'call'
        fees = self.safe_dict_2(self.fees, type, 'trading', {})
        maxLeverage = self.safe_string(market, 'lever', '1')
        maxLeverage = Precise.string_max(maxLeverage, '1')
        maxSpotCost = self.safe_number(market, 'maxMktSz')
        status = self.safe_string(market, 'state')
        instIdCode = self.safe_integer(market, 'instIdCode')
        return self.extend(fees, {
            'id': id,
            'instIdCode': instIdCode,
            'symbol': symbol,
            'base': base,
            'quote': quote,
            'settle': settle,
            'baseId': baseId,
            'quoteId': quoteId,
            'settleId': settleId,
            'type': type,
            'spot': spot,
            'margin': spot and (Precise.string_gt(maxLeverage, '1')),
            'swap': swap,
            'future': future,
            'option': option,
            'active': status == 'live',
            'contract': contract,
            'linear': (quoteId == settleId) if contract else None,
            'inverse': (baseId == settleId) if contract else None,
            'contractSize': self.safe_number(market, 'ctVal') if contract else None,
            'expiry': expiry,
            'expiryDatetime': self.iso8601(expiry),
            'strike': self.parse_number(strikePrice),
            'optionType': optionType,
            'created': self.safe_integer_2(market, 'contTdSwTime', 'listTime'),  # contTdSwTime is public trading start time, while listTime considers pre-trading too
            'precision': {
                'amount': self.safe_number(market, 'lotSz'),
                'price': self.safe_number(market, 'tickSz'),
            },
            'limits': {
                'leverage': {
                    'min': self.parse_number('1'),
                    'max': self.parse_number(maxLeverage),
                },
                'amount': {
                    'min': self.safe_number(market, 'minSz'),
                    'max': None,
                },
                'price': {
                    'min': None,
                    'max': None,
                },
                'cost': {
                    'min': None,
                    'max': None if contract else maxSpotCost,
                },
            },
            'info': market,
        })

    def fetch_markets_by_type(self, type, params={}):
        request: dict = {
            'instType': self.convert_to_instrument_type(type),
        }
        if type == 'option':
            optionsUnderlying = self.safe_list(self.options, 'defaultUnderlying', ['BTC-USD', 'ETH-USD'])
            promises = []
            for i in range(0, len(optionsUnderlying)):
                underlying = optionsUnderlying[i]
                request['uly'] = underlying
                promises.append(self.publicGetPublicInstruments(self.extend(request, params)))
            promisesResult = promises
            markets = []
            for i in range(0, len(promisesResult)):
                res = self.safe_dict(promisesResult, i, {})
                options = self.safe_list(res, 'data', [])
                markets = self.array_concat(markets, options)
            return self.parse_markets(markets)
        response = self.publicGetPublicInstruments(self.extend(request, params))
        #
        # spot, future, swap, option
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "alias": "",  # self_week, next_week, quarter, next_quarter
        #                 "baseCcy": "BTC",
        #                 "category": "1",
        #                 "ctMult": "",
        #                 "ctType": "",  # inverse, linear
        #                 "ctVal": "",
        #                 "ctValCcy": "",
        #                 "expTime": "",
        #                 "instId": "BTC-USDT",  # BTC-USD-210521, CSPR-USDT-SWAP, BTC-USD-210517-44000-C
        #                 "instType": "SPOT",  # SPOT, FUTURES, SWAP, OPTION
        #                 "lever": "10",
        #                 "listTime": "1548133413000",
        #                 "lotSz": "0.00000001",
        #                 "minSz": "0.00001",
        #                 "optType": "",
        #                 "quoteCcy": "USDT",
        #                 "settleCcy": "",
        #                 "state": "live",
        #                 "stk": "",
        #                 "tickSz": "0.1",
        #                 "uly": ""
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        dataResponse = self.safe_list(response, 'data', [])
        marketsWithoutTest = []
        for i in range(0, len(dataResponse)):
            data = dataResponse[i]
            if self.isSandboxModeEnabled:
                instFamily = self.safe_string(data, 'instFamily', '')
                if instFamily.startswith('TEST'):
                    continue
            marketsWithoutTest.append(data)
        return self.parse_markets(marketsWithoutTest)

    def fetch_currencies(self, params={}) -> Currencies:
        """
        fetches all available currencies on an exchange

        https://www.okx.com/docs-v5/en/#rest-api-funding-get-currencies

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: an associative dictionary of currencies
        """
        # self endpoint requires authentication
        # while fetchCurrencies is a public API method by design
        # therefore we check the keys here
        # and fallback to generating the currencies from the markets
        isSandboxMode = self.safe_bool(self.options, 'sandboxMode', False)
        if not self.check_required_credentials(False) or isSandboxMode:
            return {}
        #
        # has['fetchCurrencies'] is currently set to True, but an unauthorized request returns
        #
        #     {"msg":"Request header “OK_ACCESS_KEY“ can't be empty.","code":"50103"}
        #
        response = self.privateGetAssetCurrencies(params)
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "canDep": True,
        #                "canInternal": False,
        #                "canWd": True,
        #                "ccy": "USDT",
        #                "chain": "USDT-TRC20",
        #                "logoLink": "https://static.coinall.ltd/cdn/assets/imgs/221/5F74EB20302D7761.png",
        #                "mainNet": False,
        #                "maxFee": "1.6",
        #                "maxWd": "8852150",
        #                "minFee": "0.8",
        #                "minWd": "2",
        #                "name": "Tether",
        #                "usedWdQuota": "0",
        #                "wdQuota": "500",
        #                "wdTickSz": "3"
        #            },
        #            {
        #                "canDep": True,
        #                "canInternal": False,
        #                "canWd": True,
        #                "ccy": "USDT",
        #                "chain": "USDT-ERC20",
        #                "logoLink": "https://static.coinall.ltd/cdn/assets/imgs/221/5F74EB20302D7761.png",
        #                "mainNet": False,
        #                "maxFee": "16",
        #                "maxWd": "8852150",
        #                "minFee": "8",
        #                "minWd": "2",
        #                "name": "Tether",
        #                "usedWdQuota": "0",
        #                "wdQuota": "500",
        #                "wdTickSz": "3"
        #            },
        #            ...
        #        ],
        #        "msg": ""
        #    }
        #
        data = self.safe_list(response, 'data', [])
        dataByCurrencyId = self.group_by(data, 'ccy')
        currencies = list(dataByCurrencyId.values())
        return self.parse_currencies(currencies)

    def parse_currency(self, currency: dict) -> Currency:
        chains = currency
        # currencies are grouped by chain entries, so there is at least one entry
        firstChain = self.safe_dict(chains, 0, {})
        currencyId = self.safe_string(firstChain, 'ccy')
        code = self.safe_currency_code(currencyId)
        networks: dict = {}
        type = 'crypto'
        chainsLength = len(chains)
        for j in range(0, chainsLength):
            chain = chains[j]
            # allow empty string for rare fiat-currencies, e.g. TRY
            networkId = self.safe_string(chain, 'chain', '')  # USDT-BEP20, USDT-Avalance-C, etc
            if networkId == '':
                # only happens for fiat 'TRY' currency
                type = 'fiat'
            idParts = networkId.split('-')
            parts = self.array_slice(idParts, 1)
            chainPart = '-'.join(parts)
            networkCode = self.network_id_to_code(chainPart, code)
            networks[networkCode] = {
                'id': networkId,
                'network': networkCode,
                'active': None,
                'deposit': self.safe_bool(chain, 'canDep'),
                'withdraw': self.safe_bool(chain, 'canWd'),
                'fee': self.safe_number(chain, 'fee'),
                'precision': self.parse_number(self.parse_precision(self.safe_string(chain, 'wdTickSz'))),
                'limits': {
                    'withdraw': {
                        'min': self.safe_number(chain, 'minWd'),
                        'max': self.safe_number(chain, 'maxWd'),
                    },
                },
                'info': chain,
            }
        return self.safe_currency_structure({
            'info': chains,
            'code': code,
            'id': currencyId,
            'name': self.safe_string(firstChain, 'name'),
            'active': None,
            'deposit': None,
            'withdraw': None,
            'fee': None,
            'precision': None,
            'limits': {
                'amount': {
                    'min': None,
                    'max': None,
                },
            },
            'type': type,
            'networks': networks,
        })

    def fetch_order_book(self, symbol: str, limit: Int = None, params={}) -> OrderBook:
        """
        fetches information on open orders with bid(buy) and ask(sell) prices, volumes and other data

        https://www.okx.com/docs-v5/en/#order-book-trading-market-data-get-order-book

        :param str symbol: unified symbol of the market to fetch the order book for
        :param int [limit]: the maximum amount of order book entries to return
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.method]: 'publicGetMarketBooksFull' or 'publicGetMarketBooks' default is 'publicGetMarketBooks'
        :returns dict: A dictionary of `order book structures <https://docs.ccxt.com/?id=order-book-structure>` indexed by market symbols
        """
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        method = None
        method, params = self.handle_option_and_params(params, 'fetchOrderBook', 'method', 'publicGetMarketBooks')
        if method == 'publicGetMarketBooksFull' and limit is None:
            limit = 5000
        limit = 100 if (limit is None) else limit
        if limit is not None:
            request['sz'] = limit  # max 400
        response = None
        if (method == 'publicGetMarketBooksFull') or (limit > 400):
            response = self.publicGetMarketBooksFull(self.extend(request, params))
        else:
            response = self.publicGetMarketBooks(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "asks": [
        #                     ["0.07228","4.211619","0","2"],  # price, amount, liquidated orders, total open orders
        #                     ["0.0723","299.880364","0","2"],
        #                     ["0.07231","3.72832","0","1"],
        #                 ],
        #                 "bids": [
        #                     ["0.07221","18.5","0","1"],
        #                     ["0.0722","18.5","0","1"],
        #                     ["0.07219","0.505407","0","1"],
        #                 ],
        #                 "ts": "1621438475342"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        timestamp = self.safe_integer(first, 'ts')
        return self.parse_order_book(first, symbol, timestamp)

    def parse_ticker(self, ticker: dict, market: Market = None) -> Ticker:
        #
        #      {
        #          "instType":"SWAP",
        #          "instId":"BTC-USDT-SWAP",
        #          "markPx":"200",
        #          "ts":"1597026383085"
        #      }
        #
        #     {
        #         "instType": "SPOT",
        #         "instId": "ETH-BTC",
        #         "last": "0.07319",
        #         "lastSz": "0.044378",
        #         "askPx": "0.07322",
        #         "askSz": "4.2",
        #         "bidPx": "0.0732",
        #         "bidSz": "6.050058",
        #         "open24h": "0.07801",
        #         "high24h": "0.07975",
        #         "low24h": "0.06019",
        #         "volCcy24h": "11788.887619",
        #         "vol24h": "167493.829229",
        #         "ts": "1621440583784",
        #         "sodUtc0": "0.07872",
        #         "sodUtc8": "0.07345"
        #     }
        #     {
        #          instId: 'LTC-USDT',
        #          idxPx: '65.74',
        #          open24h: '65.37',
        #          high24h: '66.15',
        #          low24h: '64.97',
        #          sodUtc0: '65.68',
        #          sodUtc8: '65.54',
        #          ts: '1728467346900'
        #     },
        #
        timestamp = self.safe_integer(ticker, 'ts')
        marketId = self.safe_string(ticker, 'instId')
        market = self.safe_market(marketId, market, '-')
        symbol = market['symbol']
        last = self.safe_string(ticker, 'last')
        open = self.safe_string(ticker, 'open24h')
        spot = self.safe_bool(market, 'spot', False)
        quoteVolume = self.safe_string(ticker, 'volCcy24h') if spot else None
        baseVolume = self.safe_string(ticker, 'vol24h')
        high = self.safe_string(ticker, 'high24h')
        low = self.safe_string(ticker, 'low24h')
        return self.safe_ticker({
            'symbol': symbol,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'high': high,
            'low': low,
            'bid': self.safe_string(ticker, 'bidPx'),
            'bidVolume': self.safe_string(ticker, 'bidSz'),
            'ask': self.safe_string(ticker, 'askPx'),
            'askVolume': self.safe_string(ticker, 'askSz'),
            'vwap': None,
            'open': open,
            'close': last,
            'last': last,
            'previousClose': None,
            'change': None,
            'percentage': None,
            'average': None,
            'baseVolume': baseVolume,
            'quoteVolume': quoteVolume,
            'markPrice': self.safe_string(ticker, 'markPx'),
            'indexPrice': self.safe_string(ticker, 'idxPx'),
            'info': ticker,
        }, market)

    def fetch_ticker(self, symbol: str, params={}) -> Ticker:
        """
        fetches a price ticker, a statistical calculation with the information calculated over the past 24 hours for a specific market

        https://www.okx.com/docs-v5/en/#order-book-trading-market-data-get-ticker

        :param str symbol: unified symbol of the market to fetch the ticker for
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `ticker structure <https://docs.ccxt.com/?id=ticker-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        response = self.publicGetMarketTicker(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "instType": "SPOT",
        #                 "instId": "ETH-BTC",
        #                 "last": "0.07319",
        #                 "lastSz": "0.044378",
        #                 "askPx": "0.07322",
        #                 "askSz": "4.2",
        #                 "bidPx": "0.0732",
        #                 "bidSz": "6.050058",
        #                 "open24h": "0.07801",
        #                 "high24h": "0.07975",
        #                 "low24h": "0.06019",
        #                 "volCcy24h": "11788.887619",
        #                 "vol24h": "167493.829229",
        #                 "ts": "1621440583784",
        #                 "sodUtc0": "0.07872",
        #                 "sodUtc8": "0.07345"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        return self.parse_ticker(first, market)

    def fetch_tickers(self, symbols: Strings = None, params={}) -> Tickers:
        """
        fetches price tickers for multiple markets, statistical information calculated over the past 24 hours for each market

        https://www.okx.com/docs-v5/en/#order-book-trading-market-data-get-tickers

        :param str[] [symbols]: unified symbols of the markets to fetch the ticker for, all market tickers are returned if not assigned
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `ticker structures <https://docs.ccxt.com/?id=ticker-structure>`
        """
        self.load_markets()
        symbols = self.market_symbols(symbols)
        market = self.get_market_from_symbols(symbols)
        marketType = None
        marketType, params = self.handle_market_type_and_params('fetchTickers', market, params)
        request: dict = {
            'instType': self.convert_to_instrument_type(marketType),
        }
        if marketType == 'option':
            defaultUnderlying = self.safe_string(self.options, 'defaultUnderlying', 'BTC-USD')
            currencyId = self.safe_string_2(params, 'uly', 'marketId', defaultUnderlying)
            if currencyId is None:
                raise ArgumentsRequired(self.id + ' fetchTickers() requires an underlying uly or marketId parameter for options markets')
            else:
                request['uly'] = currencyId
        response = self.publicGetMarketTickers(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "instType": "SPOT",
        #                 "instId": "BCD-BTC",
        #                 "last": "0.0000769",
        #                 "lastSz": "5.4788",
        #                 "askPx": "0.0000777",
        #                 "askSz": "3.2197",
        #                 "bidPx": "0.0000757",
        #                 "bidSz": "4.7509",
        #                 "open24h": "0.0000885",
        #                 "high24h": "0.0000917",
        #                 "low24h": "0.0000596",
        #                 "volCcy24h": "9.2877",
        #                 "vol24h": "124824.1985",
        #                 "ts": "1621441741434",
        #                 "sodUtc0": "0.0000905",
        #                 "sodUtc8": "0.0000729"
        #             },
        #         ]
        #     }
        #
        tickers = self.safe_list(response, 'data', [])
        return self.parse_tickers(tickers, symbols)

    def fetch_mark_price(self, symbol: str, params={}) -> Ticker:
        """
        fetches mark price for the market

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-mark-price

        :param str symbol: unified symbol of the market to fetch the ticker for
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `ticker structures <https://docs.ccxt.com/?id=ticker-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        response = self.publicGetPublicMarkPrice(self.extend(request, params))
        #
        # {
        #     "code": "0",
        #     "data": [
        #         {
        #             "instId": "ETH-USDT",
        #             "instType": "MARGIN",
        #             "markPx": "2403.98",
        #             "ts": "1728578500703"
        #         }
        #     ],
        #     "msg": ""
        # }
        #
        data = self.safe_list(response, 'data')
        return self.parse_ticker(self.safe_dict(data, 0), market)

    def fetch_mark_prices(self, symbols: Strings = None, params={}) -> Tickers:
        """
        fetches price tickers for multiple markets, statistical information calculated over the past 24 hours for each market

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-mark-price

        :param str[] [symbols]: unified symbols of the markets to fetch the ticker for, all market tickers are returned if not assigned
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `ticker structures <https://docs.ccxt.com/?id=ticker-structure>`
        """
        self.load_markets()
        symbols = self.market_symbols(symbols)
        market = self.get_market_from_symbols(symbols)
        marketType = None
        marketType, params = self.handle_market_type_and_params('fetchTickers', market, params, 'swap')
        request: dict = {
            'instType': self.convert_to_instrument_type(marketType),
        }
        if marketType == 'option':
            defaultUnderlying = self.safe_string(self.options, 'defaultUnderlying', 'BTC-USD')
            currencyId = self.safe_string_2(params, 'uly', 'marketId', defaultUnderlying)
            if currencyId is None:
                raise ArgumentsRequired(self.id + ' fetchMarkPrices() requires an underlying uly or marketId parameter for options markets')
            else:
                request['uly'] = currencyId
        response = self.publicGetPublicMarkPrice(self.extend(request, params))
        tickers = self.safe_list(response, 'data', [])
        return self.parse_tickers(tickers, symbols)

    def parse_trade(self, trade: dict, market: Market = None) -> Trade:
        #
        # public fetchTrades
        #
        #     {
        #         "instId": "ETH-BTC",
        #         "side": "sell",
        #         "sz": "0.119501",
        #         "px": "0.07065",
        #         "tradeId": "15826757",
        #         "ts": "1621446178316"
        #     }
        #
        # option: fetchTrades
        #
        #     {
        #         "fillVol": "0.46387625976562497",
        #         "fwdPx": "26299.754935451125",
        #         "indexPx": "26309.7",
        #         "instFamily": "BTC-USD",
        #         "instId": "BTC-USD-230526-26000-C",
        #         "markPx": "0.042386283557554236",
        #         "optType": "C",
        #         "px": "0.0415",
        #         "side": "sell",
        #         "sz": "90",
        #         "tradeId": "112",
        #         "ts": "1683907480154"
        #     }
        #
        # private fetchMyTrades
        #
        #     {
        #         "side": "buy",
        #         "fillSz": "0.007533",
        #         "fillPx": "2654.98",
        #         "fee": "-0.000007533",
        #         "ordId": "317321390244397056",
        #         "instType": "SPOT",
        #         "instId": "ETH-USDT",
        #         "clOrdId": "",
        #         "posSide": "net",
        #         "billId": "317321390265368576",
        #         "tag": "0",
        #         "execType": "T",
        #         "tradeId": "107601752",
        #         "feeCcy": "ETH",
        #         "ts": "1621927314985"
        #     }
        #
        id = self.safe_string(trade, 'tradeId')
        marketId = self.safe_string(trade, 'instId')
        market = self.safe_market(marketId, market, '-')
        symbol = market['symbol']
        timestamp = self.safe_integer(trade, 'ts')
        price = self.safe_string_2(trade, 'fillPx', 'px')
        amount = self.safe_string_2(trade, 'fillSz', 'sz')
        side = self.safe_string(trade, 'side')
        orderId = self.safe_string(trade, 'ordId')
        feeCostString = self.safe_string(trade, 'fee')
        fee = None
        if feeCostString is not None:
            feeCostSigned = Precise.string_neg(feeCostString)
            feeCurrencyId = self.safe_string(trade, 'feeCcy')
            feeCurrencyCode = self.safe_currency_code(feeCurrencyId)
            fee = {
                'cost': feeCostSigned,
                'currency': feeCurrencyCode,
            }
        takerOrMaker = self.safe_string(trade, 'execType')
        if takerOrMaker == 'T':
            takerOrMaker = 'taker'
        elif takerOrMaker == 'M':
            takerOrMaker = 'maker'
        return self.safe_trade({
            'info': trade,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'symbol': symbol,
            'id': id,
            'order': orderId,
            'type': None,
            'takerOrMaker': takerOrMaker,
            'side': side,
            'price': price,
            'amount': amount,
            'cost': None,
            'fee': fee,
        }, market)

    def fetch_trades(self, symbol: str, since: Int = None, limit: Int = None, params={}) -> List[Trade]:
        """
        get the list of most recent trades for a particular symbol

        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-trades
        https://www.okx.com/docs-v5/en/#rest-api-public-data-get-option-trades

        :param str symbol: unified symbol of the market to fetch trades for
        :param int [since]: timestamp in ms of the earliest trade to fetch
        :param int [limit]: the maximum amount of trades to fetch
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.method]: 'publicGetMarketTrades' or 'publicGetMarketHistoryTrades' default is 'publicGetMarketTrades'
        :param boolean [params.paginate]: *only applies to publicGetMarketHistoryTrades* default False, when True will automatically paginate by calling self endpoint multiple times
        :returns Trade[]: a list of `trade structures <https://docs.ccxt.com/?id=public-trades>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchTrades', 'paginate')
        if paginate:
            return self.fetch_paginated_call_cursor('fetchTrades', symbol, since, limit, params, 'tradeId', 'after', None, 100)
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        response = None
        if market['option']:
            response = self.publicGetPublicOptionTrades(self.extend(request, params))
        else:
            if limit is not None:
                request['limit'] = limit  # default 100
            method = None
            method, params = self.handle_option_and_params(params, 'fetchTrades', 'method', 'publicGetMarketTrades')
            if method == 'publicGetMarketTrades':
                response = self.publicGetMarketTrades(self.extend(request, params))
            elif method == 'publicGetMarketHistoryTrades':
                response = self.publicGetMarketHistoryTrades(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {"instId":"ETH-BTC","side":"sell","sz":"0.119501","px":"0.07065","tradeId":"15826757","ts":"1621446178316"},
        #             {"instId":"ETH-BTC","side":"sell","sz":"0.03","px":"0.07068","tradeId":"15826756","ts":"1621446178066"},
        #             {"instId":"ETH-BTC","side":"buy","sz":"0.507","px":"0.07069","tradeId":"15826755","ts":"1621446175085"},
        #         ]
        #     }
        #
        # option
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "fillVol": "0.46387625976562497",
        #                 "fwdPx": "26299.754935451125",
        #                 "indexPx": "26309.7",
        #                 "instFamily": "BTC-USD",
        #                 "instId": "BTC-USD-230526-26000-C",
        #                 "markPx": "0.042386283557554236",
        #                 "optType": "C",
        #                 "px": "0.0415",
        #                 "side": "sell",
        #                 "sz": "90",
        #                 "tradeId": "112",
        #                 "ts": "1683907480154"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_trades(data, market, since, limit)

    def parse_ohlcv(self, ohlcv, market: Market = None) -> list:
        #
        #     [
        #         "1678928760000",  # timestamp
        #         "24341.4",  # open
        #         "24344",  # high
        #         "24313.2",  # low
        #         "24323",  # close
        #         "628",  # contract volume
        #         "2.5819",  # base volume
        #         "62800",  # quote volume
        #         "0"  # candlestick state
        #     ]
        #
        res = self.handle_market_type_and_params('fetchOHLCV', market, None)
        type = res[0]
        volumeIndex = 5 if (type == 'spot') else 6
        return [
            self.safe_integer(ohlcv, 0),
            self.safe_number(ohlcv, 1),
            self.safe_number(ohlcv, 2),
            self.safe_number(ohlcv, 3),
            self.safe_number(ohlcv, 4),
            self.safe_number(ohlcv, volumeIndex),
        ]

    def fetch_ohlcv(self, symbol: str, timeframe: str = '1m', since: Int = None, limit: Int = None, params={}) -> List[list]:
        """
        fetches historical candlestick data containing the open, high, low, and close price, and the volume of a market

        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-candlesticks
        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-candlesticks-history
        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-mark-price-candlesticks
        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-mark-price-candlesticks-history
        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-index-candlesticks
        https://www.okx.com/docs-v5/en/#rest-api-market-data-get-index-candlesticks-history
        https://www.okx.com/docs-v5/en/#order-book-trading-market-data-get-candlesticks-history

        :param str symbol: unified symbol of the market to fetch OHLCV data for
        :param str timeframe: the length of time each candle represents
        :param int [since]: timestamp in ms of the earliest candle to fetch
        :param int [limit]: the maximum amount of candles to fetch
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.price]: "mark" or "index" for mark price and index price candles
        :param int [params.until]: timestamp in ms of the latest candle to fetch
        :param str [params.type]: "Candles" or "HistoryCandles", default is "Candles" for recent candles, "HistoryCandles" for older candles
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :returns int[][]: A list of candles ordered, open, high, low, close, volume
        """
        self.load_markets()
        market = self.market(symbol)
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchOHLCV', 'paginate')
        if paginate:
            return self.fetch_paginated_call_deterministic('fetchOHLCV', symbol, since, limit, timeframe, params, 200)
        priceType = self.safe_string(params, 'price')
        isMarkOrIndex = self.in_array(priceType, ['mark', 'index'])
        params = self.omit(params, 'price')
        options = self.safe_dict(self.options, 'fetchOHLCV', {})
        timezone = self.safe_string(options, 'timezone', 'UTC')
        limitIsUndefined = (limit is None)
        if limit is None:
            limit = 100  # default 100, max 300
        else:
            maxLimit = 100 if isMarkOrIndex else 300  # default 300, only 100 if 'mark' or 'index'
            limit = min(limit, maxLimit)
        duration = self.parse_timeframe(timeframe)
        bar = self.safe_string(self.timeframes, timeframe, timeframe)
        if (timezone == 'UTC') and (duration >= 21600):  # if utc and timeframe >= 6h
            bar += timezone.lower()
        request: dict = {
            'instId': market['id'],
            'bar': bar,
            'limit': limit,
        }
        defaultType = 'Candles'
        if since is not None:
            now = self.milliseconds()
            durationInMilliseconds = duration * 1000
            # switch to history candles if since is past the cutoff for current candles
            historyBorder = now - ((1440 - 1) * durationInMilliseconds)
            if since < historyBorder:
                defaultType = 'HistoryCandles'
                maxLimit = 100 if isMarkOrIndex else 300
                limit = min(limit, maxLimit)
            startTime = max(since - 1, 0)
            request['before'] = startTime
            request['after'] = self.sum(since, durationInMilliseconds * limit)
        until = self.safe_integer(params, 'until')
        if until is not None:
            request['after'] = until
            params = self.omit(params, 'until')
        defaultType = self.safe_string(options, 'type', defaultType)  # Candles or HistoryCandles
        type = self.safe_string(params, 'type', defaultType)
        params = self.omit(params, 'type')
        isHistoryCandles = (type == 'HistoryCandles')
        response = None
        if priceType == 'mark':
            if isHistoryCandles:
                response = self.publicGetMarketHistoryMarkPriceCandles(self.extend(request, params))
            else:
                response = self.publicGetMarketMarkPriceCandles(self.extend(request, params))
        elif priceType == 'index':
            request['instId'] = market['info']['instFamily']  # okx index candles require instFamily instead of instId
            if isHistoryCandles:
                response = self.publicGetMarketHistoryIndexCandles(self.extend(request, params))
            else:
                response = self.publicGetMarketIndexCandles(self.extend(request, params))
        else:
            if isHistoryCandles:
                if limitIsUndefined and (limit == 100):
                    limit = 300
                    request['limit'] = 300  # reassign to 300, but self whole logic needs to be simplified...
                response = self.publicGetMarketHistoryCandles(self.extend(request, params))
            else:
                response = self.publicGetMarketCandles(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             ["1678928760000","24341.4","24344","24313.2","24323","628","2.5819","62800","0"],
        #             ["1678928700000","24324.1","24347.6","24321.7","24341.4","2565","10.5401","256500","1"],
        #             ["1678928640000","24300.2","24324.1","24288","24324.1","3304","13.5937","330400","1"],
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_ohlcvs(data, market, timeframe, since, limit)

    def fetch_funding_rate_history(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
        """
        fetches historical funding rate prices

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-funding-rate-history

        :param str symbol: unified symbol of the market to fetch the funding rate history for
        :param int [since]: timestamp in ms of the earliest funding rate to fetch
        :param int [limit]: the maximum amount of `funding rate structures <https://docs.ccxt.com/?id=funding-rate-history-structure>` to fetch
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :returns dict[]: a list of `funding rate structures <https://docs.ccxt.com/?id=funding-rate-history-structure>`
        """
        if symbol is None:
            raise ArgumentsRequired(self.id + ' fetchFundingRateHistory() requires a symbol argument')
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchFundingRateHistory', 'paginate')
        if paginate:
            return self.fetch_paginated_call_deterministic('fetchFundingRateHistory', symbol, since, limit, '8h', params, 100)
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        if since is not None:
            request['before'] = max(since - 1, 0)
        if limit is not None:
            request['limit'] = limit
        response = self.publicGetPublicFundingRateHistory(self.extend(request, params))
        #
        #     {
        #         "code":"0",
        #         "msg":"",
        #         "data":[
        #             {
        #                 "instType":"SWAP",
        #                 "instId":"BTC-USDT-SWAP",
        #                 "fundingRate":"0.018",
        #                 "realizedRate":"0.017",
        #                 "fundingTime":"1597026383085"
        #             },
        #             {
        #                 "instType":"SWAP",
        #                 "instId":"BTC-USDT-SWAP",
        #                 "fundingRate":"0.018",
        #                 "realizedRate":"0.017",
        #                 "fundingTime":"1597026383085"
        #             }
        #         ]
        #     }
        #
        rates = []
        data = self.safe_list(response, 'data', [])
        for i in range(0, len(data)):
            rate = data[i]
            timestamp = self.safe_integer(rate, 'fundingTime')
            rates.append({
                'info': rate,
                'symbol': self.safe_symbol(self.safe_string(rate, 'instId')),
                'fundingRate': self.safe_number(rate, 'realizedRate'),
                'timestamp': timestamp,
                'datetime': self.iso8601(timestamp),
            })
        sorted = self.sort_by(rates, 'timestamp')
        return self.filter_by_symbol_since_limit(sorted, market['symbol'], since, limit)

    def parse_balance_by_type(self, type, response):
        if type == 'funding':
            return self.parse_funding_balance(response)
        else:
            return self.parse_trading_balance(response)

    def parse_trading_balance(self, response):
        result: dict = {'info': response}
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        timestamp = self.safe_integer(first, 'uTime')
        details = self.safe_list(first, 'details', [])
        for i in range(0, len(details)):
            balance = details[i]
            currencyId = self.safe_string(balance, 'ccy')
            code = self.safe_currency_code(currencyId)
            account = self.account()
            # it may be incorrect to use total, free and used for swap accounts
            eq = self.safe_string(balance, 'eq')
            availEq = self.safe_string(balance, 'availEq')
            account['total'] = eq
            if availEq is None:
                account['free'] = self.safe_string(balance, 'availBal')
                account['used'] = self.safe_string(balance, 'frozenBal')
            else:
                account['free'] = availEq
            result[code] = account
        result['timestamp'] = timestamp
        result['datetime'] = self.iso8601(timestamp)
        return self.safe_balance(result)

    def parse_funding_balance(self, response):
        result: dict = {'info': response}
        data = self.safe_list(response, 'data', [])
        for i in range(0, len(data)):
            balance = data[i]
            currencyId = self.safe_string(balance, 'ccy')
            code = self.safe_currency_code(currencyId)
            account = self.account()
            # it may be incorrect to use total, free and used for swap accounts
            account['total'] = self.safe_string(balance, 'bal')
            account['free'] = self.safe_string(balance, 'availBal')
            account['used'] = self.safe_string(balance, 'frozenBal')
            result[code] = account
        return self.safe_balance(result)

    def parse_trading_fee(self, fee: dict, market: Market = None) -> TradingFeeInterface:
        # https://www.okx.com/docs-v5/en/#rest-api-account-get-fee-rates
        #
        #     {
        #         "category": "1",
        #         "delivery": "",
        #         "exercise": "",
        #         "instType": "SPOT",
        #         "level": "Lv1",
        #         "maker": "-0.0008",
        #         "taker": "-0.001",
        #         "ts": "1639043138472"
        #     }
        #
        return {
            'info': fee,
            'symbol': self.safe_symbol(None, market),
            # OKX returns the fees values opposed to other exchanges, so the sign needs to be flipped
            'maker': self.parse_number(Precise.string_neg(self.safe_string_2(fee, 'maker', 'makerU'))),
            'taker': self.parse_number(Precise.string_neg(self.safe_string_2(fee, 'taker', 'takerU'))),
            'percentage': None,
            'tierBased': None,
        }

    def fetch_trading_fee(self, symbol: str, params={}) -> TradingFeeInterface:
        """
        fetch the trading fees for a market

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-fee-rates

        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `fee structure <https://docs.ccxt.com/?id=fee-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instType': self.convert_to_instrument_type(market['type']),  # SPOT, MARGIN, SWAP, FUTURES, OPTION
            # "instId": market["id"],  # only applicable to SPOT/MARGIN
            # "uly": market["id"],  # only applicable to FUTURES/SWAP/OPTION
            # "category": "1",  # 1 = Class A, 2 = Class B, 3 = Class C, 4 = Class D
        }
        if market['spot']:
            request['instId'] = market['id']
        elif market['swap'] or market['future'] or market['option']:
            request['uly'] = market['baseId'] + '-' + market['quoteId']
        else:
            raise NotSupported(self.id + ' fetchTradingFee() supports spot, swap, future or option markets only')
        response = self.privateGetAccountTradeFee(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "category": "1",
        #                 "delivery": "",
        #                 "exercise": "",
        #                 "instType": "SPOT",
        #                 "level": "Lv1",
        #                 "maker": "-0.0008",
        #                 "taker": "-0.001",
        #                 "ts": "1639043138472"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        return self.parse_trading_fee(first, market)

    def fetch_balance(self, params={}) -> Balances:
        """
        query for balance and get the amount of funds available for trading or funds locked in orders

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-get-balance
        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-balance

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.type]: wallet type, ['funding' or 'trading'] default is 'trading'
        :returns dict: a `balance structure <https://docs.ccxt.com/?id=balance-structure>`
        """
        self.load_markets()
        marketType, query = self.handle_market_type_and_params('fetchBalance', None, params)
        request: dict = {
            # 'ccy': 'BTC,ETH',  # comma-separated list of currency ids
        }
        response = None
        if marketType == 'funding':
            response = self.privateGetAssetBalances(self.extend(request, query))
        else:
            response = self.privateGetAccountBalance(self.extend(request, query))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "adjEq": "",
        #                 "details": [
        #                     {
        #                         "availBal": "",
        #                         "availEq": "28.21006347",
        #                         "cashBal": "28.21006347",
        #                         "ccy": "USDT",
        #                         "crossLiab": "",
        #                         "disEq": "28.2687404020176",
        #                         "eq":"28 .21006347",
        #                         "eqUsd": "28.2687404020176",
        #                         "frozenBal": "0",
        #                         "interest": "",
        #                         "isoEq": "0",
        #                         "isoLiab": "",
        #                         "liab": "",
        #                         "maxLoan": "",
        #                         "mgnRatio": "",
        #                         "notionalLever": "0",
        #                         "ordFrozen": "0",
        #                         "twap": "0",
        #                         "uTime": "1621556539861",
        #                         "upl": "0",
        #                         "uplLiab": ""
        #                     }
        #                 ],
        #                 "imr": "",
        #                 "isoEq": "0",
        #                 "mgnRatio": "",
        #                 "mmr": "",
        #                 "notionalUsd": "",
        #                 "ordFroz": "",
        #                 "totalEq": "28.2687404020176",
        #                 "uTime": "1621556553510"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "adjEq": "",
        #                 "details": [
        #                     {
        #                         "availBal": "0.049",
        #                         "availEq": "",
        #                         "cashBal": "0.049",
        #                         "ccy": "BTC",
        #                         "crossLiab": "",
        #                         "disEq": "1918.55678",
        #                         "eq": "0.049",
        #                         "eqUsd": "1918.55678",
        #                         "frozenBal": "0",
        #                         "interest": "",
        #                         "isoEq": "",
        #                         "isoLiab": "",
        #                         "liab": "",
        #                         "maxLoan": "",
        #                         "mgnRatio": "",
        #                         "notionalLever": "",
        #                         "ordFrozen": "0",
        #                         "twap": "0",
        #                         "uTime": "1621973128591",
        #                         "upl": "",
        #                         "uplLiab": ""
        #                     }
        #                 ],
        #                 "imr": "",
        #                 "isoEq": "",
        #                 "mgnRatio": "",
        #                 "mmr": "",
        #                 "notionalUsd": "",
        #                 "ordFroz": "",
        #                 "totalEq": "1918.55678",
        #                 "uTime": "1622045126908"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        # funding
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "availBal": "0.00005426",
        #                 "bal": 0.0000542600000000,
        #                 "ccy": "BTC",
        #                 "frozenBal": "0"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        return self.parse_balance_by_type(marketType, response)

    def create_market_buy_order_with_cost(self, symbol: str, cost: float, params={}):
        """
        create a market buy order by providing the symbol and cost

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-place-order

        :param str symbol: unified symbol of the market to create an order in
        :param float cost: how much you want to trade in units of the quote currency
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: an `order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        if not market['spot']:
            raise NotSupported(self.id + ' createMarketBuyOrderWithCost() supports spot markets only')
        req = {
            'createMarketBuyOrderRequiresPrice': False,
            'tgtCcy': 'quote_ccy',
        }
        return self.create_order(symbol, 'market', 'buy', cost, None, self.extend(req, params))

    def create_market_sell_order_with_cost(self, symbol: str, cost: float, params={}):
        """
        create a market buy order by providing the symbol and cost

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-place-order

        :param str symbol: unified symbol of the market to create an order in
        :param float cost: how much you want to trade in units of the quote currency
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: an `order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        if not market['spot']:
            raise NotSupported(self.id + ' createMarketSellOrderWithCost() supports spot markets only')
        req = {
            'createMarketBuyOrderRequiresPrice': False,
            'tgtCcy': 'quote_ccy',
        }
        return self.create_order(symbol, 'market', 'sell', cost, None, self.extend(req, params))

    def create_order_request(self, symbol: str, type: OrderType, side: OrderSide, amount: float, price: Num = None, params={}):
        market = self.market(symbol)
        takeProfitPrice = self.safe_value_2(params, 'takeProfitPrice', 'tpTriggerPx')
        stopLossPrice = self.safe_value_2(params, 'stopLossPrice', 'slTriggerPx')
        conditional = (stopLossPrice is not None) or (takeProfitPrice is not None) or (type == 'conditional')
        request: dict = {
            'instId': market['id'],
            # 'ccy': currency['id'],  # only applicable to cross MARGIN orders in single-currency margin
            # 'clOrdId': clientOrderId,  # up to 32 characters, must be unique
            # 'tag': tag,  # up to 8 characters
            'side': side,
            # 'posSide': 'long',  # long, short,  # required in the long/short mode, and can only be long or short(only for future or swap)
            'ordType': type,
            # 'ordType': type,  # privatePostTradeOrder: market, limit, post_only, fok, ioc, optimal_limit_ioc
            # 'ordType': type,  # privatePostTradeOrderAlgo: conditional, oco, trigger, move_order_stop, iceberg, twap
            # 'sz': self.amount_to_precision(symbol, amount),
            # 'px': self.price_to_precision(symbol, price),  # limit orders only
            # 'reduceOnly': False,
            #
            # 'triggerPx': 10,  # stopPrice(trigger orders)
            # 'orderPx': 10,  # Order price if -1, the order will be executed at the market price.(trigger orders)
            # 'triggerPxType': 'last',  # Conditional default is last, mark or index(trigger orders)
            #
            # 'tpTriggerPx': 10,  # takeProfitPrice(conditional orders)
            # 'tpTriggerPxType': 'last',  # Conditional default is last, mark or index(conditional orders)
            # 'tpOrdPx': 10,  # Order price for Take-Profit orders, if -1 will be executed at market price(conditional orders)
            #
            # 'slTriggerPx': 10,  # stopLossPrice(conditional orders)
            # 'slTriggerPxType': 'last',  # Conditional default is last, mark or index(conditional orders)
            # 'slOrdPx': 10,  # Order price for Stop-Loss orders, if -1 will be executed at market price(conditional orders)
        }
        isConditionalOrOCO = conditional or (type == 'oco')
        closeFraction = self.safe_string(params, 'closeFraction')
        shouldOmitSize = isConditionalOrOCO and closeFraction is not None
        if not shouldOmitSize:
            request['sz'] = self.amount_to_precision(symbol, amount)
        spot = market['spot']
        contract = market['contract']
        triggerPrice = self.safe_value_n(params, ['triggerPrice', 'stopPrice', 'triggerPx'])
        timeInForce = self.safe_string(params, 'timeInForce', 'GTC')
        # takeProfitPrice = self.safe_value_2(params, 'takeProfitPrice', 'tpTriggerPx')
        tpOrdPx = self.safe_value(params, 'tpOrdPx', price)
        tpTriggerPxType = self.safe_string(params, 'tpTriggerPxType', 'last')
        # stopLossPrice = self.safe_value_2(params, 'stopLossPrice', 'slTriggerPx')
        slOrdPx = self.safe_value(params, 'slOrdPx', price)
        slTriggerPxType = self.safe_string(params, 'slTriggerPxType', 'last')
        clientOrderId = self.safe_string_2(params, 'clOrdId', 'clientOrderId')
        stopLoss = self.safe_value(params, 'stopLoss')
        takeProfit = self.safe_value(params, 'takeProfit')
        hasStopLoss = (stopLoss is not None)
        hasTakeProfit = (takeProfit is not None)
        trailingPercent = self.safe_string_2(params, 'trailingPercent', 'callbackRatio')
        isTrailingPercentOrder = trailingPercent is not None
        trailingPrice = self.safe_string_2(params, 'trailingPrice', 'callbackSpread')
        isTrailingPriceOrder = trailingPrice is not None
        trigger = (triggerPrice is not None) or (type == 'trigger')
        isReduceOnly = self.safe_value(params, 'reduceOnly', False) or (closeFraction is not None)
        defaultMarginMode = self.safe_string_2(self.options, 'defaultMarginMode', 'marginMode', 'cross')
        marginMode = self.safe_string_2(params, 'marginMode', 'tdMode')  # cross or isolated, tdMode not ommited so be extended into the request
        margin = False
        if (marginMode is not None) and (marginMode != 'cash'):
            margin = True
        else:
            marginMode = defaultMarginMode
            margin = self.safe_bool(params, 'margin', False)
        if spot:
            if margin:
                defaultCurrency = market['quote'] if (side == 'buy') else market['base']
                currency = self.safe_string(params, 'ccy', defaultCurrency)
                request['ccy'] = self.safe_currency_code(currency)
            tradeMode = marginMode if margin else 'cash'
            request['tdMode'] = tradeMode
        elif contract:
            if market['swap'] or market['future']:
                positionSide = None
                positionSide, params = self.handle_option_and_params(params, 'createOrder', 'positionSide')
                if positionSide is not None:
                    request['posSide'] = positionSide
                else:
                    hedged = None
                    hedged, params = self.handle_option_and_params(params, 'createOrder', 'hedged')
                    if hedged:
                        isBuy = (side == 'buy')
                        isProtective = (takeProfitPrice is not None) or (stopLossPrice is not None) or isReduceOnly
                        if isProtective:
                            # in case of protective orders, the posSide should be opposite of position side
                            # reduceOnly is emulated and not natively supported by the exchange
                            request['posSide'] = 'short' if isBuy else 'long'
                            if isReduceOnly:
                                params = self.omit(params, 'reduceOnly')
                        else:
                            request['posSide'] = 'long' if isBuy else 'short'
            request['tdMode'] = marginMode
        isMarketOrder = type == 'market'
        postOnly = False
        postOnly, params = self.handle_post_only(isMarketOrder, type == 'post_only', params)
        params = self.omit(params, ['currency', 'ccy', 'marginMode', 'timeInForce', 'stopPrice', 'triggerPrice', 'clientOrderId', 'stopLossPrice', 'takeProfitPrice', 'slOrdPx', 'tpOrdPx', 'margin', 'stopLoss', 'takeProfit', 'trailingPercent'])
        ioc = (timeInForce == 'IOC') or (type == 'ioc')
        fok = (timeInForce == 'FOK') or (type == 'fok')
        # conditional = (stopLossPrice is not None) or (takeProfitPrice is not None) or (type == 'conditional')
        marketIOC = (isMarketOrder and ioc) or (type == 'optimal_limit_ioc')
        defaultTgtCcy = self.safe_string(self.options, 'tgtCcy', 'base_ccy')
        tgtCcy = self.safe_string(params, 'tgtCcy', defaultTgtCcy)
        if (not contract) and (not margin):
            request['tgtCcy'] = tgtCcy
        if isMarketOrder or marketIOC:
            request['ordType'] = 'market'
            if spot and (side == 'buy'):
                # spot market buy: "sz" can refer either to base currency units or to quote currency units
                # see documentation: https://www.okx.com/docs-v5/en/#rest-api-trade-place-order
                if tgtCcy == 'quote_ccy':
                    # quote_ccy: sz refers to units of quote currency
                    createMarketBuyOrderRequiresPrice = True
                    createMarketBuyOrderRequiresPrice, params = self.handle_option_and_params(params, 'createOrder', 'createMarketBuyOrderRequiresPrice', True)
                    notional = self.safe_number_2(params, 'cost', 'sz')
                    params = self.omit(params, ['cost', 'sz'])
                    if createMarketBuyOrderRequiresPrice:
                        if price is not None:
                            if notional is None:
                                amountString = self.number_to_string(amount)
                                priceString = self.number_to_string(price)
                                quoteAmount = Precise.string_mul(amountString, priceString)
                                notional = self.parse_number(quoteAmount)
                        elif notional is None:
                            raise InvalidOrder(self.id + " createOrder() requires the price argument with market buy orders to calculate total order cost(amount to spend), where cost = amount * price. Supply a price argument to createOrder() call if you want the cost to be calculated for you from price and amount, or, alternatively, add .options['createMarketBuyOrderRequiresPrice'] = False and supply the total cost value in the 'amount' argument or in the 'cost' unified extra parameter or in exchange-specific 'sz' extra parameter(the exchange-specific behaviour)")
                    else:
                        notional = amount if (notional is None) else notional
                    request['sz'] = self.cost_to_precision(symbol, notional)
            if marketIOC and contract:
                request['ordType'] = 'optimal_limit_ioc'
        else:
            if (not trigger) and (not conditional):
                request['px'] = self.price_to_precision(symbol, price)
        if postOnly:
            request['ordType'] = 'post_only'
        elif ioc and not marketIOC:
            request['ordType'] = 'ioc'
        elif fok:
            request['ordType'] = 'fok'
        if isTrailingPercentOrder:
            convertedTrailingPercent = Precise.string_div(trailingPercent, '100')
            request['callbackRatio'] = convertedTrailingPercent
            request['ordType'] = 'move_order_stop'
        elif isTrailingPriceOrder:
            request['callbackSpread'] = trailingPrice
            request['ordType'] = 'move_order_stop'
        elif hasStopLoss or hasTakeProfit:
            attachAlgoOrd = {}
            if hasStopLoss:
                stopLossTriggerPrice = self.safe_value_n(stopLoss, ['triggerPrice', 'stopPrice', 'slTriggerPx'])
                if stopLossTriggerPrice is None:
                    raise InvalidOrder(self.id + ' createOrder() requires a trigger price in params["stopLoss"]["triggerPrice"], or params["stopLoss"]["stopPrice"], or params["stopLoss"]["slTriggerPx"] for a stop loss order')
                slTriggerPx = self.price_to_precision(symbol, stopLossTriggerPrice)
                slOrder = {}
                slOrder['slTriggerPx'] = slTriggerPx
                stopLossLimitPrice = self.safe_value_n(stopLoss, ['price', 'stopLossPrice', 'slOrdPx'])
                stopLossOrderType = self.safe_string(stopLoss, 'type')
                if stopLossOrderType is not None:
                    stopLossLimitOrderType = (stopLossOrderType == 'limit')
                    stopLossMarketOrderType = (stopLossOrderType == 'market')
                    if (not stopLossLimitOrderType) and (not stopLossMarketOrderType):
                        raise InvalidOrder(self.id + ' createOrder() params["stopLoss"]["type"] must be either "limit" or "market"')
                    elif stopLossLimitOrderType:
                        if stopLossLimitPrice is None:
                            raise InvalidOrder(self.id + ' createOrder() requires a limit price in params["stopLoss"]["price"] or params["stopLoss"]["slOrdPx"] for a stop loss limit order')
                        else:
                            slOrder['slOrdPx'] = self.price_to_precision(symbol, stopLossLimitPrice)
                    elif stopLossOrderType == 'market':
                        slOrder['slOrdPx'] = '-1'
                elif stopLossLimitPrice is not None:
                    slOrder['slOrdPx'] = self.price_to_precision(symbol, stopLossLimitPrice)  # limit sl order
                else:
                    slOrder['slOrdPx'] = '-1'  # market sl order
                stopLossTriggerPriceType = self.safe_string_2(stopLoss, 'triggerPriceType', 'slTriggerPxType', 'last')
                if stopLossTriggerPriceType is not None:
                    if (stopLossTriggerPriceType != 'last') and (stopLossTriggerPriceType != 'index') and (stopLossTriggerPriceType != 'mark'):
                        raise InvalidOrder(self.id + ' createOrder() stop loss trigger price type must be one of "last", "index" or "mark"')
                    slOrder['slTriggerPxType'] = stopLossTriggerPriceType
                attachAlgoOrd = self.extend(attachAlgoOrd, slOrder)
            if hasTakeProfit:
                takeProfitTriggerPrice = self.safe_value_n(takeProfit, ['triggerPrice', 'stopPrice', 'tpTriggerPx'])
                if takeProfitTriggerPrice is None:
                    raise InvalidOrder(self.id + ' createOrder() requires a trigger price in params["takeProfit"]["triggerPrice"], or params["takeProfit"]["stopPrice"], or params["takeProfit"]["tpTriggerPx"] for a take profit order')
                tpOrder = {}
                tpOrder['tpTriggerPx'] = self.price_to_precision(symbol, takeProfitTriggerPrice)
                takeProfitLimitPrice = self.safe_value_n(takeProfit, ['price', 'takeProfitPrice', 'tpOrdPx'])
                takeProfitOrderType = self.safe_string_2(takeProfit, 'type', 'tpOrdKind')
                if takeProfitOrderType is not None:
                    takeProfitLimitOrderType = (takeProfitOrderType == 'limit')
                    takeProfitMarketOrderType = (takeProfitOrderType == 'market')
                    if (not takeProfitLimitOrderType) and (not takeProfitMarketOrderType):
                        raise InvalidOrder(self.id + ' createOrder() params["takeProfit"]["type"] must be either "limit" or "market"')
                    elif takeProfitLimitOrderType:
                        if takeProfitLimitPrice is None:
                            raise InvalidOrder(self.id + ' createOrder() requires a limit price in params["takeProfit"]["price"] or params["takeProfit"]["tpOrdPx"] for a take profit limit order')
                        else:
                            tpOrder['tpOrdKind'] = takeProfitOrderType
                            tpOrder['tpOrdPx'] = self.price_to_precision(symbol, takeProfitLimitPrice)
                    elif takeProfitOrderType == 'market':
                        tpOrder['tpOrdPx'] = '-1'
                elif takeProfitLimitPrice is not None:
                    tpOrder['tpOrdKind'] = 'limit'
                    tpOrder['tpOrdPx'] = self.price_to_precision(symbol, takeProfitLimitPrice)  # limit tp order
                else:
                    tpOrder['tpOrdPx'] = '-1'  # market tp order
                takeProfitTriggerPriceType = self.safe_string_2(takeProfit, 'triggerPriceType', 'tpTriggerPxType', 'last')
                if takeProfitTriggerPriceType is not None:
                    if (takeProfitTriggerPriceType != 'last') and (takeProfitTriggerPriceType != 'index') and (takeProfitTriggerPriceType != 'mark'):
                        raise InvalidOrder(self.id + ' createOrder() take profit trigger price type must be one of "last", "index" or "mark"')
                    tpOrder['tpTriggerPxType'] = takeProfitTriggerPriceType
                attachAlgoOrd = self.extend(attachAlgoOrd, tpOrder)
            attachOrdKeys = list(attachAlgoOrd.keys())
            attachOrdLen = len(attachOrdKeys)
            if attachOrdLen > 0:
                request['attachAlgoOrds'] = [attachAlgoOrd]
        # algo order details
        if trigger:
            request['ordType'] = 'trigger'
            request['triggerPx'] = self.price_to_precision(symbol, triggerPrice)
            request['orderPx'] = '-1' if isMarketOrder else self.price_to_precision(symbol, price)
        elif conditional:
            request['ordType'] = 'conditional'
            twoWayCondition = ((takeProfitPrice is not None) and (stopLossPrice is not None))
            # if TP and SL are sent together
            # 'conditional' only stop-loss order will be applied
            # tpOrdKind is 'condition' which is the default
            if twoWayCondition:
                request['ordType'] = 'oco'
            if side == 'sell':
                request = self.omit(request, 'tgtCcy')
            if self.safe_string(request, 'tdMode') == 'cash':
                # for some reason tdMode = cash throws
                # {"code":"1","data":[{"algoClOrdId":"","algoId":"","clOrdId":"","sCode":"51000","sMsg":"Parameter tdMode error ","tag":""}],"msg":""}
                request['tdMode'] = marginMode
            if takeProfitPrice is not None:
                request['tpTriggerPx'] = self.price_to_precision(symbol, takeProfitPrice)
                tpOrdPxReq = '-1'
                if tpOrdPx is not None:
                    tpOrdPxReq = self.price_to_precision(symbol, tpOrdPx)
                request['tpOrdPx'] = tpOrdPxReq
                request['tpTriggerPxType'] = tpTriggerPxType
            if stopLossPrice is not None:
                request['slTriggerPx'] = self.price_to_precision(symbol, stopLossPrice)
                slOrdPxReq = '-1'
                if slOrdPx is not None:
                    slOrdPxReq = self.price_to_precision(symbol, slOrdPx)
                request['slOrdPx'] = slOrdPxReq
                request['slTriggerPxType'] = slTriggerPxType
        if clientOrderId is None:
            brokerId = self.safe_string(self.options, 'brokerId')
            if brokerId is not None:
                request['clOrdId'] = brokerId + self.uuid16()
                request['tag'] = brokerId
        else:
            request['clOrdId'] = clientOrderId
            params = self.omit(params, ['clOrdId', 'clientOrderId'])
        return self.extend(request, params)

    def create_order(self, symbol: str, type: OrderType, side: OrderSide, amount: float, price: Num = None, params={}):
        """
        create a trade order

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-place-order
        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-place-multiple-orders
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-post-place-algo-order

        :param str symbol: unified symbol of the market to create an order in
        :param str type: 'market' or 'limit'
        :param str side: 'buy' or 'sell'
        :param float amount: how much of currency you want to trade in units of base currency
        :param float [price]: the price at which the order is to be fulfilled, in units of the quote currency, ignored in market orders
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param bool [params.reduceOnly]: a mark to reduce the position size for margin, swap and future orders
        :param bool [params.postOnly]: True to place a post only order
        :param dict [params.takeProfit]: *takeProfit object in params* containing the triggerPrice at which the attached take profit order will be triggered(perpetual swap markets only)
        :param float [params.takeProfit.triggerPrice]: take profit trigger price
        :param float [params.takeProfit.price]: used for take profit limit orders, not used for take profit market price orders
        :param str [params.takeProfit.type]: 'market' or 'limit' used to specify the take profit price type
        :param dict [params.stopLoss]: *stopLoss object in params* containing the triggerPrice at which the attached stop loss order will be triggered(perpetual swap markets only)
        :param float [params.stopLoss.triggerPrice]: stop loss trigger price
        :param float [params.stopLoss.price]: used for stop loss limit orders, not used for stop loss market price orders
        :param str [params.stopLoss.type]: 'market' or 'limit' used to specify the stop loss price type
        :param str [params.positionSide]: if position mode is one-way: set to 'net', if position mode is hedge-mode: set to 'long' or 'short'
        :param str [params.trailingPercent]: the percent to trail away from the current market price
        :param str [params.tpOrdKind]: 'condition' or 'limit', the default is 'condition'
        :param bool [params.hedged]: *swap and future only* True for hedged mode, False for one way mode
        :param str [params.marginMode]: 'cross' or 'isolated', the default is 'cross'
        :returns dict: an `order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request = self.create_order_request(symbol, type, side, amount, price, params)
        method = self.safe_string(self.options, 'createOrder', 'privatePostTradeBatchOrders')
        requestOrdType = self.safe_string(request, 'ordType')
        if (requestOrdType == 'trigger') or (requestOrdType == 'conditional') or (requestOrdType == 'move_order_stop') or (type == 'move_order_stop') or (type == 'oco') or (type == 'iceberg') or (type == 'twap'):
            method = 'privatePostTradeOrderAlgo'
        if (method != 'privatePostTradeOrder') and (method != 'privatePostTradeOrderAlgo') and (method != 'privatePostTradeBatchOrders'):
            raise ExchangeError(self.id + ' createOrder() self.options["createOrder"] must be either privatePostTradeBatchOrders or privatePostTradeOrder or privatePostTradeOrderAlgo')
        if method == 'privatePostTradeBatchOrders':
            # keep the request body the same
            # submit a single order in an array to the batch order endpoint
            # because it has a lower ratelimit
            request = [request]
        response = None
        if method == 'privatePostTradeOrder':
            response = self.privatePostTradeOrder(request)
        elif method == 'privatePostTradeOrderAlgo':
            response = self.privatePostTradeOrderAlgo(request)
        else:
            response = self.privatePostTradeBatchOrders(request)
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        order = self.parse_order(first, market)
        order['type'] = type
        order['side'] = side
        return order

    def create_orders(self, orders: List[OrderRequest], params={}):
        """
        create a list of trade orders

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-place-multiple-orders

        :param Array orders: list of orders to create, each object should contain the parameters required by createOrder, namely symbol, type, side, amount, price and params
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: an `order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        ordersRequests = []
        for i in range(0, len(orders)):
            rawOrder = orders[i]
            marketId = self.safe_string(rawOrder, 'symbol')
            type = self.safe_string(rawOrder, 'type')
            side = self.safe_string(rawOrder, 'side')
            amount = self.safe_value(rawOrder, 'amount')
            price = self.safe_value(rawOrder, 'price')
            orderParams = self.safe_dict(rawOrder, 'params', {})
            extendedParams = self.extend(orderParams, params)  # the request does not accept extra params since it's a list, so we're extending each order with the common params
            orderRequest = self.create_order_request(marketId, type, side, amount, price, extendedParams)
            ordersRequests.append(orderRequest)
        response = self.privatePostTradeBatchOrders(ordersRequests)
        # {
        #     "code": "0",
        #     "data": [
        #        {
        #           "clOrdId": "e847386590ce4dBCc7f2a1b4c4509f82",
        #           "ordId": "636305438765568000",
        #           "sCode": "0",
        #           "sMsg": "Order placed",
        #           "tag": "e847386590ce4dBC"
        #        },
        #        {
        #           "clOrdId": "e847386590ce4dBC0b9993fe642d8f62",
        #           "ordId": "636305438765568001",
        #           "sCode": "0",
        #           "sMsg": "Order placed",
        #           "tag": "e847386590ce4dBC"
        #        }
        #     ],
        #     "inTime": "1697979038584486",
        #     "msg": "",
        #     "outTime": "1697979038586493"
        # }
        data = self.safe_list(response, 'data', [])
        return self.parse_orders(data)

    def edit_order_request(self, id: str, symbol, type, side, amount=None, price=None, params={}):
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        isAlgoOrder = None
        if (type == 'trigger') or (type == 'conditional') or (type == 'move_order_stop') or (type == 'oco') or (type == 'iceberg') or (type == 'twap'):
            isAlgoOrder = True
        clientOrderId = self.safe_string_2(params, 'clOrdId', 'clientOrderId')
        if clientOrderId is not None:
            if isAlgoOrder:
                request['algoClOrdId'] = clientOrderId
            else:
                request['clOrdId'] = clientOrderId
        else:
            if isAlgoOrder:
                request['algoId'] = id
            else:
                request['ordId'] = id
        stopLossTriggerPrice = self.safe_value_2(params, 'stopLossPrice', 'newSlTriggerPx')
        stopLossPrice = self.safe_value(params, 'newSlOrdPx')
        stopLossTriggerPriceType = self.safe_string(params, 'newSlTriggerPxType', 'last')
        takeProfitTriggerPrice = self.safe_value_2(params, 'takeProfitPrice', 'newTpTriggerPx')
        takeProfitPrice = self.safe_value(params, 'newTpOrdPx')
        takeProfitTriggerPriceType = self.safe_string(params, 'newTpTriggerPxType', 'last')
        stopLoss = self.safe_value(params, 'stopLoss')
        takeProfit = self.safe_value(params, 'takeProfit')
        hasStopLoss = (stopLoss is not None)
        hasTakeProfit = (takeProfit is not None)
        if isAlgoOrder:
            if (stopLossTriggerPrice is None) and (takeProfitTriggerPrice is None):
                raise BadRequest(self.id + ' editOrder() requires a stopLossPrice or takeProfitPrice parameter for editing an algo order')
            if stopLossTriggerPrice is not None:
                if stopLossPrice is None:
                    raise BadRequest(self.id + ' editOrder() requires a newSlOrdPx parameter for editing an algo order')
                request['newSlTriggerPx'] = self.price_to_precision(symbol, stopLossTriggerPrice)
                request['newSlOrdPx'] = '-1' if (type == 'market') else self.price_to_precision(symbol, stopLossPrice)
                request['newSlTriggerPxType'] = stopLossTriggerPriceType
            if takeProfitTriggerPrice is not None:
                if takeProfitPrice is None:
                    raise BadRequest(self.id + ' editOrder() requires a newTpOrdPx parameter for editing an algo order')
                request['newTpTriggerPx'] = self.price_to_precision(symbol, takeProfitTriggerPrice)
                request['newTpOrdPx'] = '-1' if (type == 'market') else self.price_to_precision(symbol, takeProfitPrice)
                request['newTpTriggerPxType'] = takeProfitTriggerPriceType
        else:
            if stopLossTriggerPrice is not None:
                request['newSlTriggerPx'] = self.price_to_precision(symbol, stopLossTriggerPrice)
                request['newSlOrdPx'] = '-1' if (type == 'market') else self.price_to_precision(symbol, stopLossPrice)
                request['newSlTriggerPxType'] = stopLossTriggerPriceType
            if takeProfitTriggerPrice is not None:
                request['newTpTriggerPx'] = self.price_to_precision(symbol, takeProfitTriggerPrice)
                request['newTpOrdPx'] = '-1' if (type == 'market') else self.price_to_precision(symbol, takeProfitPrice)
                request['newTpTriggerPxType'] = takeProfitTriggerPriceType
            if hasStopLoss:
                stopLossTriggerPrice = self.safe_value(stopLoss, 'triggerPrice')
                stopLossPrice = self.safe_value(stopLoss, 'price')
                stopLossType = self.safe_string(stopLoss, 'type')
                request['newSlTriggerPx'] = self.price_to_precision(symbol, stopLossTriggerPrice)
                request['newSlOrdPx'] = '-1' if (stopLossType == 'market') else self.price_to_precision(symbol, stopLossPrice)
                request['newSlTriggerPxType'] = stopLossTriggerPriceType
            if hasTakeProfit:
                takeProfitTriggerPrice = self.safe_value(takeProfit, 'triggerPrice')
                takeProfitPrice = self.safe_value(takeProfit, 'price')
                takeProfitType = self.safe_string(takeProfit, 'type')
                request['newTpOrdKind'] = takeProfitType if (takeProfitType == 'limit') else 'condition'
                request['newTpTriggerPx'] = self.price_to_precision(symbol, takeProfitTriggerPrice)
                request['newTpOrdPx'] = '-1' if (takeProfitType == 'market') else self.price_to_precision(symbol, takeProfitPrice)
                request['newTpTriggerPxType'] = takeProfitTriggerPriceType
        if amount is not None:
            request['newSz'] = self.amount_to_precision(symbol, amount)
        if not isAlgoOrder:
            if price is not None:
                request['newPx'] = self.price_to_precision(symbol, price)
        params = self.omit(params, ['clOrdId', 'clientOrderId', 'takeProfitPrice', 'stopLossPrice', 'stopLoss', 'takeProfit', 'postOnly'])
        return self.extend(request, params)

    def edit_order(self, id: str, symbol: str, type: OrderType, side: OrderSide, amount: Num = None, price: Num = None, params={}):
        """
        edit a trade order

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-amend-order
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-post-amend-algo-order

        :param str id: order id
        :param str symbol: unified symbol of the market to create an order in
        :param str type: 'market' or 'limit'
        :param str side: 'buy' or 'sell'
        :param float amount: how much of the currency you want to trade in units of the base currency
        :param float [price]: the price at which the order is to be fulfilled, in units of the quote currency, ignored in market orders
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.clientOrderId]: client order id, uses id if not passed
        :param float [params.stopLossPrice]: stop loss trigger price
        :param float [params.newSlOrdPx]: the stop loss order price, set to stopLossPrice if the type is market
        :param str [params.newSlTriggerPxType]: 'last', 'index' or 'mark' used to specify the stop loss trigger price type, default is 'last'
        :param float [params.takeProfitPrice]: take profit trigger price
        :param float [params.newTpOrdPx]: the take profit order price, set to takeProfitPrice if the type is market
        :param str [params.newTpTriggerPxType]: 'last', 'index' or 'mark' used to specify the take profit trigger price type, default is 'last'
        :param dict [params.stopLoss]: *stopLoss object in params* containing the triggerPrice at which the attached stop loss order will be triggered
        :param float [params.stopLoss.triggerPrice]: stop loss trigger price
        :param float [params.stopLoss.price]: used for stop loss limit orders, not used for stop loss market price orders
        :param str [params.stopLoss.type]: 'market' or 'limit' used to specify the stop loss price type
        :param dict [params.takeProfit]: *takeProfit object in params* containing the triggerPrice at which the attached take profit order will be triggered
        :param float [params.takeProfit.triggerPrice]: take profit trigger price
        :param float [params.takeProfit.price]: used for take profit limit orders, not used for take profit market price orders
        :param str [params.takeProfit.type]: 'market' or 'limit' used to specify the take profit price type
        :param str [params.newTpOrdKind]: 'condition' or 'limit', the default is 'condition'
        :returns dict: an `order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request = self.edit_order_request(id, symbol, type, side, amount, price, params)
        isAlgoOrder = None
        if (type == 'trigger') or (type == 'conditional') or (type == 'move_order_stop') or (type == 'oco') or (type == 'iceberg') or (type == 'twap'):
            isAlgoOrder = True
        response = None
        if isAlgoOrder:
            response = self.privatePostTradeAmendAlgos(self.extend(request, params))
        else:
            response = self.privatePostTradeAmendOrder(self.extend(request, params))
        #
        #     {
        #        "code": "0",
        #        "data": [
        #            {
        #                 "clOrdId": "e847386590ce4dBCc1a045253497a547",
        #                 "ordId": "559176536793178112",
        #                 "reqId": "",
        #                 "sCode": "0",
        #                 "sMsg": ""
        #            }
        #        ],
        #        "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        first = self.safe_dict(data, 0, {})
        order = self.parse_order(first, market)
        order['type'] = type
        order['side'] = side
        return order

    def cancel_order(self, id: str, symbol: Str = None, params={}):
        """
        cancels an open order

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-cancel-order
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-post-cancel-algo-order

        :param str id: order id
        :param str symbol: unified symbol of the market the order was made in
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param boolean [params.trigger]: True if trigger orders
        :param boolean [params.trailing]: set to True if you want to cancel a trailing order
        :returns dict: An `order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        if symbol is None:
            raise ArgumentsRequired(self.id + ' cancelOrder() requires a symbol argument')
        trigger = self.safe_value_2(params, 'stop', 'trigger')
        trailing = self.safe_bool(params, 'trailing', False)
        if trigger or trailing:
            orderInner = self.cancel_orders([id], symbol, params)
            return self.safe_dict(orderInner, 0)
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
            # 'ordId': id,  # either ordId or clOrdId is required
            # 'clOrdId': clientOrderId,
        }
        clientOrderId = self.safe_string_2(params, 'clOrdId', 'clientOrderId')
        if clientOrderId is not None:
            request['clOrdId'] = clientOrderId
        else:
            request['ordId'] = id
        query = self.omit(params, ['clOrdId', 'clientOrderId'])
        response = self.privatePostTradeCancelOrder(self.extend(request, query))
        # {"code":"0","data":[{"clOrdId":"","ordId":"317251910906576896","sCode":"0","sMsg":""}],"msg":""}
        data = self.safe_value(response, 'data', [])
        order = self.safe_dict(data, 0)
        return self.parse_order(order, market)

    def parse_ids(self, ids):
        """
 @ignore
        :param string[]|str ids: order ids
        :returns str[]: list of order ids
        """
        if (ids is not None) and isinstance(ids, str):
            return ids.split(',')
        else:
            return ids

    def cancel_orders(self, ids: List[str], symbol: Str = None, params={}):
        """
        cancel multiple orders

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-cancel-multiple-orders
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-post-cancel-algo-order

        :param str[] ids: order ids
        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param boolean [params.trigger]: whether the order is a stop/trigger order
        :param boolean [params.trailing]: set to True if you want to cancel trailing orders
        :returns dict: an list of `order structures <https://docs.ccxt.com/?id=order-structure>`
        """
        # TODO : the original endpoint signature differs, according to that you can skip individual symbol and assign ids in batch. At self moment, `params` is not being used too.
        if symbol is None:
            raise ArgumentsRequired(self.id + ' cancelOrders() requires a symbol argument')
        self.load_markets()
        market = self.market(symbol)
        request = []
        options = self.safe_value(self.options, 'cancelOrders', {})
        defaultMethod = self.safe_string(options, 'method', 'privatePostTradeCancelBatchOrders')
        method = self.safe_string(params, 'method', defaultMethod)
        clientOrderIds = self.parse_ids(self.safe_value_2(params, 'clOrdId', 'clientOrderId'))
        algoIds = self.parse_ids(self.safe_value(params, 'algoId'))
        trigger = self.safe_value_2(params, 'stop', 'trigger')
        trailing = self.safe_bool(params, 'trailing', False)
        if trigger or trailing:
            method = 'privatePostTradeCancelAlgos'
        if clientOrderIds is None:
            ids = self.parse_ids(ids)
            if algoIds is not None:
                for i in range(0, len(algoIds)):
                    request.append({
                        'algoId': algoIds[i],
                        'instId': market['id'],
                    })
            for i in range(0, len(ids)):
                if trailing or trigger:
                    request.append({
                        'algoId': ids[i],
                        'instId': market['id'],
                    })
                else:
                    request.append({
                        'ordId': ids[i],
                        'instId': market['id'],
                    })
        else:
            for i in range(0, len(clientOrderIds)):
                if trailing or trigger:
                    request.append({
                        'instId': market['id'],
                        'algoClOrdId': clientOrderIds[i],
                    })
                else:
                    request.append({
                        'instId': market['id'],
                        'clOrdId': clientOrderIds[i],
                    })
        response = None
        if method == 'privatePostTradeCancelAlgos':
            response = self.privatePostTradeCancelAlgos(request)  # * dont self.extend with params, otherwise ARRAY will be turned into OBJECT
        else:
            response = self.privatePostTradeCancelBatchOrders(request)  # * dont self.extend with params, otherwise ARRAY will be turned into OBJECT
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "clOrdId": "e123456789ec4dBC1123456ba123b45e",
        #                 "ordId": "405071912345641543",
        #                 "sCode": "0",
        #                 "sMsg": ""
        #             },
        #             ...
        #         ],
        #         "msg": ""
        #     }
        #
        # Algo order
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "algoId": "431375349042380800",
        #                 "sCode": "0",
        #                 "sMsg": ""
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        ordersData = self.safe_list(response, 'data', [])
        return self.parse_orders(ordersData, market, None, None, params)

    def cancel_orders_for_symbols(self, orders: List[CancellationRequest], params={}):
        """
        cancel multiple orders for multiple symbols

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-cancel-multiple-orders
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-post-cancel-algo-order

        :param CancellationRequest[] orders: each order should contain the parameters required by cancelOrder namely id and symbol, example [{"id": "a", "symbol": "BTC/USDT"}, {"id": "b", "symbol": "ETH/USDT"}]
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param boolean [params.trigger]: whether the order is a stop/trigger order
        :param boolean [params.trailing]: set to True if you want to cancel trailing orders
        :returns dict: an list of `order structures <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        request = []
        options = self.safe_dict(self.options, 'cancelOrders', {})
        defaultMethod = self.safe_string(options, 'method', 'privatePostTradeCancelBatchOrders')
        method = self.safe_string(params, 'method', defaultMethod)
        trigger = self.safe_bool_2(params, 'stop', 'trigger')
        trailing = self.safe_bool(params, 'trailing', False)
        isStopOrTrailing = trigger or trailing
        if isStopOrTrailing:
            method = 'privatePostTradeCancelAlgos'
        for i in range(0, len(orders)):
            order = orders[i]
            id = self.safe_string(order, 'id')
            clientOrderId = self.safe_string_2(order, 'clOrdId', 'clientOrderId')
            symbol = self.safe_string(order, 'symbol')
            market = self.market(symbol)
            idKey = 'ordId'
            if isStopOrTrailing:
                idKey = 'algoId'
            elif clientOrderId is not None:
                if isStopOrTrailing:
                    idKey = 'algoClOrdId'
                else:
                    idKey = 'clOrdId'
            requestItem: dict = {
                'instId': market['id'],
            }
            requestItem[idKey] = clientOrderId if (clientOrderId is not None) else id
            request.append(requestItem)
        response = None
        if method == 'privatePostTradeCancelAlgos':
            response = self.privatePostTradeCancelAlgos(request)  # * dont self.extend with params, otherwise ARRAY will be turned into OBJECT
        else:
            response = self.privatePostTradeCancelBatchOrders(request)  # * dont self.extend with params, otherwise ARRAY will be turned into OBJECT
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "clOrdId": "e123456789ec4dBC1123456ba123b45e",
        #                 "ordId": "405071912345641543",
        #                 "sCode": "0",
        #                 "sMsg": ""
        #             },
        #             ...
        #         ],
        #         "msg": ""
        #     }
        #
        # Algo order
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "algoId": "431375349042380800",
        #                 "sCode": "0",
        #                 "sMsg": ""
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        ordersData = self.safe_list(response, 'data', [])
        return self.parse_orders(ordersData, None, None, None, params)

    def cancel_all_orders_after(self, timeout: Int, params={}):
        """
        dead man's switch, cancel all orders after the given timeout

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-cancel-all-after

        :param number timeout: time in milliseconds, 0 represents cancel the timer
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: the api result
        """
        self.load_markets()
        request: dict = {
            'timeOut': self.parse_to_int(timeout / 1000) if (timeout > 0) else 0,
        }
        response = self.privatePostTradeCancelAllAfter(self.extend(request, params))
        #
        #     {
        #         "code":"0",
        #         "msg":"",
        #         "data":[
        #             {
        #                 "triggerTime":"1587971460",
        #                 "ts":"1587971400"
        #             }
        #         ]
        #     }
        #
        return response

    def parse_order_status(self, status: Str):
        statuses: dict = {
            'canceled': 'canceled',
            'order_failed': 'canceled',
            'live': 'open',
            'partially_filled': 'open',
            'filled': 'closed',
            'effective': 'closed',
        }
        return self.safe_string(statuses, status, status)

    def parse_order(self, order: dict, market: Market = None) -> Order:
        #
        # createOrder
        #
        #     {
        #         "clOrdId": "oktswap6",
        #         "ordId": "312269865356374016",
        #         "tag": "",
        #         "sCode": "0",
        #         "sMsg": ""
        #     }
        #
        # editOrder
        #
        #     {
        #         "clOrdId": "e847386590ce4dBCc1a045253497a547",
        #         "ordId": "559176536793178112",
        #         "reqId": "",
        #         "sCode": "0",
        #         "sMsg": ""
        #     }
        #
        # Spot and Swap fetchOrder, fetchOpenOrders
        #
        #     {
        #         "accFillSz": "0",
        #         "avgPx": "",
        #         "cTime": "1621910749815",
        #         "category": "normal",
        #         "ccy": "",
        #         "clOrdId": "",
        #         "fee": "0",
        #         "feeCcy": "ETH",
        #         "fillPx": "",
        #         "fillSz": "0",
        #         "fillTime": "",
        #         "instId": "ETH-USDT",
        #         "instType": "SPOT",
        #         "lever": "",
        #         "ordId": "317251910906576896",
        #         "ordType": "limit",
        #         "pnl": "0",
        #         "posSide": "net",
        #         "px": "2000",
        #         "rebate": "0",
        #         "rebateCcy": "USDT",
        #         "side": "buy",
        #         "slOrdPx": "",
        #         "slTriggerPx": "",
        #         "state": "live",
        #         "sz": "0.001",
        #         "tag": "",
        #         "tdMode": "cash",
        #         "tpOrdPx": "",
        #         "tpTriggerPx": "",
        #         "tradeId": "",
        #         "uTime": "1621910749815"
        #     }
        #
        # watchOrders & fetchClosedOrders
        #
        #    {
        #        "algoClOrdId": "",
        #        "algoId": "",
        #        "attachAlgoClOrdId": "",
        #        "attachAlgoOrds": [],
        #        "cancelSource": "",
        #        "cancelSourceReason": "",  # not present in WS, but present in fetchClosedOrders
        #        "category": "normal",
        #        "ccy": "",  # empty in WS, but eg. `USDT` in fetchClosedOrders
        #        "clOrdId": "",
        #        "cTime": "1751705801423",
        #        "feeCcy": "USDT",
        #        "instId": "LINK-USDT-SWAP",
        #        "instType": "SWAP",
        #        "isTpLimit": "false",
        #        "lever": "3",
        #        "linkedAlgoOrd": {"algoId": ""},
        #        "ordId": "2657625147249614848",
        #        "ordType": "limit",
        #        "posSide": "net",
        #        "px": "13.142",
        #        "pxType": "",
        #        "pxUsd": "",
        #        "pxVol": "",
        #        "quickMgnType": "",
        #        "rebate": "0",
        #        "rebateCcy": "USDT",
        #        "reduceOnly": "true",
        #        "side": "sell",
        #        "slOrdPx": "",
        #        "slTriggerPx": "",
        #        "slTriggerPxType": "",
        #        "source": "",
        #        "stpId": "",
        #        "stpMode": "cancel_maker",
        #        "sz": "0.1",
        #        "tag": "",
        #        "tdMode": "isolated",
        #        "tgtCcy": "",
        #        "tpOrdPx": "",
        #        "tpTriggerPx": "",
        #        "tpTriggerPxType": "",
        #        "uTime": "1751705807467",
        #        "reqId": "",                      # field present only in WS
        #        "msg": "",                        # field present only in WS
        #        "amendResult": "",                # field present only in WS
        #        "amendSource": "",                # field present only in WS
        #        "code": "0",                      # field present only in WS
        #        "fillFwdPx": "",                  # field present only in WS
        #        "fillMarkVol": "",                # field present only in WS
        #        "fillPxUsd": "",                  # field present only in WS
        #        "fillPxVol": "",                  # field present only in WS
        #        "lastPx": "13.142",               # field present only in WS
        #        "notionalUsd": "1.314515408",     # field present only in WS
        #
        #     #### these below fields are empty on first omit from websocket, because of "creation" event. however, if order is executed, it also immediately sends another update with these fields filled  ###
        #
        #        "pnl": "-0.0001",
        #        "accFillSz": "0.1",
        #        "avgPx": "13.142",
        #        "state": "filled",
        #        "fee": "-0.00026284",
        #        "fillPx": "13.142",
        #        "tradeId": "293429690",
        #        "fillSz": "0.1",
        #        "fillTime": "1751705807467",
        #        "fillNotionalUsd": "1.314515408",  # field present only in WS
        #        "fillPnl": "-0.0001",             # field present only in WS
        #        "fillFee": "-0.00026284",         # field present only in WS
        #        "fillFeeCcy": "USDT",             # field present only in WS
        #        "execType": "M",                  # field present only in WS
        #        "fillMarkPx": "13.141",           # field present only in WS
        #        "fillIdxPx": "13.147"             # field present only in WS
        #    }
        #
        #
        # Algo Order fetchOpenOrders, fetchCanceledOrders, fetchClosedOrders
        #
        #     {
        #         "activePx": "",
        #         "activePxType": "",
        #         "actualPx": "",
        #         "actualSide": "buy",
        #         "actualSz": "0",
        #         "algoId": "431375349042380800",
        #         "cTime": "1649119897778",
        #         "callbackRatio": "",
        #         "callbackSpread": "",
        #         "ccy": "",
        #         "ctVal": "0.01",
        #         "instId": "BTC-USDT-SWAP",
        #         "instType": "SWAP",
        #         "last": "46538.9",
        #         "lever": "125",
        #         "moveTriggerPx": "",
        #         "notionalUsd": "467.059",
        #         "ordId": "",
        #         "ordPx": "50000",
        #         "ordType": "trigger",
        #         "posSide": "long",
        #         "pxLimit": "",
        #         "pxSpread": "",
        #         "pxVar": "",
        #         "side": "buy",
        #         "slOrdPx": "",
        #         "slTriggerPx": "",
        #         "slTriggerPxType": "",
        #         "state": "live",
        #         "sz": "1",
        #         "szLimit": "",
        #         "tag": "",
        #         "tdMode": "isolated",
        #         "tgtCcy": "",
        #         "timeInterval": "",
        #         "tpOrdPx": "",
        #         "tpTriggerPx": "",
        #         "tpTriggerPxType": "",
        #         "triggerPx": "50000",
        #         "triggerPxType": "last",
        #         "triggerTime": "",
        #         "uly": "BTC-USDT"
        #     }
        #
        scode = self.safe_string(order, 'sCode')
        if (scode is not None) and (scode != '0'):
            return self.safe_order({
                'id': self.safe_string(order, 'ordId'),
                'clientOrderId': self.safe_string(order, 'clOrdId'),
                'status': 'rejected',
                'info': order,
            })
        id = self.safe_string_2(order, 'algoId', 'ordId')
        timestamp = self.safe_integer(order, 'cTime')
        lastUpdateTimestamp = self.safe_integer(order, 'uTime')
        lastTradeTimestamp = self.safe_integer(order, 'fillTime')
        side = self.safe_string(order, 'side')
        type = self.safe_string(order, 'ordType')
        postOnly = None
        timeInForce = None
        if type == 'post_only':
            postOnly = True
            type = 'limit'
        elif type == 'fok':
            timeInForce = 'FOK'
            type = 'limit'
        elif type == 'ioc':
            timeInForce = 'IOC'
            type = 'limit'
        marketId = self.safe_string(order, 'instId')
        market = self.safe_market(marketId, market)
        symbol = self.safe_symbol(marketId, market, '-')
        filled = self.safe_string(order, 'accFillSz')
        price = self.safe_string_2(order, 'px', 'ordPx')
        average = self.safe_string(order, 'avgPx')
        status = self.parse_order_status(self.safe_string(order, 'state'))
        feeCostString = self.safe_string(order, 'fee')
        amount = None
        cost = None
        # spot market buy: "sz" can refer either to base currency units or to quote currency units
        # see documentation: https://www.okx.com/docs-v5/en/#rest-api-trade-place-order
        defaultTgtCcy = self.safe_string(self.options, 'tgtCcy', 'base_ccy')
        tgtCcy = self.safe_string(order, 'tgtCcy', defaultTgtCcy)
        instType = self.safe_string(order, 'instType')
        if (side == 'buy') and (type == 'market') and (instType == 'SPOT') and (tgtCcy == 'quote_ccy'):
            # "sz" refers to the cost
            cost = self.safe_string(order, 'sz')
        else:
            # "sz" refers to the trade currency amount
            amount = self.safe_string(order, 'sz')
        fee = None
        if feeCostString is not None:
            feeCostSigned = Precise.string_neg(feeCostString)
            feeCurrencyId = self.safe_string(order, 'feeCcy')
            feeCurrencyCode = self.safe_currency_code(feeCurrencyId)
            fee = {
                'cost': self.parse_number(feeCostSigned),
                'currency': feeCurrencyCode,
            }
        clientOrderId = self.safe_string(order, 'clOrdId')
        if (clientOrderId is not None) and (len(clientOrderId) < 1):
            clientOrderId = None  # fix empty clientOrderId string
        stopLossPrice = self.safe_number_2(order, 'slTriggerPx', 'slOrdPx')
        takeProfitPrice = self.safe_number_2(order, 'tpTriggerPx', 'tpOrdPx')
        reduceOnlyRaw = self.safe_string(order, 'reduceOnly')
        reduceOnly = False
        if reduceOnly is not None:
            reduceOnly = (reduceOnlyRaw == 'true')
        return self.safe_order({
            'info': order,
            'id': id,
            'clientOrderId': clientOrderId,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'lastTradeTimestamp': lastTradeTimestamp,
            'lastUpdateTimestamp': lastUpdateTimestamp,
            'symbol': symbol,
            'type': type,
            'timeInForce': timeInForce,
            'postOnly': postOnly,
            'side': side,
            'price': price,
            'stopLossPrice': stopLossPrice,
            'takeProfitPrice': takeProfitPrice,
            'triggerPrice': self.safe_number_n(order, ['triggerPx', 'moveTriggerPx']),
            'average': average,
            'cost': cost,
            'amount': amount,
            'filled': filled,
            'remaining': None,
            'status': status,
            'fee': fee,
            'trades': None,
            'reduceOnly': reduceOnly,
        }, market)

    def fetch_order(self, id: str, symbol: Str = None, params={}):
        """
        fetch an order by the id

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-order-details
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-get-algo-order-details

        :param str id: the order id
        :param str symbol: unified market symbol
        :param dict [params]: extra and exchange specific parameters
        :param boolean [params.trigger]: True if fetching trigger orders
        :returns: `an order structure <https://docs.ccxt.com/?id=order-structure>`
        """
        if symbol is None:
            raise ArgumentsRequired(self.id + ' fetchOrder() requires a symbol argument')
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
            # 'clOrdId': 'abcdef12345',  # optional, [a-z0-9]{1,32}
            # 'ordId': id,
            # 'instType':  # spot, swap, futures, margin
        }
        clientOrderId = self.safe_string_2(params, 'clOrdId', 'clientOrderId')
        options = self.safe_value(self.options, 'fetchOrder', {})
        defaultMethod = self.safe_string(options, 'method', 'privateGetTradeOrder')
        method = self.safe_string(params, 'method', defaultMethod)
        trigger = self.safe_value_2(params, 'stop', 'trigger')
        if trigger:
            method = 'privateGetTradeOrderAlgo'
            if clientOrderId is not None:
                request['algoClOrdId'] = clientOrderId
            else:
                request['algoId'] = id
        else:
            if clientOrderId is not None:
                request['clOrdId'] = clientOrderId
            else:
                request['ordId'] = id
        query = self.omit(params, ['method', 'clOrdId', 'clientOrderId', 'stop', 'trigger'])
        response = None
        if method == 'privateGetTradeOrderAlgo':
            response = self.privateGetTradeOrderAlgo(self.extend(request, query))
        else:
            response = self.privateGetTradeOrder(self.extend(request, query))
        #
        # Spot and Swap
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "accFillSz": "0",
        #                 "avgPx": "",
        #                 "cTime": "1621910749815",
        #                 "category": "normal",
        #                 "ccy": "",
        #                 "clOrdId": "",
        #                 "fee": "0",
        #                 "feeCcy": "ETH",
        #                 "fillPx": "",
        #                 "fillSz": "0",
        #                 "fillTime": "",
        #                 "instId": "ETH-USDT",
        #                 "instType": "SPOT",
        #                 "lever": "",
        #                 "ordId": "317251910906576896",
        #                 "ordType": "limit",
        #                 "pnl": "0",
        #                 "posSide": "net",
        #                 "px":"20 00",
        #                 "rebate": "0",
        #                 "rebateCcy": "USDT",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "state": "live",
        #                 "sz":"0. 001",
        #                 "tag": "",
        #                 "tdMode": "cash",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tradeId": "",
        #                 "uTime": "1621910749815"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        # Algo order
        #     {
        #         "code":"0",
        #         "msg":"",
        #         "data":[
        #             {
        #                 "instType":"FUTURES",
        #                 "instId":"BTC-USD-200329",
        #                 "ordId":"123445",
        #                 "ccy":"BTC",
        #                 "clOrdId":"",
        #                 "algoId":"1234",
        #                 "sz":"999",
        #                 "closeFraction":"",
        #                 "ordType":"oco",
        #                 "side":"buy",
        #                 "posSide":"long",
        #                 "tdMode":"cross",
        #                 "tgtCcy": "",
        #                 "state":"effective",
        #                 "lever":"20",
        #                 "tpTriggerPx":"",
        #                 "tpTriggerPxType":"",
        #                 "tpOrdPx":"",
        #                 "slTriggerPx":"",
        #                 "slTriggerPxType":"",
        #                 "triggerPx":"99",
        #                 "triggerPxType":"last",
        #                 "ordPx":"12",
        #                 "actualSz":"",
        #                 "actualPx":"",
        #                 "actualSide":"",
        #                 "pxVar":"",
        #                 "pxSpread":"",
        #                 "pxLimit":"",
        #                 "szLimit":"",
        #                 "tag": "adadadadad",
        #                 "timeInterval":"",
        #                 "callbackRatio":"",
        #                 "callbackSpread":"",
        #                 "activePx":"",
        #                 "moveTriggerPx":"",
        #                 "reduceOnly": "false",
        #                 "triggerTime":"1597026383085",
        #                 "last": "16012",
        #                 "failCode": "",
        #                 "algoClOrdId": "",
        #                 "cTime":"1597026383000"
        #             }
        #         ]
        #     }
        #
        data = self.safe_value(response, 'data', [])
        order = self.safe_dict(data, 0)
        return self.parse_order(order, market)

    def fetch_open_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
        """
        fetch all unfilled currently open orders

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-order-list
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-get-algo-order-list

        :param str symbol: unified market symbol
        :param int [since]: the earliest time in ms to fetch open orders for
        :param int [limit]: the maximum number of  open orders structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param bool [params.trigger]: True if fetching trigger or conditional orders
        :param str [params.ordType]: "conditional", "oco", "trigger", "move_order_stop", "iceberg", or "twap"
        :param str [params.algoId]: Algo ID "'433845797218942976'"
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :param boolean [params.trailing]: set to True if you want to fetch trailing orders
        :returns Order[]: a list of `order structures <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchOpenOrders', 'paginate')
        if paginate:
            return self.fetch_paginated_call_dynamic('fetchOpenOrders', symbol, since, limit, params)
        request: dict = {
            # 'instType': 'SPOT',  # SPOT, MARGIN, SWAP, FUTURES, OPTION
            # 'uly': currency['id'],
            # 'instId': market['id'],
            # 'ordType': 'limit',  # market, limit, post_only, fok, ioc, comma-separated, stop orders: conditional, oco, trigger, move_order_stop, iceberg, or twap
            # 'state': 'live',  # live, partially_filled
            # 'after': orderId,
            # 'before': orderId,
            # 'limit': limit,  # default 100, max 100
        }
        market = None
        if symbol is not None:
            market = self.market(symbol)
            request['instId'] = market['id']
        if limit is not None:
            request['limit'] = limit  # default 100, max 100
        options = self.safe_value(self.options, 'fetchOpenOrders', {})
        algoOrderTypes = self.safe_value(self.options, 'algoOrderTypes', {})
        defaultMethod = self.safe_string(options, 'method', 'privateGetTradeOrdersPending')
        method = self.safe_string(params, 'method', defaultMethod)
        ordType = self.safe_string(params, 'ordType')
        trigger = self.safe_value_2(params, 'stop', 'trigger')
        trailing = self.safe_bool(params, 'trailing', False)
        if trailing or trigger or (ordType in algoOrderTypes):
            method = 'privateGetTradeOrdersAlgoPending'
        if trailing:
            request['ordType'] = 'move_order_stop'
        elif trigger and (ordType is None):
            request['ordType'] = 'trigger'
        query = self.omit(params, ['method', 'stop', 'trigger', 'trailing'])
        response = None
        if method == 'privateGetTradeOrdersAlgoPending':
            response = self.privateGetTradeOrdersAlgoPending(self.extend(request, query))
        else:
            response = self.privateGetTradeOrdersPending(self.extend(request, query))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "accFillSz": "0",
        #                 "avgPx": "",
        #                 "cTime": "1621910749815",
        #                 "category": "normal",
        #                 "ccy": "",
        #                 "clOrdId": "",
        #                 "fee": "0",
        #                 "feeCcy": "ETH",
        #                 "fillPx": "",
        #                 "fillSz": "0",
        #                 "fillTime": "",
        #                 "instId": "ETH-USDT",
        #                 "instType": "SPOT",
        #                 "lever": "",
        #                 "ordId": "317251910906576896",
        #                 "ordType": "limit",
        #                 "pnl": "0",
        #                 "posSide": "net",
        #                 "px":"20 00",
        #                 "rebate": "0",
        #                 "rebateCcy": "USDT",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "state": "live",
        #                 "sz":"0. 001",
        #                 "tag": "",
        #                 "tdMode": "cash",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tradeId": "",
        #                 "uTime": "1621910749815"
        #             }
        #         ],
        #         "msg":""
        #     }
        #
        # Algo order
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "activePx": "",
        #                 "activePxType": "",
        #                 "actualPx": "",
        #                 "actualSide": "buy",
        #                 "actualSz": "0",
        #                 "algoId": "431375349042380800",
        #                 "cTime": "1649119897778",
        #                 "callbackRatio": "",
        #                 "callbackSpread": "",
        #                 "ccy": "",
        #                 "ctVal": "0.01",
        #                 "instId": "BTC-USDT-SWAP",
        #                 "instType": "SWAP",
        #                 "last": "46538.9",
        #                 "lever": "125",
        #                 "moveTriggerPx": "",
        #                 "notionalUsd": "467.059",
        #                 "ordId": "",
        #                 "ordPx": "50000",
        #                 "ordType": "trigger",
        #                 "posSide": "long",
        #                 "pxLimit": "",
        #                 "pxSpread": "",
        #                 "pxVar": "",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "slTriggerPxType": "",
        #                 "state": "live",
        #                 "sz": "1",
        #                 "szLimit": "",
        #                 "tag": "",
        #                 "tdMode": "isolated",
        #                 "tgtCcy": "",
        #                 "timeInterval": "",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tpTriggerPxType": "",
        #                 "triggerPx": "50000",
        #                 "triggerPxType": "last",
        #                 "triggerTime": "",
        #                 "uly": "BTC-USDT"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_orders(data, market, since, limit)

    def fetch_canceled_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
        """
        fetches information on multiple canceled orders made by the user

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-order-history-last-7-days
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-get-algo-order-history

        :param str symbol: unified market symbol of the market orders were made in
        :param int [since]: timestamp in ms of the earliest order, default is None
        :param int [limit]: max number of orders to return, default is None
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param bool [params.trigger]: True if fetching trigger or conditional orders
        :param str [params.ordType]: "conditional", "oco", "trigger", "move_order_stop", "iceberg", or "twap"
        :param str [params.algoId]: Algo ID "'433845797218942976'"
        :param int [params.until]: timestamp in ms to fetch orders for
        :param boolean [params.trailing]: set to True if you want to fetch trailing orders
        :returns dict: a list of `order structures <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        request: dict = {
            # 'instType': type.upper(),  # SPOT, MARGIN, SWAP, FUTURES, OPTION
            # 'uly': currency['id'],
            # 'instId': market['id'],
            # 'ordType': 'limit',  # market, limit, post_only, fok, ioc, comma-separated stop orders: conditional, oco, trigger, move_order_stop, iceberg, or twap
            # 'state': 'canceled',  # filled, canceled
            # 'after': orderId,
            # 'before': orderId,
            # 'limit': limit,  # default 100, max 100
            # 'algoId': "'433845797218942976'",  # Algo order
        }
        market = None
        if symbol is not None:
            market = self.market(symbol)
            request['instId'] = market['id']
        type = None
        query = None
        type, query = self.handle_market_type_and_params('fetchCanceledOrders', market, params)
        request['instType'] = self.convert_to_instrument_type(type)
        if limit is not None:
            request['limit'] = limit  # default 100, max 100
        request['state'] = 'canceled'
        options = self.safe_value(self.options, 'fetchCanceledOrders', {})
        algoOrderTypes = self.safe_value(self.options, 'algoOrderTypes', {})
        defaultMethod = self.safe_string(options, 'method', 'privateGetTradeOrdersHistory')
        method = self.safe_string(params, 'method', defaultMethod)
        ordType = self.safe_string(params, 'ordType')
        trigger = self.safe_value_2(params, 'stop', 'trigger')
        trailing = self.safe_bool(params, 'trailing', False)
        if trailing:
            method = 'privateGetTradeOrdersAlgoHistory'
            request['ordType'] = 'move_order_stop'
        elif trigger or (ordType in algoOrderTypes):
            method = 'privateGetTradeOrdersAlgoHistory'
            algoId = self.safe_string(params, 'algoId')
            if algoId is not None:
                request['algoId'] = algoId
                params = self.omit(params, 'algoId')
            if trigger:
                if ordType is None:
                    raise ArgumentsRequired(self.id + ' fetchCanceledOrders() requires an "ordType" string parameter, "conditional", "oco", "trigger", "move_order_stop", "iceberg", or "twap"')
        else:
            if since is not None:
                request['begin'] = since
            until = self.safe_integer(query, 'until')
            if until is not None:
                request['end'] = until
                query = self.omit(query, ['until'])
        send = self.omit(query, ['method', 'stop', 'trigger', 'trailing'])
        response = None
        if method == 'privateGetTradeOrdersAlgoHistory':
            response = self.privateGetTradeOrdersAlgoHistory(self.extend(request, send))
        else:
            response = self.privateGetTradeOrdersHistory(self.extend(request, send))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "accFillSz": "0",
        #                 "avgPx": "",
        #                 "cTime": "1644037822494",
        #                 "category": "normal",
        #                 "ccy": "",
        #                 "clOrdId": "",
        #                 "fee": "0",
        #                 "feeCcy": "BTC",
        #                 "fillPx": "",
        #                 "fillSz": "0",
        #                 "fillTime": "",
        #                 "instId": "BTC-USDT",
        #                 "instType": "SPOT",
        #                 "lever": "",
        #                 "ordId": "410059580352409602",
        #                 "ordType": "limit",
        #                 "pnl": "0",
        #                 "posSide": "net",
        #                 "px": "30000",
        #                 "rebate": "0",
        #                 "rebateCcy": "USDT",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "slTriggerPxType": "",
        #                 "source": "",
        #                 "state": "canceled",
        #                 "sz": "0.0005452",
        #                 "tag": "",
        #                 "tdMode": "cash",
        #                 "tgtCcy": "",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tpTriggerPxType": "",
        #                 "tradeId": "",
        #                 "uTime": "1644038165667"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        # Algo order
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "activePx": "",
        #                 "activePxType": "",
        #                 "actualPx": "",
        #                 "actualSide": "buy",
        #                 "actualSz": "0",
        #                 "algoId": "433845797218942976",
        #                 "cTime": "1649708898523",
        #                 "callbackRatio": "",
        #                 "callbackSpread": "",
        #                 "ccy": "",
        #                 "ctVal": "0.01",
        #                 "instId": "BTC-USDT-SWAP",
        #                 "instType": "SWAP",
        #                 "last": "39950.4",
        #                 "lever": "125",
        #                 "moveTriggerPx": "",
        #                 "notionalUsd": "1592.1760000000002",
        #                 "ordId": "",
        #                 "ordPx": "29000",
        #                 "ordType": "trigger",
        #                 "posSide": "long",
        #                 "pxLimit": "",
        #                 "pxSpread": "",
        #                 "pxVar": "",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "slTriggerPxType": "",
        #                 "state": "canceled",
        #                 "sz": "4",
        #                 "szLimit": "",
        #                 "tag": "",
        #                 "tdMode": "isolated",
        #                 "tgtCcy": "",
        #                 "timeInterval": "",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tpTriggerPxType": "",
        #                 "triggerPx": "30000",
        #                 "triggerPxType": "last",
        #                 "triggerTime": "",
        #                 "uly": "BTC-USDT"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_orders(data, market, since, limit)

    def fetch_closed_orders(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Order]:
        """
        fetches information on multiple closed orders made by the user

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-order-history-last-7-days
        https://www.okx.com/docs-v5/en/#order-book-trading-algo-trading-get-algo-order-history
        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-order-history-last-3-months

        :param str symbol: unified market symbol of the market orders were made in
        :param int [since]: the earliest time in ms to fetch orders for
        :param int [limit]: the maximum number of order structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param bool [params.trigger]: True if fetching trigger or conditional orders
        :param str [params.ordType]: "conditional", "oco", "trigger", "move_order_stop", "iceberg", or "twap"
        :param str [params.algoId]: Algo ID "'433845797218942976'"
        :param int [params.until]: timestamp in ms to fetch orders for
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :param str [params.method]: method to be used, either 'privateGetTradeOrdersHistory', 'privateGetTradeOrdersHistoryArchive' or 'privateGetTradeOrdersAlgoHistory' default is 'privateGetTradeOrdersHistory'
        :param boolean [params.trailing]: set to True if you want to fetch trailing orders
        :returns Order[]: a list of `order structures <https://docs.ccxt.com/?id=order-structure>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchClosedOrders', 'paginate')
        if paginate:
            return self.fetch_paginated_call_dynamic('fetchClosedOrders', symbol, since, limit, params)
        request: dict = {
            # 'instType': type.upper(),  # SPOT, MARGIN, SWAP, FUTURES, OPTION
            # 'uly': currency['id'],
            # 'instId': market['id'],
            # 'ordType': 'limit',  # market, limit, post_only, fok, ioc, comma-separated stop orders: conditional, oco, trigger, move_order_stop, iceberg, or twap
            # 'state': 'filled',  # filled, effective
            # 'after': orderId,
            # 'before': orderId,
            # 'limit': limit,  # default 100, max 100
            # 'algoId': "'433845797218942976'",  # Algo order
        }
        market = None
        if symbol is not None:
            market = self.market(symbol)
            request['instId'] = market['id']
        type = None
        query = None
        type, query = self.handle_market_type_and_params('fetchClosedOrders', market, params)
        request['instType'] = self.convert_to_instrument_type(type)
        if limit is not None:
            request['limit'] = limit  # default 100, max 100
        options = self.safe_dict(self.options, 'fetchClosedOrders', {})
        algoOrderTypes = self.safe_dict(self.options, 'algoOrderTypes', {})
        defaultMethod = self.safe_string(options, 'method', 'privateGetTradeOrdersHistory')
        method = self.safe_string(params, 'method', defaultMethod)
        ordType = self.safe_string(params, 'ordType')
        trigger = self.safe_bool_2(params, 'stop', 'trigger')
        trailing = self.safe_bool(params, 'trailing', False)
        if trailing or trigger or (ordType in algoOrderTypes):
            method = 'privateGetTradeOrdersAlgoHistory'
            request['state'] = 'effective'
        if trailing:
            request['ordType'] = 'move_order_stop'
        elif trigger:
            if ordType is None:
                request['ordType'] = 'trigger'
        else:
            if since is not None:
                request['begin'] = since
            until = self.safe_integer(query, 'until')
            if until is not None:
                request['end'] = until
                query = self.omit(query, ['until'])
            request['state'] = 'filled'
        send = self.omit(query, ['method', 'stop', 'trigger', 'trailing'])
        response = None
        if method == 'privateGetTradeOrdersAlgoHistory':
            response = self.privateGetTradeOrdersAlgoHistory(self.extend(request, send))
        elif method == 'privateGetTradeOrdersHistoryArchive':
            response = self.privateGetTradeOrdersHistoryArchive(self.extend(request, send))
        else:
            response = self.privateGetTradeOrdersHistory(self.extend(request, send))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "accFillSz": "0",
        #                 "avgPx": "",
        #                 "cTime": "1621910749815",
        #                 "category": "normal",
        #                 "ccy": "",
        #                 "clOrdId": "",
        #                 "fee": "0",
        #                 "feeCcy": "ETH",
        #                 "fillPx": "",
        #                 "fillSz": "0",
        #                 "fillTime": "",
        #                 "instId": "ETH-USDT",
        #                 "instType": "SPOT",
        #                 "lever": "",
        #                 "ordId": "317251910906576896",
        #                 "ordType": "limit",
        #                 "pnl": "0",
        #                 "posSide": "net",
        #                 "px": "2000",
        #                 "rebate": "0",
        #                 "rebateCcy": "USDT",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "state": "live",
        #                 "sz": "0.001",
        #                 "tag": "",
        #                 "tdMode": "cash",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tradeId": "",
        #                 "uTime": "1621910749815"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        # Algo order
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "activePx": "",
        #                 "activePxType": "",
        #                 "actualPx": "",
        #                 "actualSide": "buy",
        #                 "actualSz": "0",
        #                 "algoId": "433845797218942976",
        #                 "cTime": "1649708898523",
        #                 "callbackRatio": "",
        #                 "callbackSpread": "",
        #                 "ccy": "",
        #                 "ctVal": "0.01",
        #                 "instId": "BTC-USDT-SWAP",
        #                 "instType": "SWAP",
        #                 "last": "39950.4",
        #                 "lever": "125",
        #                 "moveTriggerPx": "",
        #                 "notionalUsd": "1592.1760000000002",
        #                 "ordId": "",
        #                 "ordPx": "29000",
        #                 "ordType": "trigger",
        #                 "posSide": "long",
        #                 "pxLimit": "",
        #                 "pxSpread": "",
        #                 "pxVar": "",
        #                 "side": "buy",
        #                 "slOrdPx": "",
        #                 "slTriggerPx": "",
        #                 "slTriggerPxType": "",
        #                 "state": "effective",
        #                 "sz": "4",
        #                 "szLimit": "",
        #                 "tag": "",
        #                 "tdMode": "isolated",
        #                 "tgtCcy": "",
        #                 "timeInterval": "",
        #                 "tpOrdPx": "",
        #                 "tpTriggerPx": "",
        #                 "tpTriggerPxType": "",
        #                 "triggerPx": "30000",
        #                 "triggerPxType": "last",
        #                 "triggerTime": "",
        #                 "uly": "BTC-USDT"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_orders(data, market, since, limit)

    def fetch_my_trades(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
        """
        fetch all trades made by the user

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-transaction-details-last-3-months

        :param str symbol: unified market symbol
        :param int [since]: the earliest time in ms to fetch trades for
        :param int [limit]: the maximum number of trades structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param int [params.until]: Timestamp in ms of the latest time to retrieve trades for
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :returns Trade[]: a list of `trade structures <https://docs.ccxt.com/?id=trade-structure>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchMyTrades', 'paginate')
        if paginate:
            return self.fetch_paginated_call_dynamic('fetchMyTrades', symbol, since, limit, params)
        request: dict = {
            # 'instType': 'SPOT',  # SPOT, MARGIN, SWAP, FUTURES, OPTION
            # 'uly': currency['id'],
            # 'instId': market['id'],
            # 'ordId': orderId,
            # 'after': billId,
            # 'before': billId,
            # 'limit': limit,  # default 100, max 100
        }
        market = None
        if symbol is not None:
            market = self.market(symbol)
            request['instId'] = market['id']
        if since is not None:
            request['begin'] = since
        request, params = self.handle_until_option('end', request, params)
        type, query = self.handle_market_type_and_params('fetchMyTrades', market, params)
        request['instType'] = self.convert_to_instrument_type(type)
        if (limit is not None) and (since is None):  # limit = n, okx will return the n most recent results, instead of the n results after limit, so limit should only be sent when since is None
            request['limit'] = limit  # default 100, max 100
        response = self.privateGetTradeFillsHistory(self.extend(request, query))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "side": "buy",
        #                 "fillSz": "0.007533",
        #                 "fillPx": "2654.98",
        #                 "fee": "-0.000007533",
        #                 "ordId": "317321390244397056",
        #                 "instType": "SPOT",
        #                 "instId": "ETH-USDT",
        #                 "clOrdId": "",
        #                 "posSide": "net",
        #                 "billId": "317321390265368576",
        #                 "tag": "0",
        #                 "execType": "T",
        #                 "tradeId": "107601752",
        #                 "feeCcy": "ETH",
        #                 "ts": "1621927314985"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_trades(data, market, since, limit, query)

    def fetch_order_trades(self, id: str, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
        """
        fetch all the trades made from a single order

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-get-transaction-details-last-3-months

        :param str id: order id
        :param str symbol: unified market symbol
        :param int [since]: the earliest time in ms to fetch trades for
        :param int [limit]: the maximum number of trades to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict[]: a list of `trade structures <https://docs.ccxt.com/?id=trade-structure>`
        """
        request: dict = {
            # 'instrument_id': market['id'],
            'ordId': id,
            # 'after': '1',  # return the page after the specified page number
            # 'before': '1',  # return the page before the specified page number
            # 'limit': limit,  # optional, number of results per request, default = maximum = 100
        }
        return self.fetch_my_trades(symbol, since, limit, self.extend(request, params))

    def fetch_ledger(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[LedgerEntry]:
        """
        fetch the history of changes, actions done by the user or operations that altered balance of the user

        https://www.okx.com/docs-v5/en/#rest-api-account-get-bills-details-last-7-days
        https://www.okx.com/docs-v5/en/#rest-api-account-get-bills-details-last-3-months
        https://www.okx.com/docs-v5/en/#rest-api-funding-asset-bills-details

        :param str [code]: unified currency code, default is None
        :param int [since]: timestamp in ms of the earliest ledger entry, default is None
        :param int [limit]: max number of ledger entries to return, default is None
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.marginMode]: 'cross' or 'isolated'
        :param int [params.until]: the latest time in ms to fetch entries for
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [available parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :returns dict: a `ledger structure <https://docs.ccxt.com/?id=ledger-entry-structure>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchLedger', 'paginate')
        if paginate:
            return self.fetch_paginated_call_dynamic('fetchLedger', code, since, limit, params)
        options = self.safe_dict(self.options, 'fetchLedger', {})
        method = self.safe_string(options, 'method')
        method = self.safe_string(params, 'method', method)
        params = self.omit(params, 'method')
        request: dict = {
            # 'instType': None,  # 'SPOT', 'MARGIN', 'SWAP', 'FUTURES", 'OPTION'
            # 'ccy': None,  # currency['id'],
            # 'mgnMode': None,  # 'isolated', 'cross'
            # 'ctType': None,  # 'linear', 'inverse', only applicable to FUTURES/SWAP
            # 'type': varies depending the 'method' endpoint :
            #     - https://www.okx.com/docs-v5/en/#rest-api-account-get-bills-details-last-7-days
            #     - https://www.okx.com/docs-v5/en/#rest-api-funding-asset-bills-details
            #     - https://www.okx.com/docs-v5/en/#rest-api-account-get-bills-details-last-3-months
            # 'after': 'id',  # return records earlier than the requested bill id
            # 'before': 'id',  # return records newer than the requested bill id
            # 'limit': 100,  # default 100, max 100
        }
        marginMode = None
        marginMode, params = self.handle_margin_mode_and_params('fetchLedger', params)
        if marginMode is None:
            marginMode = self.safe_string(params, 'mgnMode')
        if method != 'privateGetAssetBills':
            if marginMode is not None:
                request['mgnMode'] = marginMode
        type, query = self.handle_market_type_and_params('fetchLedger', None, params)
        if type is not None:
            request['instType'] = self.convert_to_instrument_type(type)
        if limit is not None:
            request['limit'] = limit
        currency = None
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        request, params = self.handle_until_option('end', request, params)
        response = None
        if method == 'privateGetAccountBillsArchive':
            response = self.privateGetAccountBillsArchive(self.extend(request, query))
        elif method == 'privateGetAssetBills':
            response = self.privateGetAssetBills(self.extend(request, query))
        else:
            response = self.privateGetAccountBills(self.extend(request, query))
        #
        # privateGetAccountBills, privateGetAccountBillsArchive
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "bal": "0.0000819307998198",
        #                 "balChg": "-664.2679586599999802",
        #                 "billId": "310394313544966151",
        #                 "ccy": "USDT",
        #                 "fee": "0",
        #                 "from": "",
        #                 "instId": "LTC-USDT",
        #                 "instType": "SPOT",
        #                 "mgnMode": "cross",
        #                 "notes": "",
        #                 "ordId": "310394313519800320",
        #                 "pnl": "0",
        #                 "posBal": "0",
        #                 "posBalChg": "0",
        #                 "subType": "2",
        #                 "sz": "664.26795866",
        #                 "to": "",
        #                 "ts": "1620275771196",
        #                 "type": "2"
        #             }
        #         ]
        #     }
        #
        # privateGetAssetBills
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "billId": "12344",
        #                 "ccy": "BTC",
        #                 "balChg": "2",
        #                 "bal": "12",
        #                 "type": "1",
        #                 "ts": "1597026383085"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_ledger(data, currency, since, limit)

    def parse_ledger_entry_type(self, type):
        types: dict = {
            '1': 'transfer',  # transfer
            '2': 'trade',  # trade
            '3': 'trade',  # delivery
            '4': 'rebate',  # auto token conversion
            '5': 'trade',  # liquidation
            '6': 'transfer',  # margin transfer
            '7': 'trade',  # interest deduction
            '8': 'fee',  # funding rate
            '9': 'trade',  # adl
            '10': 'trade',  # clawback
            '11': 'trade',  # system token conversion
        }
        return self.safe_string(types, type, type)

    def parse_ledger_entry(self, item: dict, currency: Currency = None) -> LedgerEntry:
        #
        # privateGetAccountBills, privateGetAccountBillsArchive
        #
        #     {
        #         "bal": "0.0000819307998198",
        #         "balChg": "-664.2679586599999802",
        #         "billId": "310394313544966151",
        #         "ccy": "USDT",
        #         "fee": "0",
        #         "from": "",
        #         "instId": "LTC-USDT",
        #         "instType": "SPOT",
        #         "mgnMode": "cross",
        #         "notes": "",
        #         "ordId": "310394313519800320",
        #         "pnl": "0",
        #         "posBal": "0",
        #         "posBalChg": "0",
        #         "subType": "2",
        #         "sz": "664.26795866",
        #         "to": "",
        #         "ts": "1620275771196",
        #         "type": "2"
        #     }
        #
        # privateGetAssetBills
        #
        #     {
        #         "billId": "12344",
        #         "ccy": "BTC",
        #         "balChg": "2",
        #         "bal": "12",
        #         "type": "1",
        #         "ts": "1597026383085"
        #     }
        #
        currencyId = self.safe_string(item, 'ccy')
        code = self.safe_currency_code(currencyId, currency)
        currency = self.safe_currency(currencyId, currency)
        timestamp = self.safe_integer(item, 'ts')
        feeCostString = self.safe_string(item, 'fee')
        fee = None
        if feeCostString is not None:
            fee = {
                'cost': self.parse_number(Precise.string_neg(feeCostString)),
                'currency': code,
            }
        marketId = self.safe_string(item, 'instId')
        symbol = self.safe_symbol(marketId, None, '-')
        return self.safe_ledger_entry({
            'info': item,
            'id': self.safe_string(item, 'billId'),
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'account': None,
            'referenceId': self.safe_string(item, 'ordId'),
            'referenceAccount': None,
            'type': self.parse_ledger_entry_type(self.safe_string(item, 'type')),
            'currency': code,
            'symbol': symbol,
            'amount': self.safe_number(item, 'balChg'),
            'before': None,
            'after': self.safe_number(item, 'bal'),
            'status': 'ok',
            'fee': fee,
        }, currency)

    def parse_deposit_address(self, depositAddress, currency: Currency = None) -> DepositAddress:
        #
        #     {
        #         "addr": "okbtothemoon",
        #         "memo": "971668",  # may be missing
        #         "tag":"52055",  # may be missing
        #         "pmtId": "",  # may be missing
        #         "ccy": "BTC",
        #         "to": "6",  # 1 SPOT, 3 FUTURES, 6 FUNDING, 9 SWAP, 12 OPTION, 18 Unified account
        #         "selected": True
        #     }
        #
        #     {
        #         "ccy":"usdt-erc20",
        #         "to":"6",
        #         "addr":"0x696abb81974a8793352cbd33aadcf78eda3cfdfa",
        #         "selected":true
        #     }
        #
        #     {
        #        "chain": "ETH-OKExChain",
        #        "addrEx": {"comment": "6040348"},  # some currencies like TON may have self field,
        #        "ctAddr": "72315c",
        #        "ccy": "ETH",
        #        "to": "6",
        #        "addr": "0x1c9f2244d1ccaa060bd536827c18925db10db102",
        #        "selected": True
        #     }
        #
        address = self.safe_string(depositAddress, 'addr')
        tag = self.safe_string_n(depositAddress, ['tag', 'pmtId', 'memo'])
        if tag is None:
            addrEx = self.safe_value(depositAddress, 'addrEx', {})
            tag = self.safe_string(addrEx, 'comment')
        currencyId = self.safe_string(depositAddress, 'ccy')
        currency = self.safe_currency(currencyId, currency)
        code = currency['code']
        chain = self.safe_string(depositAddress, 'chain')
        networks = self.safe_value(currency, 'networks', {})
        networksById = self.index_by(networks, 'id')
        networkData = self.safe_value(networksById, chain)
        # inconsistent naming responses from exchange
        # with respect to network naming provided in currency info vs address chain-names and ids
        #
        # response from address endpoint:
        #      {
        #          "chain": "USDT-Polygon",
        #          "ctAddr": "",
        #          "ccy": "USDT",
        #          "to":"6" ,
        #          "addr": "0x1903441e386cc49d937f6302955b5feb4286dcfa",
        #          "selected": True
        #      }
        # network information from currency['networks'] field:
        # Polygon: {
        #        info: {
        #            canDep: False,
        #            canInternal: False,
        #            canWd: False,
        #            ccy: 'USDT',
        #            chain: 'USDT-Polygon-Bridge',
        #            mainNet: False,
        #            maxFee: '26.879528',
        #            minFee: '13.439764',
        #            minWd: '0.001',
        #            name: ''
        #        },
        #        id: 'USDT-Polygon-Bridge',
        #        network: 'Polygon',
        #        active: False,
        #        deposit: False,
        #        withdraw: False,
        #        fee: 13.439764,
        #        precision: None,
        #        limits: {
        #            withdraw: {
        #                min: 0.001,
        #                max: None
        #            }
        #        }
        #     },
        #
        if chain == 'USDT-Polygon':
            networkData = self.safe_value_2(networksById, 'USDT-Polygon-Bridge', 'USDT-Polygon')
        network = self.safe_string(networkData, 'network')
        networkCode = self.network_id_to_code(network, code)
        self.check_address(address)
        return {
            'info': depositAddress,
            'currency': code,
            'network': networkCode,
            'address': address,
            'tag': tag,
        }

    def fetch_deposit_addresses_by_network(self, code: str, params={}) -> List[DepositAddress]:
        """
        fetch a dictionary of addresses for a currency, indexed by network

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-get-deposit-address

        :param str code: unified currency code of the currency for the deposit address
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `address structures <https://docs.ccxt.com/?id=address-structure>` indexed by the network
        """
        self.load_markets()
        currency = self.currency(code)
        request: dict = {
            'ccy': currency['id'],
        }
        response = self.privateGetAssetDepositAddress(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "addr": "okbtothemoon",
        #                 "memo": "971668",  # may be missing
        #                 "tag":"52055",  # may be missing
        #                 "pmtId": "",  # may be missing
        #                 "ccy": "BTC",
        #                 "to": "6",  # 1 SPOT, 3 FUTURES, 6 FUNDING, 9 SWAP, 12 OPTION, 18 Unified account
        #                 "selected": True
        #             },
        #             # {"ccy":"usdt-erc20","to":"6","addr":"0x696abb81974a8793352cbd33aadcf78eda3cfdfa","selected":true},
        #             # {"ccy":"usdt-trc20","to":"6","addr":"TRrd5SiSZrfQVRKm4e9SRSbn2LNTYqCjqx","selected":true},
        #             # {"ccy":"usdt_okexchain","to":"6","addr":"0x696abb81974a8793352cbd33aadcf78eda3cfdfa","selected":true},
        #             # {"ccy":"usdt_kip20","to":"6","addr":"0x696abb81974a8793352cbd33aadcf78eda3cfdfa","selected":true},
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        filtered = self.filter_by(data, 'selected', True)
        parsed = self.parse_deposit_addresses(filtered, [currency['code']], False)
        return self.index_by(parsed, 'network')

    def fetch_deposit_address(self, code: str, params={}) -> DepositAddress:
        """
        fetch the deposit address for a currency associated with self account

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-get-deposit-address

        :param str code: unified currency code
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.network]: the network name for the deposit address
        :returns dict: an `address structure <https://docs.ccxt.com/?id=address-structure>`
        """
        self.load_markets()
        rawNetwork = self.safe_string(params, 'network')  # some networks are like "Dora Vota Mainnet"
        params = self.omit(params, 'network')
        code = self.safe_currency_code(code)
        network = self.network_id_to_code(rawNetwork, code)
        response = self.fetch_deposit_addresses_by_network(code, params)
        if network is not None:
            result = self.safe_dict(response, network)
            if result is None:
                raise InvalidAddress(self.id + ' fetchDepositAddress() cannot find ' + network + ' deposit address for ' + code)
            return result
        codeNetwork = self.network_id_to_code(code, code)
        if codeNetwork in response:
            return response[codeNetwork]
        # if the network is not specified, return the first address
        keys = list(response.keys())
        first = self.safe_string(keys, 0)
        return self.safe_dict(response, first)

    def withdraw(self, code: str, amount: float, address: str, tag: Str = None, params={}) -> Transaction:
        """
        make a withdrawal

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-withdrawal

        :param str code: unified currency code
        :param float amount: the amount to withdraw
        :param str address: the address to withdraw to
        :param str tag:
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `transaction structure <https://docs.ccxt.com/?id=transaction-structure>`
        """
        tag, params = self.handle_withdraw_tag_and_params(tag, params)
        self.check_address(address)
        self.load_markets()
        currency = self.currency(code)
        if (tag is not None) and (len(tag) > 0):
            address = address + ':' + tag
        request: dict = {
            'ccy': currency['id'],
            'toAddr': address,
            'dest': '4',  # 2 = OKCoin International, 3 = OKX 4 = others
            'amt': self.number_to_string(amount),
        }
        network = self.safe_string(params, 'network')  # self line allows the user to specify either ERC20 or ETH
        if network is not None:
            networks = self.safe_dict(self.options, 'networks', {})
            network = self.safe_string(networks, network.upper(), network)  # handle ETH>ERC20 alias
            request['chain'] = currency['id'] + '-' + network
            params = self.omit(params, 'network')
        fee = self.safe_string(params, 'fee')
        if fee is None:
            currencies = self.fetch_currencies()
            self.currencies = self.map_to_safe_map(self.deep_extend(self.currencies, currencies))
            targetNetwork = self.safe_dict(currency['networks'], self.network_id_to_code(network, currency['code']), {})
            fee = self.safe_string(targetNetwork, 'fee')
            if fee is None:
                raise ArgumentsRequired(self.id + ' withdraw() requires a "fee" string parameter, network transaction fee must be ≥ 0. Withdrawals to OKCoin or OKX are fee-free, please set "0". Withdrawing to external digital asset address requires network transaction fee.')
        request['fee'] = self.number_to_string(fee)  # withdrawals to OKCoin or OKX are fee-free, please set 0
        query = self.omit(params, ['fee'])
        response = self.privatePostAssetWithdrawal(self.extend(request, query))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "amt": "0.1",
        #                 "wdId": "67485",
        #                 "ccy": "BTC"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        transaction = self.safe_dict(data, 0)
        return self.parse_transaction(transaction, currency)

    def fetch_deposits(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]:
        """
        fetch all deposits made to an account

        https://www.okx.com/docs-v5/en/#rest-api-funding-get-deposit-history

        :param str code: unified currency code
        :param int [since]: the earliest time in ms to fetch deposits for
        :param int [limit]: the maximum number of deposits structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param int [params.until]: the latest time in ms to fetch entries for
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :returns dict[]: a list of `transaction structures <https://docs.ccxt.com/?id=transaction-structure>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchDeposits', 'paginate')
        if paginate:
            return self.fetch_paginated_call_dynamic('fetchDeposits', code, since, limit, params)
        request: dict = {
            # 'ccy': currency['id'],
            # 'state': 2,  # 0 waiting for confirmation, 1 deposit credited, 2 deposit successful
            # 'after': since,
            # 'before' self.milliseconds(),
            # 'limit': limit,  # default 100, max 100
        }
        currency = None
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        if since is not None:
            request['before'] = max(since - 1, 0)
        if limit is not None:
            request['limit'] = limit  # default 100, max 100
        request, params = self.handle_until_option('after', request, params)
        response = self.privateGetAssetDepositHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "amt": "0.01044408",
        #                 "txId": "1915737_3_0_0_asset",
        #                 "ccy": "BTC",
        #                 "from": "13801825426",
        #                 "to": "",
        #                 "ts": "1597026383085",
        #                 "state": "2",
        #                 "depId": "4703879"
        #             },
        #             {
        #                 "amt": "491.6784211",
        #                 "txId": "1744594_3_184_0_asset",
        #                 "ccy": "OKB",
        #                 "from": "",
        #                 "to": "",
        #                 "ts": "1597026383085",
        #                 "state": "2",
        #                 "depId": "4703809"
        #             },
        #             {
        #                 "amt": "223.18782496",
        #                 "txId": "6d892c669225b1092c780bf0da0c6f912fc7dc8f6b8cc53b003288624c",
        #                 "ccy": "USDT",
        #                 "from": "",
        #                 "to": "39kK4XvgEuM7rX9frgyHoZkWqx4iKu1spD",
        #                 "ts": "1597026383085",
        #                 "state": "2",
        #                 "depId": "4703779"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_transactions(data, currency, since, limit, params)

    def fetch_deposit(self, id: str, code: Str = None, params={}):
        """
        fetch data on a currency deposit via the deposit id

        https://www.okx.com/docs-v5/en/#rest-api-funding-get-deposit-history

        :param str id: deposit id
        :param str code: filter by currency code
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `transaction structure <https://docs.ccxt.com/?id=transaction-structure>`
        """
        self.load_markets()
        request: dict = {
            'depId': id,
        }
        currency = None
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        response = self.privateGetAssetDepositHistory(self.extend(request, params))
        data = self.safe_value(response, 'data')
        deposit = self.safe_dict(data, 0, {})
        return self.parse_transaction(deposit, currency)

    def fetch_withdrawals(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Transaction]:
        """
        fetch all withdrawals made from an account

        https://www.okx.com/docs-v5/en/#rest-api-funding-get-withdrawal-history

        :param str code: unified currency code
        :param int [since]: the earliest time in ms to fetch withdrawals for
        :param int [limit]: the maximum number of withdrawals structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param int [params.until]: the latest time in ms to fetch entries for
        :param boolean [params.paginate]: default False, when True will automatically paginate by calling self endpoint multiple times. See in the docs all the [availble parameters](https://github.com/ccxt/ccxt/wiki/Manual#pagination-params)
        :returns dict[]: a list of `transaction structures <https://docs.ccxt.com/?id=transaction-structure>`
        """
        self.load_markets()
        paginate = False
        paginate, params = self.handle_option_and_params(params, 'fetchWithdrawals', 'paginate')
        if paginate:
            return self.fetch_paginated_call_dynamic('fetchWithdrawals', code, since, limit, params)
        request: dict = {
            # 'ccy': currency['id'],
            # 'state': 2,  # -3: pending cancel, -2 canceled, -1 failed, 0, pending, 1 sending, 2 sent, 3 awaiting email verification, 4 awaiting manual verification, 5 awaiting identity verification
            # 'after': since,
            # 'before': self.milliseconds(),
            # 'limit': limit,  # default 100, max 100
        }
        currency = None
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        if since is not None:
            request['before'] = max(since - 1, 0)
        if limit is not None:
            request['limit'] = limit  # default 100, max 100
        request, params = self.handle_until_option('after', request, params)
        response = self.privateGetAssetWithdrawalHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "amt": "0.094",
        #                 "wdId": "4703879",
        #                 "fee": "0.01000000eth",
        #                 "txId": "0x62477bac6509a04512819bb1455e923a60dea5966c7caeaa0b24eb8fb0432b85",
        #                 "ccy": "ETH",
        #                 "from": "13426335357",
        #                 "to": "0xA41446125D0B5b6785f6898c9D67874D763A1519",
        #                 "ts": "1597026383085",
        #                 "state": "2"
        #             },
        #             {
        #                 "amt": "0.01",
        #                 "wdId": "4703879",
        #                 "fee": "0.00000000btc",
        #                 "txId": "",
        #                 "ccy": "BTC",
        #                 "from": "13426335357",
        #                 "to": "13426335357",
        #                 "ts": "1597026383085",
        #                 "state": "2"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_transactions(data, currency, since, limit, params)

    def fetch_withdrawal(self, id: str, code: Str = None, params={}):
        """
        fetch data on a currency withdrawal via the withdrawal id

        https://www.okx.com/docs-v5/en/#rest-api-funding-get-withdrawal-history

        :param str id: withdrawal id
        :param str code: unified currency code of the currency withdrawn, default is None
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `transaction structure <https://docs.ccxt.com/?id=transaction-structure>`
        """
        self.load_markets()
        request: dict = {
            'wdId': id,
        }
        currency = None
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        response = self.privateGetAssetWithdrawalHistory(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "chain": "USDT-TRC20",
        #                "clientId": '',
        #                "fee": "0.8",
        #                "ccy": "USDT",
        #                "amt": "54.561",
        #                "txId": "00cff6ec7fa7c7d7d184bd84e82b9ff36863f07c0421188607f87dfa94e06b70",
        #                "from": "example@email.com",
        #                "to": "TEY6qjnKDyyq5jDc3DJizWLCdUySrpQ4yp",
        #                "state": "2",
        #                "ts": "1641376485000",
        #                "wdId": "25147041"
        #            }
        #        ],
        #        "msg": ''
        #    }
        #
        data = self.safe_list(response, 'data', [])
        withdrawal = self.safe_dict(data, 0, {})
        return self.parse_transaction(withdrawal)

    def parse_transaction_status(self, status: Str):
        #
        # deposit statuses
        #
        #     {
        #         "0": "waiting for confirmation",
        #         "1": "deposit credited",
        #         "2": "deposit successful"
        #     }
        #
        # withdrawal statuses
        #
        #     {
        #        '-3': "pending cancel",
        #        "-2": "canceled",
        #        "-1": "failed",
        #         "0": "pending",
        #         "1": "sending",
        #         "2": "sent",
        #         "3": "awaiting email verification",
        #         "4": "awaiting manual verification",
        #         "5": "awaiting identity verification"
        #     }
        #
        statuses: dict = {
            '-3': 'pending',
            '-2': 'canceled',
            '-1': 'failed',
            '0': 'pending',
            '1': 'pending',
            '2': 'ok',
            '3': 'pending',
            '4': 'pending',
            '5': 'pending',
            '6': 'pending',
            '7': 'pending',
            '8': 'pending',
            '9': 'pending',
            '10': 'pending',
            '12': 'pending',
            '15': 'pending',
            '16': 'pending',
        }
        return self.safe_string(statuses, status, status)

    def parse_transaction(self, transaction: dict, currency: Currency = None) -> Transaction:
        #
        # withdraw
        #
        #     {
        #         "amt": "0.1",
        #         "wdId": "67485",
        #         "ccy": "BTC"
        #     }
        #
        # fetchWithdrawals
        #
        #     {
        #         "amt": "0.094",
        #         "wdId": "4703879",
        #         "fee": "0.01000000eth",
        #         "txId": "0x62477bac6509a04512819bb1455e923a60dea5966c7caeaa0b24eb8fb0432b85",
        #         "ccy": "ETH",
        #         "from": "13426335357",
        #         "to": "0xA41446125D0B5b6785f6898c9D67874D763A1519",
        #         "tag",
        #         "pmtId",
        #         "memo",
        #         "ts": "1597026383085",
        #         "state": "2"
        #     }
        #
        # fetchDeposits
        #
        #     {
        #         "amt": "0.01044408",
        #         "txId": "1915737_3_0_0_asset",
        #         "ccy": "BTC",
        #         "from": "13801825426",
        #         "to": "",
        #         "ts": "1597026383085",
        #         "state": "2",
        #         "depId": "4703879"
        #     }
        #
        type = None
        id = None
        withdrawalId = self.safe_string(transaction, 'wdId')
        addressFrom = self.safe_string(transaction, 'from')
        addressTo = self.safe_string(transaction, 'to')
        address = addressTo
        tagTo = self.safe_string_2(transaction, 'tag', 'memo')
        tagTo = self.safe_string_2(transaction, 'pmtId', tagTo)
        if withdrawalId is not None:
            type = 'withdrawal'
            id = withdrawalId
        else:
            # the payment_id will appear on new deposits but appears to be removed from the response after 2 months
            id = self.safe_string(transaction, 'depId')
            type = 'deposit'
        currencyId = self.safe_string(transaction, 'ccy')
        code = self.safe_currency_code(currencyId)
        amount = self.safe_number(transaction, 'amt')
        status = self.parse_transaction_status(self.safe_string(transaction, 'state'))
        txid = self.safe_string(transaction, 'txId')
        timestamp = self.safe_integer(transaction, 'ts')
        feeCost = None
        if type == 'deposit':
            feeCost = 0
        else:
            feeCost = self.safe_number(transaction, 'fee')
        # todo parse tags
        return {
            'info': transaction,
            'id': id,
            'currency': code,
            'amount': amount,
            'network': None,
            'addressFrom': addressFrom,
            'addressTo': addressTo,
            'address': address,
            'tagFrom': None,
            'tagTo': tagTo,
            'tag': tagTo,
            'status': status,
            'type': type,
            'updated': None,
            'txid': txid,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'internal': None,
            'comment': None,
            'fee': {
                'currency': code,
                'cost': feeCost,
            },
        }

    def fetch_leverage(self, symbol: str, params={}) -> Leverage:
        """
        fetch the set leverage for a market

        https://www.okx.com/docs-v5/en/#rest-api-account-get-leverage

        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.marginMode]: 'cross' or 'isolated'
        :returns dict: a `leverage structure <https://docs.ccxt.com/?id=leverage-structure>`
        """
        self.load_markets()
        marginMode = None
        marginMode, params = self.handle_margin_mode_and_params('fetchLeverage', params)
        if marginMode is None:
            marginMode = self.safe_string(params, 'mgnMode', 'cross')  # cross marginMode
        if (marginMode != 'cross') and (marginMode != 'isolated'):
            raise BadRequest(self.id + ' fetchLeverage() requires a marginMode parameter that must be either cross or isolated')
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
            'mgnMode': marginMode,
        }
        response = self.privateGetAccountLeverageInfo(self.extend(request, params))
        #
        #     {
        #        "code": "0",
        #        "data": [
        #            {
        #                "instId": "BTC-USDT-SWAP",
        #                "lever": "5.00000000",
        #                "mgnMode": "isolated",
        #                "posSide": "net"
        #            }
        #        ],
        #        "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_leverage(data, market)

    def parse_leverage(self, leverage: dict, market: Market = None) -> Leverage:
        marketId = None
        marginMode = None
        longLeverage = None
        shortLeverage = None
        for i in range(0, len(leverage)):
            entry = leverage[i]
            marginMode = self.safe_string_lower(entry, 'mgnMode')
            marketId = self.safe_string(entry, 'instId')
            positionSide = self.safe_string_lower(entry, 'posSide')
            if positionSide == 'long':
                longLeverage = self.safe_integer(entry, 'lever')
            elif positionSide == 'short':
                shortLeverage = self.safe_integer(entry, 'lever')
            else:
                longLeverage = self.safe_integer(entry, 'lever')
                shortLeverage = self.safe_integer(entry, 'lever')
        return {
            'info': leverage,
            'symbol': self.safe_symbol(marketId, market),
            'marginMode': marginMode,
            'longLeverage': longLeverage,
            'shortLeverage': shortLeverage,
        }

    def fetch_position(self, symbol: str, params={}):
        """
        fetch data on a single open contract trade position

        https://www.okx.com/docs-v5/en/#rest-api-account-get-positions

        :param str symbol: unified market symbol of the market the position is held in, default is None
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.instType]: MARGIN, SWAP, FUTURES, OPTION
        :returns dict: a `position structure <https://docs.ccxt.com/?id=position-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        type, query = self.handle_market_type_and_params('fetchPosition', market, params)
        request: dict = {
            # instType str No Instrument type, MARGIN, SWAP, FUTURES, OPTION
            'instId': market['id'],
            # posId str No Single position ID or multiple position IDs(no more than 20) separated with comma
        }
        if type is not None:
            request['instType'] = self.convert_to_instrument_type(type)
        response = self.privateGetAccountPositions(self.extend(request, query))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "adl": "1",
        #                 "availPos": "1",
        #                 "avgPx": "2566.31",
        #                 "cTime": "1619507758793",
        #                 "ccy": "ETH",
        #                 "deltaBS": "",
        #                 "deltaPA": "",
        #                 "gammaBS": "",
        #                 "gammaPA": "",
        #                 "imr": "",
        #                 "instId": "ETH-USD-210430",
        #                 "instType": "FUTURES",
        #                 "interest": "0",
        #                 "last": "2566.22",
        #                 "lever": "10",
        #                 "liab": "",
        #                 "liabCcy": "",
        #                 "liqPx": "2352.8496681818233",
        #                 "margin": "0.0003896645377994",
        #                 "mgnMode": "isolated",
        #                 "mgnRatio": "11.731726509588816",
        #                 "mmr": "0.0000311811092368",
        #                 "optVal": "",
        #                 "pTime": "1619507761462",
        #                 "pos": "1",
        #                 "posCcy": "",
        #                 "posId": "307173036051017730",
        #                 "posSide": "long",
        #                 "thetaBS": "",
        #                 "thetaPA": "",
        #                 "tradeId": "109844",
        #                 "uTime": "1619507761462",
        #                 "upl": "-0.0000009932766034",
        #                 "uplRatio": "-0.0025490556801078",
        #                 "vegaBS": "",
        #                 "vegaPA": ""
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        position = self.safe_dict(data, 0)
        if position is None:
            return None
        return self.parse_position(position, market)

    def fetch_positions(self, symbols: Strings = None, params={}) -> List[Position]:
        """

        https://www.okx.com/docs-v5/en/#rest-api-account-get-positions
        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-positions-history history

        fetch all open positions
        :param str[]|None symbols: list of unified market symbols
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.instType]: MARGIN, SWAP, FUTURES, OPTION
        :returns dict[]: a list of `position structure <https://docs.ccxt.com/?id=position-structure>`
        """
        self.load_markets()
        request: dict = {
            # 'instType': 'MARGIN',  # optional string, MARGIN, SWAP, FUTURES, OPTION
            # 'instId': market['id'],  # optional string, e.g. 'BTC-USD-190927-5000-C'
            # 'posId': '307173036051017730',  # optional string, Single or multiple position IDs(no more than 20) separated with commas
        }
        if symbols is not None:
            marketIds = []
            for i in range(0, len(symbols)):
                entry = symbols[i]
                market = self.market(entry)
                marketIds.append(market['id'])
            marketIdsLength = len(marketIds)
            if marketIdsLength > 0:
                request['instId'] = ','.join(marketIds)
        fetchPositionsOptions = self.safe_dict(self.options, 'fetchPositions', {})
        method = self.safe_string(fetchPositionsOptions, 'method', 'privateGetAccountPositions')
        response = None
        if method == 'privateGetAccountPositionsHistory':
            response = self.privateGetAccountPositionsHistory(self.extend(request, params))
        else:
            response = self.privateGetAccountPositions(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "adl": "1",
        #                 "availPos": "1",
        #                 "avgPx": "2566.31",
        #                 "cTime": "1619507758793",
        #                 "ccy": "ETH",
        #                 "deltaBS": "",
        #                 "deltaPA": "",
        #                 "gammaBS": "",
        #                 "gammaPA": "",
        #                 "imr": "",
        #                 "instId": "ETH-USD-210430",
        #                 "instType": "FUTURES",
        #                 "interest": "0",
        #                 "last": "2566.22",
        #                 "lever": "10",
        #                 "liab": "",
        #                 "liabCcy": "",
        #                 "liqPx": "2352.8496681818233",
        #                 "margin": "0.0003896645377994",
        #                 "mgnMode": "isolated",
        #                 "mgnRatio": "11.731726509588816",
        #                 "mmr": "0.0000311811092368",
        #                 "optVal": "",
        #                 "pTime": "1619507761462",
        #                 "pos": "1",
        #                 "posCcy": "",
        #                 "posId": "307173036051017730",
        #                 "posSide": "long",
        #                 "thetaBS": "",
        #                 "thetaPA": "",
        #                 "tradeId": "109844",
        #                 "uTime": "1619507761462",
        #                 "upl": "-0.0000009932766034",
        #                 "uplRatio": "-0.0025490556801078",
        #                 "vegaBS": "",
        #                 "vegaPA": ""
        #             }
        #         ]
        #     }
        #
        positions = self.safe_list(response, 'data', [])
        result = []
        for i in range(0, len(positions)):
            result.append(self.parse_position(positions[i]))
        return self.filter_by_array_positions(result, 'symbol', self.market_symbols(symbols), False)

    def fetch_positions_for_symbol(self, symbol: str, params={}):
        """

        https://www.okx.com/docs-v5/en/#rest-api-account-get-positions

        fetch all open positions for specific symbol
        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.instType]: MARGIN(if needed)
        :returns dict[]: a list of `position structure <https://docs.ccxt.com/?id=position-structure>`
        """
        return self.fetch_positions([symbol], params)

    def parse_position(self, position: dict, market: Market = None):
        #
        #     {
        #        "adl": "3",
        #        "availPos": "1",
        #        "avgPx": "34131.1",
        #        "cTime": "1627227626502",
        #        "ccy": "USDT",
        #        "deltaBS": "",
        #        "deltaPA": "",
        #        "gammaBS": "",
        #        "gammaPA": "",
        #        "imr": "170.66093041794787",
        #        "instId": "BTC-USDT-SWAP",
        #        "instType": "SWAP",
        #        "interest": "0",
        #        "last": "34134.4",
        #        "lever": "2",
        #        "liab": "",
        #        "liabCcy": "",
        #        "liqPx": "12608.959083877446",
        #        "markPx": "4786.459271773621",
        #        "margin": "",
        #        "mgnMode": "cross",
        #        "mgnRatio": "140.49930117599155",
        #        "mmr": "1.3652874433435829",
        #        "notionalUsd": "341.5130010779638",
        #        "optVal": "",
        #        "pos": "1",
        #        "posCcy": "",
        #        "posId": "339552508062380036",
        #        "posSide": "long",
        #        "thetaBS": "",
        #        "thetaPA": "",
        #        "tradeId": "98617799",
        #        "uTime": "1627227626502",
        #        "upl": "0.0108608358957281",
        #        "uplRatio": "0.0000636418743944",
        #        "vegaBS": "",
        #        "vegaPA": ""
        #    }
        # history
        #    {
        #        "cTime":"1708351230102",
        #        "ccy":"USDT",
        #        "closeAvgPx":"1.2567",
        #        "closeTotalPos":"40",
        #        "direction":"short",
        #        "fee":"-0.0351036",
        #        "fundingFee":"0",
        #        "instId":"SUSHI-USDT-SWAP",
        #        "instType":"SWAP",
        #        "lever":"10.0",
        #        "liqPenalty":"0",
        #        "mgnMode":"isolated",
        #        "openAvgPx":"1.2462",
        #        "openMaxPos":"40",
        #        "pnl":"-0.42",
        #        "pnlRatio":"-0.0912982667308618",
        #        "posId":"666159086676836352",
        #        "realizedPnl":"-0.4551036",
        #        "triggerPx":"",
        #        "type":"2",
        #        "uTime":"1708354805699",
        #        "uly":"SUSHI-USDT"
        #    }
        #
        marketId = self.safe_string(position, 'instId')
        market = self.safe_market(marketId, market, None, 'contract')
        symbol = market['symbol']
        pos = self.safe_string(position, 'pos')  # 'pos' field: One way mode: 0 if position is not open, 1 if open | Two way(hedge) mode: -1 if short, 1 if long, 0 if position is not open
        contractsAbs = Precise.string_abs(pos)
        side = self.safe_string_2(position, 'posSide', 'direction')
        hedged = side != 'net'
        contracts = self.parse_number(contractsAbs)
        if market['margin']:
            # margin position
            if side == 'net':
                posCcy = self.safe_string(position, 'posCcy')
                parsedCurrency = self.safe_currency_code(posCcy)
                if parsedCurrency is not None:
                    side = 'long' if (market['base'] == parsedCurrency) else 'short'
            if side is None:
                side = self.safe_string(position, 'direction')
        else:
            if pos is not None:
                if side == 'net':
                    if Precise.string_gt(pos, '0'):
                        side = 'long'
                    elif Precise.string_lt(pos, '0'):
                        side = 'short'
                    else:
                        side = None
        contractSize = self.safe_number(market, 'contractSize')
        contractSizeString = self.number_to_string(contractSize)
        markPriceString = self.safe_string(position, 'markPx')
        notionalString = self.safe_string(position, 'notionalUsd')
        if market['inverse']:
            notionalString = Precise.string_div(Precise.string_mul(contractsAbs, contractSizeString), markPriceString)
        notional = self.parse_number(notionalString)
        marginMode = self.safe_string(position, 'mgnMode')
        initialMarginString = None
        entryPriceString = self.safe_string_2(position, 'avgPx', 'openAvgPx')
        unrealizedPnlString = self.safe_string(position, 'upl')
        leverageString = self.safe_string(position, 'lever')
        initialMarginPercentage = None
        collateralString = None
        if marginMode == 'cross':
            initialMarginString = self.safe_string(position, 'imr')
            collateralString = Precise.string_add(initialMarginString, unrealizedPnlString)
        elif marginMode == 'isolated':
            initialMarginPercentage = Precise.string_div('1', leverageString)
            collateralString = self.safe_string(position, 'margin')
        maintenanceMarginString = self.safe_string(position, 'mmr')
        maintenanceMargin = self.parse_number(maintenanceMarginString)
        maintenanceMarginPercentageString = Precise.string_div(maintenanceMarginString, notionalString)
        if initialMarginPercentage is None:
            initialMarginPercentage = self.parse_number(Precise.string_div(initialMarginString, notionalString, 4))
        elif initialMarginString is None:
            if market['linear']:
                initialMarginString = Precise.string_mul(initialMarginPercentage, notionalString)
            else:
                initialMarginString = Precise.string_div(Precise.string_div(Precise.string_mul(contractsAbs, contractSizeString), entryPriceString), leverageString)
        rounder = '0.00005'  # round to closest 0.01%
        maintenanceMarginPercentage = self.parse_number(Precise.string_div(Precise.string_add(maintenanceMarginPercentageString, rounder), '1', 4))
        liquidationPrice = self.safe_number(position, 'liqPx')
        percentageString = self.safe_string(position, 'uplRatio')
        percentage = self.parse_number(Precise.string_mul(percentageString, '100'))
        timestamp = self.safe_integer(position, 'cTime')
        marginRatio = self.parse_number(Precise.string_div(maintenanceMarginString, collateralString, 4))
        return self.safe_position({
            'info': position,
            'id': self.safe_string(position, 'posId'),
            'symbol': symbol,
            'notional': notional,
            'marginMode': marginMode,
            'liquidationPrice': liquidationPrice,
            'entryPrice': self.parse_number(entryPriceString),
            'unrealizedPnl': self.parse_number(unrealizedPnlString),
            'realizedPnl': self.safe_number(position, 'realizedPnl'),
            'percentage': percentage,
            'contracts': contracts,
            'contractSize': contractSize,
            'markPrice': self.parse_number(markPriceString),
            'lastPrice': self.safe_number(position, 'closeAvgPx'),
            'side': side,
            'hedged': hedged,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'lastUpdateTimestamp': self.safe_integer(position, 'uTime'),
            'maintenanceMargin': maintenanceMargin,
            'maintenanceMarginPercentage': maintenanceMarginPercentage,
            'collateral': self.parse_number(collateralString),
            'initialMargin': self.parse_number(initialMarginString),
            'initialMarginPercentage': self.parse_number(initialMarginPercentage),
            'leverage': self.parse_number(leverageString),
            'marginRatio': marginRatio,
            'stopLossPrice': None,
            'takeProfitPrice': None,
        })

    def transfer(self, code: str, amount: float, fromAccount: str, toAccount: str, params={}) -> TransferEntry:
        """
        transfer currency internally between wallets on the same account

        https://www.okx.com/docs-v5/en/#rest-api-funding-funds-transfer

        :param str code: unified currency code
        :param float amount: amount to transfer
        :param str fromAccount: account to transfer from
        :param str toAccount: account to transfer to
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `transfer structure <https://docs.ccxt.com/?id=transfer-structure>`
        """
        self.load_markets()
        currency = self.currency(code)
        accountsByType = self.safe_dict(self.options, 'accountsByType', {})
        fromId = self.safe_string(accountsByType, fromAccount, fromAccount)
        toId = self.safe_string(accountsByType, toAccount, toAccount)
        request: dict = {
            'ccy': currency['id'],
            'amt': self.currency_to_precision(code, amount),
            'type': '0',  # 0 = transfer within account by default, 1 = master account to sub-account, 2 = sub-account to master account, 3 = sub-account to master account(Only applicable to APIKey from sub-account), 4 = sub-account to sub-account
            'from': fromId,  # remitting account, 6: Funding account, 18: Trading account
            'to': toId,  # beneficiary account, 6: Funding account, 18: Trading account
            # 'subAcct': 'sub-account-name',  # optional, only required when type is 1, 2 or 4
            # 'loanTrans': False,  # Whether or not borrowed coins can be transferred out under Multi-currency margin and Portfolio margin. The default is False
            # 'clientId': 'client-supplied id',  # A combination of case-sensitive alphanumerics, all numbers, or all letters of up to 32 characters
            # 'omitPosRisk': False,  # Ignore position risk. Default is False. Applicable to Portfolio margin
        }
        if fromId == 'master':
            request['type'] = '1'
            request['subAcct'] = toId
            request['from'] = self.safe_string(params, 'from', '6')
            request['to'] = self.safe_string(params, 'to', '6')
        elif toId == 'master':
            request['type'] = '2'
            request['subAcct'] = fromId
            request['from'] = self.safe_string(params, 'from', '6')
            request['to'] = self.safe_string(params, 'to', '6')
        response = self.privatePostAssetTransfer(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "transId": "754147",
        #                 "ccy": "USDT",
        #                 "from": "6",
        #                 "amt": "0.1",
        #                 "to": "18"
        #             }
        #         ]
        #     }
        #
        data = self.safe_list(response, 'data', [])
        rawTransfer = self.safe_dict(data, 0, {})
        return self.parse_transfer(rawTransfer, currency)

    def parse_transfer(self, transfer: dict, currency: Currency = None) -> TransferEntry:
        #
        # transfer
        #
        #     {
        #         "transId": "754147",
        #         "ccy": "USDT",
        #         "from": "6",
        #         "amt": "0.1",
        #         "to": "18"
        #     }
        #
        # fetchTransfer
        #
        #     {
        #         "amt": "5",
        #         "ccy": "USDT",
        #         "from": "18",
        #         "instId": "",
        #         "state": "success",
        #         "subAcct": "",
        #         "to": "6",
        #         "toInstId": "",
        #         "transId": "464424732",
        #         "type": "0"
        #     }
        #
        # fetchTransfers
        #
        #     {
        #         "bal": "70.6874353780312913",
        #         "balChg": "-4.0000000000000000",  # negative means "to funding", positive meand "from funding"
        #         "billId": "588900695232225299",
        #         "ccy": "USDT",
        #         "execType": "",
        #         "fee": "",
        #         "from": "18",
        #         "instId": "",
        #         "instType": "",
        #         "mgnMode": "",
        #         "notes": "To Funding Account",
        #         "ordId": "",
        #         "pnl": "",
        #         "posBal": "",
        #         "posBalChg": "",
        #         "price": "0",
        #         "subType": "12",
        #         "sz": "-4",
        #         "to": "6",
        #         "ts": "1686676866989",
        #         "type": "1"
        #     }
        #
        id = self.safe_string_2(transfer, 'transId', 'billId')
        currencyId = self.safe_string(transfer, 'ccy')
        code = self.safe_currency_code(currencyId, currency)
        amount = self.safe_number(transfer, 'amt')
        fromAccountId = self.safe_string(transfer, 'from')
        toAccountId = self.safe_string(transfer, 'to')
        accountsById = self.safe_dict(self.options, 'accountsById', {})
        timestamp = self.safe_integer(transfer, 'ts')
        balanceChange = self.safe_string(transfer, 'sz')
        if balanceChange is not None:
            amount = self.parse_number(Precise.string_abs(balanceChange))
        return {
            'info': transfer,
            'id': id,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'currency': code,
            'amount': amount,
            'fromAccount': self.safe_string(accountsById, fromAccountId),
            'toAccount': self.safe_string(accountsById, toAccountId),
            'status': self.parse_transfer_status(self.safe_string(transfer, 'state')),
        }

    def parse_transfer_status(self, status: Str) -> Str:
        statuses: dict = {
            'success': 'ok',
        }
        return self.safe_string(statuses, status, status)

    def fetch_transfer(self, id: str, code: Str = None, params={}) -> TransferEntry:
        self.load_markets()
        request: dict = {
            'transId': id,
            # 'type': 0,  # default is 0 transfer within account, 1 master to sub, 2 sub to master
        }
        response = self.privateGetAssetTransferState(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "amt": "5",
        #                 "ccy": "USDT",
        #                 "from": "18",
        #                 "instId": "",
        #                 "state": "success",
        #                 "subAcct": "",
        #                 "to": "6",
        #                 "toInstId": "",
        #                 "transId": "464424732",
        #                 "type": "0"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        transfer = self.safe_dict(data, 0)
        return self.parse_transfer(transfer)

    def fetch_transfers(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[TransferEntry]:
        """
        fetch a history of internal transfers made on an account

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-bills-details-last-3-months

        :param str code: unified currency code of the currency transferred
        :param int [since]: the earliest time in ms to fetch transfers for
        :param int [limit]: the maximum number of transfers structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict[]: a list of `transfer structures <https://docs.ccxt.com/?id=transfer-structure>`
        """
        self.load_markets()
        currency = None
        request: dict = {
            'type': '1',  # https://www.okx.com/docs-v5/en/#rest-api-account-get-bills-details-last-3-months
        }
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        if since is not None:
            request['begin'] = since
        if limit is not None:
            request['limit'] = limit
        response = self.privateGetAccountBillsArchive(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "bal": "70.6874353780312913",
        #                "balChg": "-4.0000000000000000",
        #                "billId": "588900695232225299",
        #                "ccy": "USDT",
        #                "execType": "",
        #                "fee": "",
        #                "from": "18",
        #                "instId": "",
        #                "instType": "",
        #                "mgnMode": "",
        #                "notes": "To Funding Account",
        #                "ordId": "",
        #                "pnl": "",
        #                "posBal": "",
        #                "posBalChg": "",
        #                "price": "0",
        #                "subType": "12",
        #                "sz": "-4",
        #                "to": "6",
        #                "ts": "1686676866989",
        #                "type": "1"
        #            },
        #            ...
        #        ],
        #        "msg": ""
        #    }
        #
        transfers = self.safe_list(response, 'data', [])
        return self.parse_transfers(transfers, currency, since, limit, params)

    def sign(self, path, api='public', method='GET', params={}, headers=None, body=None):
        isArray = isinstance(params, list)
        request = '/api/' + self.version + '/' + self.implode_params(path, params)
        query = self.omit(params, self.extract_params(path))
        url = self.implode_hostname(self.urls['api']['rest']) + request
        # type = self.getPathAuthenticationType(path)
        if api == 'public':
            if query:
                url += '?' + self.urlencode(query)
        elif api == 'private':
            self.check_required_credentials()
            # inject id in implicit api call
            if method == 'POST' and (path == 'trade/batch-orders' or path == 'trade/order-algo' or path == 'trade/order'):
                brokerId = self.safe_string(self.options, 'brokerId', '6b9ad766b55dBCDE')
                if isinstance(params, list):
                    for i in range(0, len(params)):
                        entry = params[i]
                        clientOrderId = self.safe_string(entry, 'clOrdId')
                        if clientOrderId is None:
                            entry['clOrdId'] = brokerId + self.uuid16()
                            entry['tag'] = brokerId
                            params[i] = entry
                else:
                    clientOrderId = self.safe_string(params, 'clOrdId')
                    if clientOrderId is None:
                        params['clOrdId'] = brokerId + self.uuid16()
                        params['tag'] = brokerId
            timestamp = self.iso8601(self.nonce())
            headers = {
                'OK-ACCESS-KEY': self.apiKey,
                'OK-ACCESS-PASSPHRASE': self.password,
                'OK-ACCESS-TIMESTAMP': timestamp,
                # 'OK-FROM': '',
                # 'OK-TO': '',
                # 'OK-LIMIT': '',
            }
            auth = timestamp + method + request
            if method == 'GET':
                if query:
                    urlencodedQuery = '?' + self.urlencode(query)
                    url += urlencodedQuery
                    auth += urlencodedQuery
            else:
                if isArray or query:
                    body = self.json(query)
                    auth += body
                headers['Content-Type'] = 'application/json'
            signature = self.hmac(self.encode(auth), self.encode(self.secret), hashlib.sha256, 'base64')
            headers['OK-ACCESS-SIGN'] = signature
        return {'url': url, 'method': method, 'body': body, 'headers': headers}

    def parse_funding_rate(self, contract, market: Market = None) -> FundingRate:
        #
        #    {
        #        "fundingRate": "0.00027815",
        #        "fundingTime": "1634256000000",
        #        "instId": "BTC-USD-SWAP",
        #        "instType": "SWAP",
        #        "nextFundingRate": "0.00017",
        #        "nextFundingTime": "1634284800000"
        #    }
        # ws
        #     {
        #        "fundingRate":"0.0001875391284828",
        #        "fundingTime":"1700726400000",
        #        "instId":"BTC-USD-SWAP",
        #        "instType":"SWAP",
        #        "method": "next_period",
        #        "maxFundingRate":"0.00375",
        #        "minFundingRate":"-0.00375",
        #        "nextFundingRate":"0.0002608059239328",
        #        "nextFundingTime":"1700755200000",
        #        "premium": "0.0001233824646391",
        #        "settFundingRate":"0.0001699799259033",
        #        "settState":"settled",
        #        "ts":"1700724675402"
        #     }
        #
        # in the response above nextFundingRate is actually two funding rates from now
        #
        nextFundingRateTimestamp = self.safe_integer(contract, 'nextFundingTime')
        marketId = self.safe_string(contract, 'instId')
        symbol = self.safe_symbol(marketId, market)
        nextFundingRate = self.safe_number(contract, 'nextFundingRate')
        fundingTime = self.safe_integer(contract, 'fundingTime')
        fundingTimeString = self.safe_string(contract, 'fundingTime')
        nextFundingTimeString = self.safe_string(contract, 'nextFundingTime')
        millisecondsInterval = Precise.string_sub(nextFundingTimeString, fundingTimeString)
        # https://www.okx.com/support/hc/en-us/articles/360053909272-Ⅸ-Introduction-to-perpetual-swap-funding-fee
        # > The current interest is 0.
        return {
            'info': contract,
            'symbol': symbol,
            'markPrice': None,
            'indexPrice': None,
            'interestRate': self.parse_number('0'),
            'estimatedSettlePrice': None,
            'timestamp': None,
            'datetime': None,
            'fundingRate': self.safe_number(contract, 'fundingRate'),
            'fundingTimestamp': fundingTime,
            'fundingDatetime': self.iso8601(fundingTime),
            'nextFundingRate': nextFundingRate,
            'nextFundingTimestamp': nextFundingRateTimestamp,
            'nextFundingDatetime': self.iso8601(nextFundingRateTimestamp),
            'previousFundingRate': None,
            'previousFundingTimestamp': None,
            'previousFundingDatetime': None,
            'interval': self.parse_funding_interval(millisecondsInterval),
        }

    def parse_funding_interval(self, interval):
        intervals: dict = {
            '3600000': '1h',
            '14400000': '4h',
            '28800000': '8h',
            '57600000': '16h',
            '86400000': '24h',
        }
        return self.safe_string(intervals, interval, interval)

    def fetch_funding_interval(self, symbol: str, params={}) -> FundingRate:
        """
        fetch the current funding rate interval

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-funding-rate

        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `funding rate structure <https://docs.ccxt.com/?id=funding-rate-structure>`
        """
        return self.fetch_funding_rate(symbol, params)

    def fetch_funding_rate(self, symbol: str, params={}) -> FundingRate:
        """
        fetch the current funding rate

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-funding-rate

        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `funding rate structure <https://docs.ccxt.com/?id=funding-rate-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        if not market['swap']:
            raise ExchangeError(self.id + ' fetchFundingRate() is only valid for swap markets')
        request: dict = {
            'instId': market['id'],
        }
        response = self.publicGetPublicFundingRate(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "fundingRate": "0.00027815",
        #                "fundingTime": "1634256000000",
        #                "instId": "BTC-USD-SWAP",
        #                "instType": "SWAP",
        #                "nextFundingRate": "0.00017",
        #                "nextFundingTime": "1634284800000"
        #            }
        #        ],
        #        "msg": ""
        #    }
        #
        data = self.safe_list(response, 'data', [])
        entry = self.safe_dict(data, 0, {})
        return self.parse_funding_rate(entry, market)

    def fetch_funding_rates(self, symbols: Strings = None, params={}) -> FundingRates:
        """
        fetches the current funding rates for multiple symbols

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-funding-rate

        :param str[] symbols: unified market symbols
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `funding rates structure <https://docs.ccxt.com/?id=funding-rates-structure>`
        """
        self.load_markets()
        symbols = self.market_symbols(symbols, 'swap', True)
        request: dict = {'instId': 'ANY'}
        response = self.publicGetPublicFundingRate(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "fundingRate": "0.00027815",
        #                "fundingTime": "1634256000000",
        #                "instId": "BTC-USD-SWAP",
        #                "instType": "SWAP",
        #                "nextFundingRate": "0.00017",
        #                "nextFundingTime": "1634284800000"
        #            }
        #        ],
        #        "msg": ""
        #    }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_funding_rates(data, symbols)

    def fetch_funding_history(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
        """
        fetch the history of funding payments paid and received on self account

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-bills-details-last-3-months

        :param str symbol: unified market symbol
        :param int [since]: the earliest time in ms to fetch funding history for
        :param int [limit]: the maximum number of funding history structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `funding history structure <https://docs.ccxt.com/?id=funding-history-structure>`
        """
        self.load_markets()
        request: dict = {
            # 'instType': 'SPOT',  # SPOT, MARGIN, SWAP, FUTURES, OPTION
            # 'ccy': currency['id'],
            # 'mgnMode': 'isolated',  # isolated, cross
            # 'ctType': 'linear',  # linear, inverse, only applicable to FUTURES/SWAP
            'type': '8',
            #
            # supported values for type
            #
            #     1 Transfer
            #     2 Trade
            #     3 Delivery
            #     4 Auto token conversion
            #     5 Liquidation
            #     6 Margin transfer
            #     7 Interest deduction
            #     8 Funding fee
            #     9 ADL
            #     10 Clawback
            #     11 System token conversion
            #     12 Strategy transfer
            #     13 ddh
            #
            # 'subType': '',
            #
            # supported values for subType
            #
            #     1 Buy
            #     2 Sell
            #     3 Open long
            #     4 Open short
            #     5 Close long
            #     6 Close short
            #     9 Interest deduction
            #     11 Transfer in
            #     12 Transfer out
            #     160 Manual margin increase
            #     161 Manual margin decrease
            #     162 Auto margin increase
            #     110 Auto buy
            #     111 Auto sell
            #     118 System token conversion transfer in
            #     119 System token conversion transfer out
            #     100 Partial liquidation close long
            #     101 Partial liquidation close short
            #     102 Partial liquidation buy
            #     103 Partial liquidation sell
            #     104 Liquidation long
            #     105 Liquidation short
            #     106 Liquidation buy
            #     107 Liquidation sell
            #     110 Liquidation transfer in
            #     111 Liquidation transfer out
            #     125 ADL close long
            #     126 ADL close short
            #     127 ADL buy
            #     128 ADL sell
            #     131 ddh buy
            #     132 ddh sell
            #     170 Exercised
            #     171 Counterparty exercised
            #     172 Expired OTM
            #     112 Delivery long
            #     113 Delivery short
            #     117 Delivery/Exercise clawback
            #     173 Funding fee expense
            #     174 Funding fee income
            #     200 System transfer in
            #     201 Manually transfer in
            #     202 System transfer out
            #     203 Manually transfer out
            #
            # "after": "id",  # earlier than the requested bill ID
            # "before": "id",  # newer than the requested bill ID
            # "limit": "100",  # default 100, max 100
        }
        if limit is not None:
            request['limit'] = str(limit)  # default 100, max 100
        market = None
        if symbol is not None:
            market = self.market(symbol)
            symbol = market['symbol']
            if market['contract']:
                if market['linear']:
                    request['ctType'] = 'linear'
                    request['ccy'] = market['quoteId']
                else:
                    request['ctType'] = 'inverse'
                    request['ccy'] = market['baseId']
        type, query = self.handle_market_type_and_params('fetchFundingHistory', market, params)
        if type == 'swap':
            request['instType'] = self.convert_to_instrument_type(type)
        # AccountBillsArchive has the same cost but supports three months of data
        response = self.privateGetAccountBillsArchive(self.extend(request, query))
        #
        #    {
        #        "bal": "0.0242946200998573",
        #        "balChg": "0.0000148752712240",
        #        "billId": "377970609204146187",
        #        "ccy": "ETH",
        #        "execType": "",
        #        "fee": "0",
        #        "from": "",
        #        "instId": "ETH-USD-SWAP",
        #        "instType": "SWAP",
        #        "mgnMode": "isolated",
        #        "notes": "",
        #        "ordId": "",
        #        "pnl": "0.000014875271224",
        #        "posBal": "0",
        #        "posBalChg": "0",
        #        "subType": "174",
        #        "sz": "9",
        #        "to": "",
        #        "ts": "1636387215588",
        #        "type": "8"
        #    }
        #
        data = self.safe_list(response, 'data', [])
        result = []
        for i in range(0, len(data)):
            entry = data[i]
            timestamp = self.safe_integer(entry, 'ts')
            instId = self.safe_string(entry, 'instId')
            marketInner = self.safe_market(instId)
            currencyId = self.safe_string(entry, 'ccy')
            code = self.safe_currency_code(currencyId)
            balanceChange = self.safe_string(entry, 'balChg')
            positionBalanceChange = self.safe_string(entry, 'posBalChg')
            amount = None
            if (balanceChange is not None) and (not Precise.string_eq(balanceChange, '0')):
                amount = balanceChange
            else:
                amount = positionBalanceChange
            result.append({
                'info': entry,
                'symbol': marketInner['symbol'],
                'code': code,
                'timestamp': timestamp,
                'datetime': self.iso8601(timestamp),
                'id': self.safe_string(entry, 'billId'),
                'amount': self.parse_number(amount),
            })
        sorted = self.sort_by(result, 'timestamp')
        return self.filter_by_symbol_since_limit(sorted, symbol, since, limit)

    def set_leverage(self, leverage: int, symbol: Str = None, params={}):
        """
        set the level of leverage for a market

        https://www.okx.com/docs-v5/en/#rest-api-account-set-leverage

        :param float leverage: the rate of leverage
        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.marginMode]: 'cross' or 'isolated'
        :param str [params.posSide]: 'long' or 'short' or 'net' for isolated margin long/short mode on futures and swap markets, default is 'net'
        :returns dict: response from the exchange
        """
        if symbol is None:
            raise ArgumentsRequired(self.id + ' setLeverage() requires a symbol argument')
        # WARNING: THIS WILL INCREASE LIQUIDATION PRICE FOR OPEN ISOLATED LONG POSITIONS
        # AND DECREASE LIQUIDATION PRICE FOR OPEN ISOLATED SHORT POSITIONS
        if (leverage < 1) or (leverage > 125):
            raise BadRequest(self.id + ' setLeverage() leverage should be between 1 and 125')
        self.load_markets()
        market = self.market(symbol)
        marginMode = None
        marginMode, params = self.handle_margin_mode_and_params('setLeverage', params)
        if marginMode is None:
            marginMode = self.safe_string(params, 'mgnMode', 'cross')  # cross marginMode
        if (marginMode != 'cross') and (marginMode != 'isolated'):
            raise BadRequest(self.id + ' setLeverage() requires a marginMode parameter that must be either cross or isolated')
        request: dict = {
            'lever': leverage,
            'mgnMode': marginMode,
            'instId': market['id'],
        }
        posSide = self.safe_string(params, 'posSide', 'net')
        if marginMode == 'isolated':
            if posSide != 'long' and posSide != 'short' and posSide != 'net':
                raise BadRequest(self.id + ' setLeverage() requires the posSide argument to be either "long", "short" or "net"')
            request['posSide'] = posSide
        response = self.privatePostAccountSetLeverage(self.extend(request, params))
        #
        #     {
        #       "code": "0",
        #       "data": [
        #         {
        #           "instId": "BTC-USDT-SWAP",
        #           "lever": "5",
        #           "mgnMode": "isolated",
        #           "posSide": "long"
        #         }
        #       ],
        #       "msg": ""
        #     }
        #
        return response

    def fetch_position_mode(self, symbol: Str = None, params={}):
        """

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-account-configuration

        fetchs the position mode, hedged or one way, hedged for binance is set identically for all linear markets or all inverse markets
        :param str symbol: unified symbol of the market to fetch the order book for
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.accountId]: if you have multiple accounts, you must specify the account id to fetch the position mode
        :returns dict: an object detailing whether the market is in hedged or one-way mode
        """
        accounts = self.fetch_accounts()
        length = len(accounts)
        selectedAccount = None
        if length > 1:
            accountId = self.safe_string(params, 'accountId')
            if accountId is None:
                accountIds = self.get_list_from_object_values(accounts, 'id')
                raise ExchangeError(self.id + ' fetchPositionMode() can not detect position mode, because you have multiple accounts. Set params["accountId"] to desired id from: ' + ', '.join(accountIds))
            else:
                accountsById = self.index_by(accounts, 'id')
                selectedAccount = self.safe_dict(accountsById, accountId)
        else:
            selectedAccount = accounts[0]
        mainAccount = selectedAccount['info']
        posMode = self.safe_string(mainAccount, 'posMode')  # long_short_mode, net_mode
        isHedged = posMode == 'long_short_mode'
        return {
            'info': mainAccount,
            'hedged': isHedged,
        }

    def set_position_mode(self, hedged: bool, symbol: Str = None, params={}):
        """
        set hedged to True or False for a market

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-set-position-mode

        :param bool hedged: set to True to use long_short_mode, False for net_mode
        :param str symbol: not used by okx setPositionMode
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: response from the exchange
        """
        hedgeMode = None
        if hedged:
            hedgeMode = 'long_short_mode'
        else:
            hedgeMode = 'net_mode'
        request: dict = {
            'posMode': hedgeMode,
        }
        response = self.privatePostAccountSetPositionMode(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "posMode": "net_mode"
        #            }
        #        ],
        #        "msg": ""
        #    }
        #
        return response

    def set_margin_mode(self, marginMode: str, symbol: Str = None, params={}):
        """
        set margin mode to 'cross' or 'isolated'

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-set-leverage

        :param str marginMode: 'cross' or 'isolated'
        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param int [params.leverage]: leverage
        :returns dict: response from the exchange
        """
        if symbol is None:
            raise ArgumentsRequired(self.id + ' setMarginMode() requires a symbol argument')
        # WARNING: THIS WILL INCREASE LIQUIDATION PRICE FOR OPEN ISOLATED LONG POSITIONS
        # AND DECREASE LIQUIDATION PRICE FOR OPEN ISOLATED SHORT POSITIONS
        marginMode = marginMode.lower()
        if (marginMode != 'cross') and (marginMode != 'isolated'):
            raise BadRequest(self.id + ' setMarginMode() marginMode must be either cross or isolated')
        self.load_markets()
        market = self.market(symbol)
        lever = self.safe_integer_2(params, 'lever', 'leverage')
        if (lever is None) or (lever < 1) or (lever > 125):
            raise BadRequest(self.id + ' setMarginMode() params["lever"] should be between 1 and 125')
        params = self.omit(params, ['leverage'])
        request: dict = {
            'lever': lever,
            'mgnMode': marginMode,
            'instId': market['id'],
        }
        response = self.privatePostAccountSetLeverage(self.extend(request, params))
        #
        #     {
        #       "code": "0",
        #       "data": [
        #         {
        #           "instId": "BTC-USDT-SWAP",
        #           "lever": "5",
        #           "mgnMode": "isolated",
        #           "posSide": "long"
        #         }
        #       ],
        #       "msg": ""
        #     }
        #
        return response

    def fetch_cross_borrow_rates(self, params={}) -> CrossBorrowRates:
        """
        fetch the borrow interest rates of all currencies

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-interest-rate

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a list of `borrow rate structures <https://docs.ccxt.com/?id=borrow-rate-structure>`
        """
        self.load_markets()
        response = self.privateGetAccountInterestRate(params)
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "ccy": "BTC",
        #                "interestRate": "0.00000833"
        #            }
        #            ...
        #        ],
        #    }
        #
        data = self.safe_list(response, 'data', [])
        rates = []
        for i in range(0, len(data)):
            rates.append(self.parse_borrow_rate(data[i]))
        return rates

    def fetch_cross_borrow_rate(self, code: str, params={}) -> CrossBorrowRate:
        """
        fetch the rate of interest to borrow a currency for margin trading

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-interest-rate

        :param str code: unified currency code
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `borrow rate structure <https://docs.ccxt.com/?id=borrow-rate-structure>`
        """
        self.load_markets()
        currency = self.currency(code)
        request: dict = {
            'ccy': currency['id'],
        }
        response = self.privateGetAccountInterestRate(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #             {
        #                "ccy": "USDT",
        #                "interestRate": "0.00002065"
        #             }
        #             ...
        #        ],
        #        "msg": ""
        #    }
        #
        data = self.safe_list(response, 'data', [])
        rate = self.safe_dict(data, 0, {})
        return self.parse_borrow_rate(rate)

    def parse_borrow_rate(self, info, currency: Currency = None):
        #
        #    {
        #        "amt": "992.10341195",
        #        "ccy": "BTC",
        #        "rate": "0.01",
        #        "ts": "1643954400000"
        #    }
        #
        ccy = self.safe_string(info, 'ccy')
        timestamp = self.safe_integer(info, 'ts')
        return {
            'currency': self.safe_currency_code(ccy),
            'rate': self.safe_number_2(info, 'interestRate', 'rate'),
            'period': 86400000,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'info': info,
        }

    def parse_borrow_rate_histories(self, response, codes, since, limit):
        #
        #    [
        #        {
        #            "amt": "992.10341195",
        #            "ccy": "BTC",
        #            "rate": "0.01",
        #            "ts": "1643954400000"
        #        },
        #        ...
        #    ]
        #
        borrowRateHistories: dict = {}
        for i in range(0, len(response)):
            item = response[i]
            code = self.safe_currency_code(self.safe_string(item, 'ccy'))
            if codes is None or self.in_array(code, codes):
                if not (code in borrowRateHistories):
                    borrowRateHistories[code] = []
                borrowRateStructure = self.parse_borrow_rate(item)
                borrrowRateCode = borrowRateHistories[code]
                borrrowRateCode.append(borrowRateStructure)
        keys = list(borrowRateHistories.keys())
        for i in range(0, len(keys)):
            code = keys[i]
            borrowRateHistories[code] = self.filter_by_currency_since_limit(borrowRateHistories[code], code, since, limit)
        return borrowRateHistories

    def fetch_borrow_rate_histories(self, codes=None, since: Int = None, limit: Int = None, params={}):
        """
        retrieves a history of a multiple currencies borrow interest rate at specific time slots, returns all currencies if no symbols passed, default is None

        https://www.okx.com/docs-v5/en/#financial-product-savings-get-public-borrow-history-public

        :param str[]|None codes: list of unified currency codes, default is None
        :param int [since]: timestamp in ms of the earliest borrowRate, default is None
        :param int [limit]: max number of borrow rate prices to return, default is None
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a dictionary of `borrow rate structures <https://docs.ccxt.com/?id=borrow-rate-structure>` indexed by the market symbol
        """
        self.load_markets()
        request: dict = {
            # 'ccy': currency['id'],
            # 'after': self.milliseconds(),  # Pagination of data to return records earlier than the requested ts,
            # 'before': since,  # Pagination of data to return records newer than the requested ts,
            # 'limit': limit,  # default is 100 and maximum is 100
        }
        if since is not None:
            request['before'] = since
        if limit is not None:
            request['limit'] = limit
        response = self.publicGetFinanceSavingsLendingRateHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "amt": "992.10341195",
        #                 "ccy": "BTC",
        #                 "rate": "0.01",
        #                 "ts": "1643954400000"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_borrow_rate_histories(data, codes, since, limit)

    def fetch_borrow_rate_history(self, code: str, since: Int = None, limit: Int = None, params={}):
        """
        retrieves a history of a currencies borrow interest rate at specific time slots

        https://www.okx.com/docs-v5/en/#financial-product-savings-get-public-borrow-history-public

        :param str code: unified currency code
        :param int [since]: timestamp for the earliest borrow rate
        :param int [limit]: the maximum number of `borrow rate structures <https://docs.ccxt.com/?id=borrow-rate-structure>` to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict[]: an array of `borrow rate structures <https://docs.ccxt.com/?id=borrow-rate-structure>`
        """
        self.load_markets()
        currency = self.currency(code)
        request: dict = {
            'ccy': currency['id'],
            # 'after': self.milliseconds(),  # Pagination of data to return records earlier than the requested ts,
            # 'before': since,  # Pagination of data to return records newer than the requested ts,
            # 'limit': limit,  # default is 100 and maximum is 100
        }
        if since is not None:
            request['before'] = since
        if limit is not None:
            request['limit'] = limit
        response = self.publicGetFinanceSavingsLendingRateHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "amt": "992.10341195",
        #                 "ccy": "BTC",
        #                 "rate": "0.01",
        #                 "ts": "1643954400000"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_borrow_rate_history(data, code, since, limit)

    def modify_margin_helper(self, symbol: str, amount, type, params={}) -> MarginModification:
        self.load_markets()
        market = self.market(symbol)
        posSide = self.safe_string(params, 'posSide', 'net')
        params = self.omit(params, ['posSide'])
        request: dict = {
            'instId': market['id'],
            'amt': amount,
            'type': type,
            'posSide': posSide,
        }
        response = self.privatePostAccountPositionMarginBalance(self.extend(request, params))
        #
        #     {
        #       "code": "0",
        #       "data": [
        #         {
        #           "amt": "0.01",
        #           "instId": "ETH-USD-SWAP",
        #           "posSide": "net",
        #           "type": "reduce"
        #         }
        #       ],
        #       "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        entry = self.safe_dict(data, 0, {})
        errorCode = self.safe_string(response, 'code')
        return self.extend(self.parse_margin_modification(entry, market), {
            'status': 'ok' if (errorCode == '0') else 'failed',
        })

    def parse_margin_modification(self, data: dict, market: Market = None) -> MarginModification:
        #
        # addMargin/reduceMargin
        #
        #    {
        #        "amt": "0.01",
        #        "instId": "ETH-USD-SWAP",
        #        "posSide": "net",
        #        "type": "reduce"
        #    }
        #
        # fetchMarginAdjustmentHistory
        #
        #    {
        #        bal: '67621.4325135010619812',
        #        balChg: '-10.0000000000000000',
        #        billId: '691293628710342659',
        #        ccy: 'USDT',
        #        clOrdId: '',
        #        execType: '',
        #        fee: '0',
        #        fillFwdPx: '',
        #        fillIdxPx: '',
        #        fillMarkPx: '',
        #        fillMarkVol: '',
        #        fillPxUsd: '',
        #        fillPxVol: '',
        #        fillTime: '1711089244850',
        #        from: '',
        #        instId: 'XRP-USDT-SWAP',
        #        instType: 'SWAP',
        #        interest: '0',
        #        mgnMode: 'isolated',
        #        notes: '',
        #        ordId: '',
        #        pnl: '0',
        #        posBal: '73.12',
        #        posBalChg: '10.00',
        #        px: '',
        #        subType: '160',
        #        sz: '10',
        #        tag: '',
        #        to: '',
        #        tradeId: '0',
        #        ts: '1711089244699',
        #        type: '6'
        #    }
        #
        amountRaw = self.safe_string_2(data, 'amt', 'posBalChg')
        typeRaw = self.safe_string(data, 'type')
        type = None
        if typeRaw == '6':
            type = 'add' if Precise.string_gt(amountRaw, '0') else 'reduce'
        else:
            type = typeRaw
        amount = Precise.string_abs(amountRaw)
        marketId = self.safe_string(data, 'instId')
        responseMarket = self.safe_market(marketId, market)
        code = responseMarket['base'] if responseMarket['inverse'] else responseMarket['quote']
        timestamp = self.safe_integer(data, 'ts')
        return {
            'info': data,
            'symbol': responseMarket['symbol'],
            'type': type,
            'marginMode': 'isolated',
            'amount': self.parse_number(amount),
            'code': code,
            'total': None,
            'status': None,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
        }

    def reduce_margin(self, symbol: str, amount: float, params={}) -> MarginModification:
        """
        remove margin from a position

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-increase-decrease-margin

        :param str symbol: unified market symbol
        :param float amount: the amount of margin to remove
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `margin structure <https://docs.ccxt.com/?id=margin-structure>`
        """
        return self.modify_margin_helper(symbol, amount, 'reduce', params)

    def add_margin(self, symbol: str, amount: float, params={}) -> MarginModification:
        """
        add margin

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-increase-decrease-margin

        :param str symbol: unified market symbol
        :param float amount: amount of margin to add
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `margin structure <https://docs.ccxt.com/?id=margin-structure>`
        """
        return self.modify_margin_helper(symbol, amount, 'add', params)

    def fetch_market_leverage_tiers(self, symbol: str, params={}) -> List[LeverageTier]:
        """
        retrieve information on the maximum leverage, and maintenance margin for trades of varying trade sizes for a single market

        https://www.okx.com/docs-v5/en/#rest-api-public-data-get-position-tiers

        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.marginMode]: 'cross' or 'isolated'
        :returns dict: a `leverage tiers structure <https://docs.ccxt.com/?id=leverage-tiers-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        type = 'MARGIN' if market['spot'] else self.convert_to_instrument_type(market['type'])
        uly = self.safe_string(market['info'], 'uly')
        if not uly:
            if type != 'MARGIN':
                raise BadRequest(self.id + ' fetchMarketLeverageTiers() cannot fetch leverage tiers for ' + symbol)
        marginMode = None
        marginMode, params = self.handle_margin_mode_and_params('fetchMarketLeverageTiers', params)
        if marginMode is None:
            marginMode = self.safe_string(params, 'tdMode', 'cross')  # cross marginMode
        request: dict = {
            'instType': type,
            'tdMode': marginMode,
            'uly': uly,
        }
        if type == 'MARGIN':
            request['instId'] = market['id']
        response = self.publicGetPublicPositionTiers(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "baseMaxLoan": "500",
        #                "imr": "0.1",
        #                "instId": "ETH-USDT",
        #                "maxLever": "10",
        #                "maxSz": "500",
        #                "minSz": "0",
        #                "mmr": "0.03",
        #                "optMgnFactor": "0",
        #                "quoteMaxLoan": "200000",
        #                "tier": "1",
        #                "uly": ""
        #            },
        #            ...
        #        ]
        #    }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_market_leverage_tiers(data, market)

    def parse_market_leverage_tiers(self, info, market: Market = None) -> List[LeverageTier]:
        """
 @ignore
        :param dict info: Exchange response for 1 market
        :param dict market: CCXT market
        """
        #
        #    [
        #        {
        #            "baseMaxLoan": "500",
        #            "imr": "0.1",
        #            "instId": "ETH-USDT",
        #            "maxLever": "10",
        #            "maxSz": "500",
        #            "minSz": "0",
        #            "mmr": "0.03",
        #            "optMgnFactor": "0",
        #            "quoteMaxLoan": "200000",
        #            "tier": "1",
        #            "uly": ""
        #        },
        #        ...
        #    ]
        #
        tiers = []
        for i in range(0, len(info)):
            tier = info[i]
            marketId = self.safe_string(tier, 'instId')
            tiers.append({
                'tier': self.safe_integer(tier, 'tier'),
                'symbol': self.safe_symbol(marketId, market),
                'currency': market['quote'],
                'minNotional': self.safe_number(tier, 'minSz'),
                'maxNotional': self.safe_number(tier, 'maxSz'),
                'maintenanceMarginRate': self.safe_number(tier, 'mmr'),
                'maxLeverage': self.safe_number(tier, 'maxLever'),
                'info': tier,
            })
        return tiers

    def fetch_borrow_interest(self, code: Str = None, symbol: Str = None, since: Int = None, limit: Int = None, params={}) -> List[BorrowInterest]:
        """
        fetch the interest owed b the user for borrowing currency for margin trading

        https://www.okx.com/docs-v5/en/#rest-api-account-get-interest-accrued-data

        :param str code: the unified currency code for the currency of the interest
        :param str symbol: the market symbol of an isolated margin market, if None, the interest for cross margin markets is returned
        :param int [since]: timestamp in ms of the earliest time to receive interest records for
        :param int [limit]: the number of `borrow interest structures <https://docs.ccxt.com/?id=borrow-interest-structure>` to retrieve
        :param dict [params]: exchange specific parameters
        :param int [params.type]: Loan type 1 - VIP loans 2 - Market loans *Default is Market loans*
        :param str [params.marginMode]: 'cross' or 'isolated'
        :returns dict[]: An list of `borrow interest structures <https://docs.ccxt.com/?id=borrow-interest-structure>`
        """
        self.load_markets()
        marginMode = None
        marginMode, params = self.handle_margin_mode_and_params('fetchBorrowInterest', params)
        if marginMode is None:
            marginMode = self.safe_string(params, 'mgnMode', 'cross')  # cross marginMode
        request: dict = {
            'mgnMode': marginMode,
        }
        market = None
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        if since is not None:
            request['before'] = since - 1
        if limit is not None:
            request['limit'] = limit
        if symbol is not None:
            market = self.market(symbol)
            request['instId'] = market['id']
        response = self.privateGetAccountInterestAccrued(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "ccy": "USDT",
        #                "instId": "",
        #                "interest": "0.0003960833333334",
        #                "interestRate": "0.0000040833333333",
        #                "liab": "97",
        #                "mgnMode": "",
        #                "ts": "1637312400000",
        #                "type": "1"
        #            },
        #            ...
        #        ],
        #        "msg": ""
        #    }
        #
        data = self.safe_list(response, 'data', [])
        interest = self.parse_borrow_interests(data)
        return self.filter_by_currency_since_limit(interest, code, since, limit)

    def parse_borrow_interest(self, info: dict, market: Market = None) -> BorrowInterest:
        instId = self.safe_string(info, 'instId')
        if instId is not None:
            market = self.safe_market(instId, market)
        timestamp = self.safe_integer(info, 'ts')
        return {
            'info': info,
            'symbol': self.safe_string(market, 'symbol'),
            'currency': self.safe_currency_code(self.safe_string(info, 'ccy')),
            'interest': self.safe_number(info, 'interest'),
            'interestRate': self.safe_number(info, 'interestRate'),
            'amountBorrowed': self.safe_number(info, 'liab'),
            'marginMode': self.safe_string(info, 'mgnMode'),
            'timestamp': timestamp,  # Interest accrued time
            'datetime': self.iso8601(timestamp),
        }

    def borrow_cross_margin(self, code: str, amount: float, params={}):
        """
        create a loan to borrow margin(need to be VIP 5 and above)

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-vip-loans-borrow-and-repay

        :param str code: unified currency code of the currency to borrow
        :param float amount: the amount to borrow
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `margin loan structure <https://docs.ccxt.com/?id=margin-loan-structure>`
        """
        self.load_markets()
        currency = self.currency(code)
        request: dict = {
            'ccy': currency['id'],
            'amt': self.currency_to_precision(code, amount),
            'side': 'borrow',
        }
        response = self.privatePostAccountBorrowRepay(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "amt": "102",
        #                 "ccy": "USDT",
        #                 "ordId": "544199684697214976",
        #                 "side": "borrow",
        #                 "state": "1"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        loan = self.safe_dict(data, 0, {})
        return self.parse_margin_loan(loan, currency)

    def repay_cross_margin(self, code: str, amount, params={}):
        """
        repay borrowed margin and interest

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-vip-loans-borrow-and-repay

        :param str code: unified currency code of the currency to repay
        :param float amount: the amount to repay
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.id]: the order ID of borrowing, it is necessary while repaying
        :returns dict: a `margin loan structure <https://docs.ccxt.com/?id=margin-loan-structure>`
        """
        self.load_markets()
        id = self.safe_string_2(params, 'id', 'ordId')
        params = self.omit(params, 'id')
        if id is None:
            raise ArgumentsRequired(self.id + ' repayCrossMargin() requires an id parameter')
        currency = self.currency(code)
        request: dict = {
            'ccy': currency['id'],
            'amt': self.currency_to_precision(code, amount),
            'side': 'repay',
            'ordId': id,
        }
        response = self.privatePostAccountBorrowRepay(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "amt": "102",
        #                 "ccy": "USDT",
        #                 "ordId": "544199684697214976",
        #                 "side": "repay",
        #                 "state": "1"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        loan = self.safe_dict(data, 0, {})
        return self.parse_margin_loan(loan, currency)

    def parse_margin_loan(self, info, currency: Currency = None):
        #
        #     {
        #         "amt": "102",
        #         "availLoan": "97",
        #         "ccy": "USDT",
        #         "loanQuota": "6000000",
        #         "posLoan": "0",
        #         "side": "repay",
        #         "usedLoan": "97"
        #     }
        #
        currencyId = self.safe_string(info, 'ccy')
        return {
            'id': None,
            'currency': self.safe_currency_code(currencyId, currency),
            'amount': self.safe_number(info, 'amt'),
            'symbol': None,
            'timestamp': None,
            'datetime': None,
            'info': info,
        }

    def fetch_open_interest(self, symbol: str, params={}):
        """
        Retrieves the open interest of a currency

        https://www.okx.com/docs-v5/en/#rest-api-public-data-get-open-interest

        :param str symbol: Unified CCXT market symbol
        :param dict [params]: exchange specific parameters
        :returns dict} an open interest structure{@link https://docs.ccxt.com/?id=open-interest-structure:
        """
        self.load_markets()
        market = self.market(symbol)
        if not market['contract']:
            raise BadRequest(self.id + ' fetchOpenInterest() supports contract markets only')
        type = self.convert_to_instrument_type(market['type'])
        uly = self.safe_string(market['info'], 'uly')
        request: dict = {
            'instType': type,
            'uly': uly,
            'instId': market['id'],
        }
        response = self.publicGetPublicOpenInterest(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "instId": "BTC-USDT-SWAP",
        #                 "instType": "SWAP",
        #                 "oi": "2125419",
        #                 "oiCcy": "21254.19",
        #                 "ts": "1664005108969"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_open_interest(data[0], market)

    def fetch_open_interests(self, symbols: Strings = None, params={}) -> OpenInterests:
        """
        Retrieves the open interests of some currencies

        https://www.okx.com/docs-v5/en/#rest-api-public-data-get-open-interest

        :param str[] symbols: Unified CCXT market symbols
        :param dict [params]: exchange specific parameters
        :param str params['instType']: Instrument type, options: 'SWAP', 'FUTURES', 'OPTION', default to 'SWAP'
        :param str params['uly']: Underlying, Applicable to FUTURES/SWAP/OPTION, if instType is 'OPTION', either uly or instFamily is required
        :param str params['instFamily']: Instrument family, Applicable to FUTURES/SWAP/OPTION, if instType is 'OPTION', either uly or instFamily is required
        :returns dict: an dictionary of `open interest structures <https://docs.ccxt.com/?id=open-interest-structure>`
        """
        self.load_markets()
        symbols = self.market_symbols(symbols, None, True, True)
        market = None
        if symbols is not None:
            market = self.market(symbols[0])
        marketType = None
        marketType, params = self.handle_sub_type_and_params('fetchOpenInterests', market, params, 'swap')
        instType = 'SWAP'
        if marketType == 'future':
            instType = 'FUTURES'
        elif instType == 'option':
            instType = 'OPTION'
        request: dict = {'instType': instType}
        uly = self.safe_string(params, 'uly')
        if uly is not None:
            request['uly'] = uly
        instFamily = self.safe_string(params, 'instFamily')
        if instFamily is not None:
            request['instFamily'] = instFamily
        if instType == 'OPTION' and uly is None and instFamily is None:
            raise BadRequest(self.id + ' fetchOpenInterests() requires either uly or instFamily parameter for OPTION markets')
        response = self.publicGetPublicOpenInterest(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "instId": "BTC-USDT-SWAP",
        #                 "instType": "SWAP",
        #                 "oi": "2125419",
        #                 "oiCcy": "21254.19",
        #                 "ts": "1664005108969"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_open_interests(data, symbols)

    def fetch_open_interest_history(self, symbol: str, timeframe='1d', since: Int = None, limit: Int = None, params={}):
        """
        Retrieves the open interest history of a currency

        https://www.okx.com/docs-v5/en/#rest-api-trading-data-get-contracts-open-interest-and-volume
        https://www.okx.com/docs-v5/en/#rest-api-trading-data-get-options-open-interest-and-volume

        :param str symbol: Unified CCXT currency code or unified symbol
        :param str timeframe: "5m", "1h", or "1d" for option only "1d" or "8h"
        :param int [since]: The time in ms of the earliest record to retrieve unix timestamp
        :param int [limit]: Not used by okx, but parsed internally by CCXT
        :param dict [params]: Exchange specific parameters
        :param int [params.until]: The time in ms of the latest record to retrieve unix timestamp
        :returns: An array of `open interest structures <https://docs.ccxt.com/?id=open-interest-structure>`
        """
        options = self.safe_dict(self.options, 'fetchOpenInterestHistory', {})
        timeframes = self.safe_dict(options, 'timeframes', {})
        timeframe = self.safe_string(timeframes, timeframe, timeframe)
        if timeframe != '5m' and timeframe != '1H' and timeframe != '1D':
            raise BadRequest(self.id + ' fetchOpenInterestHistory cannot only use the 5m, 1h, and 1d timeframe')
        self.load_markets()
        # handle unified currency code or symbol
        currencyId = None
        market = None
        if (symbol in self.markets) or (symbol in self.markets_by_id):
            market = self.market(symbol)
            currencyId = market['baseId']
        else:
            currency = self.currency(symbol)
            currencyId = currency['id']
        request: dict = {
            'ccy': currencyId,
            'period': timeframe,
        }
        type = None
        response = None
        type, params = self.handle_market_type_and_params('fetchOpenInterestHistory', market, params)
        if type == 'option':
            response = self.publicGetRubikStatOptionOpenInterestVolume(self.extend(request, params))
        else:
            if since is not None:
                request['begin'] = since
            until = self.safe_integer(params, 'until')
            if until is not None:
                request['end'] = until
                params = self.omit(params, ['until'])
            response = self.publicGetRubikStatContractsOpenInterestVolume(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            [
        #                "1648221300000",  # timestamp
        #                "2183354317.945",  # open interest(USD)
        #                "74285877.617",  # volume(USD)
        #            ],
        #            ...
        #        ],
        #        "msg": ''
        #    }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_open_interests_history(data, None, since, limit)

    def parse_open_interest(self, interest, market: Market = None):
        #
        # fetchOpenInterestHistory
        #
        #    [
        #        "1648221300000",  # timestamp
        #        "2183354317.945",  # open interest(USD) - (coin) for options
        #        "74285877.617",  # volume(USD) - (coin) for options
        #    ]
        #
        # fetchOpenInterest
        #
        #     {
        #         "instId": "BTC-USD-230520-25500-P",
        #         "instType": "OPTION",
        #         "oi": "300",
        #         "oiCcy": "3",
        #         "oiUsd": "3",
        #         "ts": "1684551166251"
        #     }
        #
        id = self.safe_string(interest, 'instId')
        market = self.safe_market(id, market)
        time = self.safe_integer(interest, 'ts')
        timestamp = self.safe_integer(interest, 0, time)
        baseVolume = None
        quoteVolume = None
        openInterestAmount = None
        openInterestValue = None
        type = self.safe_string(self.options, 'defaultType')
        if isinstance(interest, list):
            if type == 'option':
                openInterestAmount = self.safe_number(interest, 1)
                baseVolume = self.safe_number(interest, 2)
            else:
                openInterestValue = self.safe_number(interest, 1)
                quoteVolume = self.safe_number(interest, 2)
        else:
            baseVolume = self.safe_number(interest, 'oiCcy')
            openInterestAmount = self.safe_number(interest, 'oi')
            openInterestValue = self.safe_number(interest, 'oiUsd')
        return self.safe_open_interest({
            'symbol': self.safe_symbol(id),
            'baseVolume': baseVolume,  # deprecated
            'quoteVolume': quoteVolume,  # deprecated
            'openInterestAmount': openInterestAmount,
            'openInterestValue': openInterestValue,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'info': interest,
        }, market)

    def set_sandbox_mode(self, enable: bool):
        super(okx, self).set_sandbox_mode(enable)
        self.options['sandboxMode'] = enable
        if enable:
            self.headers['x-simulated-trading'] = '1'
        elif 'x-simulated-trading' in self.headers:
            self.headers = self.omit(self.headers, 'x-simulated-trading')

    def fetch_deposit_withdraw_fees(self, codes: Strings = None, params={}):
        """
        fetch deposit and withdraw fees

        https://www.okx.com/docs-v5/en/#rest-api-funding-get-currencies

        :param str[]|None codes: list of unified currency codes
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict[]: a list of `fees structures <https://docs.ccxt.com/?id=fee-structure>`
        """
        self.load_markets()
        request = {}
        if codes is not None:
            ids = self.currency_ids(codes)
            request['ccy'] = ','.join(ids)
        response = self.privateGetAssetCurrencies(self.extend(request, params))
        #
        #    {
        #        "code": "0",
        #        "data": [
        #            {
        #                "canDep": True,
        #                "canInternal": False,
        #                "canWd": True,
        #                "ccy": "USDT",
        #                "chain": "USDT-TRC20",
        #                "logoLink": "https://static.coinall.ltd/cdn/assets/imgs/221/5F74EB20302D7761.png",
        #                "mainNet": False,
        #                "maxFee": "1.6",
        #                "maxWd": "8852150",
        #                "minFee": "0.8",
        #                "minWd": "2",
        #                "name": "Tether",
        #                "usedWdQuota": "0",
        #                "wdQuota": "500",
        #                "wdTickSz": "3"
        #            },
        #            {
        #                "canDep": True,
        #                "canInternal": False,
        #                "canWd": True,
        #                "ccy": "USDT",
        #                "chain": "USDT-ERC20",
        #                "logoLink": "https://static.coinall.ltd/cdn/assets/imgs/221/5F74EB20302D7761.png",
        #                "mainNet": False,
        #                "maxFee": "16",
        #                "maxWd": "8852150",
        #                "minFee": "8",
        #                "minWd": "2",
        #                "name": "Tether",
        #                "usedWdQuota": "0",
        #                "wdQuota": "500",
        #                "wdTickSz": "3"
        #            },
        #            ...
        #        ],
        #        "msg": ""
        #    }
        #
        data = self.safe_list(response, 'data')
        return self.parse_deposit_withdraw_fees(data, codes)

    def parse_deposit_withdraw_fees(self, response, codes=None, currencyIdKey=None):
        #
        # [
        #   {
        #       "canDep": True,
        #       "canInternal": False,
        #       "canWd": True,
        #       "ccy": "USDT",
        #       "chain": "USDT-TRC20",
        #       "logoLink": "https://static.coinall.ltd/cdn/assets/imgs/221/5F74EB20302D7761.png",
        #       "mainNet": False,
        #       "maxFee": "1.6",
        #       "maxWd": "8852150",
        #       "minFee": "0.8",
        #       "minWd": "2",
        #       "name": "Tether",
        #       "usedWdQuota": "0",
        #       "wdQuota": "500",
        #       "wdTickSz": "3"
        #   }
        # ]
        #
        depositWithdrawFees: dict = {}
        codes = self.market_codes(codes)
        for i in range(0, len(response)):
            feeInfo = response[i]
            currencyId = self.safe_string(feeInfo, 'ccy')
            code = self.safe_currency_code(currencyId)
            if (codes is None) or (self.in_array(code, codes)):
                depositWithdrawFee = self.safe_value(depositWithdrawFees, code)
                if depositWithdrawFee is None:
                    depositWithdrawFees[code] = self.deposit_withdraw_fee({})
                depositWithdrawFees[code]['info'][currencyId] = feeInfo
                chain = self.safe_string(feeInfo, 'chain')
                if chain is None:
                    continue
                chainSplit = chain.split('-')
                networkId = self.safe_value(chainSplit, 1)
                withdrawFee = self.safe_number(feeInfo, 'fee')
                withdrawResult: dict = {
                    'fee': withdrawFee,
                    'percentage': False if (withdrawFee is not None) else None,
                }
                depositResult: dict = {
                    'fee': None,
                    'percentage': None,
                }
                networkCode = self.network_id_to_code(networkId, code)
                depositWithdrawFees[code]['networks'][networkCode] = {
                    'withdraw': withdrawResult,
                    'deposit': depositResult,
                }
        depositWithdrawCodes = list(depositWithdrawFees.keys())
        for i in range(0, len(depositWithdrawCodes)):
            code = depositWithdrawCodes[i]
            currency = self.currency(code)
            depositWithdrawFees[code] = self.assign_default_deposit_withdraw_fees(depositWithdrawFees[code], currency)
        return depositWithdrawFees

    def fetch_settlement_history(self, symbol: Str = None, since: Int = None, limit: Int = None, params={}):
        """
        fetches historical settlement records

        https://www.okx.com/docs-v5/en/#rest-api-public-data-get-delivery-exercise-history

        :param str symbol: unified market symbol to fetch the settlement history for
        :param int [since]: timestamp in ms
        :param int [limit]: number of records
        :param dict [params]: exchange specific params
        :returns dict[]: a list of `settlement history objects <https://docs.ccxt.com/?id=settlement-history-structure>`
        """
        if symbol is None:
            raise ArgumentsRequired(self.id + ' fetchSettlementHistory() requires a symbol argument')
        self.load_markets()
        market = self.market(symbol)
        type = None
        type, params = self.handle_market_type_and_params('fetchSettlementHistory', market, params)
        if type != 'future' and type != 'option':
            raise NotSupported(self.id + ' fetchSettlementHistory() supports futures and options markets only')
        request: dict = {
            'instType': self.convert_to_instrument_type(type),
            'uly': market['baseId'] + '-' + market['quoteId'],
        }
        if since is not None:
            request['before'] = since - 1
        if limit is not None:
            request['limit'] = limit
        response = self.publicGetPublicDeliveryExerciseHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "details": [
        #                     {
        #                         "insId": "BTC-USD-230523-25750-C",
        #                         "px": "27290.1486867000556483",
        #                         "type": "exercised"
        #                     },
        #                 ],
        #                 "ts":"1684656000000"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        settlements = self.parse_settlements(data, market)
        sorted = self.sort_by(settlements, 'timestamp')
        return self.filter_by_symbol_since_limit(sorted, market['symbol'], since, limit)

    def parse_settlement(self, settlement, market):
        #
        #     {
        #         "insId": "BTC-USD-230521-28500-P",
        #         "px": "27081.2007345984751516",
        #         "type": "exercised"
        #     }
        #
        marketId = self.safe_string(settlement, 'insId')
        return {
            'info': settlement,
            'symbol': self.safe_symbol(marketId, market),
            'price': self.safe_number(settlement, 'px'),
            'timestamp': None,
            'datetime': None,
        }

    def parse_settlements(self, settlements, market):
        #
        #     {
        #         "details": [
        #             {
        #                 "insId": "BTC-USD-230523-25750-C",
        #                 "px": "27290.1486867000556483",
        #                 "type": "exercised"
        #             },
        #         ],
        #         "ts":"1684656000000"
        #     }
        #
        result = []
        for i in range(0, len(settlements)):
            entry = settlements[i]
            timestamp = self.safe_integer(entry, 'ts')
            details = self.safe_list(entry, 'details', [])
            for j in range(0, len(details)):
                settlement = self.parse_settlement(details[j], market)
                result.append(self.extend(settlement, {
                    'timestamp': timestamp,
                    'datetime': self.iso8601(timestamp),
                }))
        return result

    def fetch_underlying_assets(self, params={}):
        """
        fetches the market ids of underlying assets for a specific contract market type

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-underlying

        :param dict [params]: exchange specific params
        :param str [params.type]: the contract market type, 'option', 'swap' or 'future', the default is 'option'
        :returns dict[]: a list of `underlying assets <https://docs.ccxt.com/?id=underlying-assets-structure>`
        """
        self.load_markets()
        marketType = None
        marketType, params = self.handle_market_type_and_params('fetchUnderlyingAssets', None, params)
        if (marketType is None) or (marketType == 'spot'):
            marketType = 'option'
        if (marketType != 'option') and (marketType != 'swap') and (marketType != 'future'):
            raise NotSupported(self.id + ' fetchUnderlyingAssets() supports contract markets only')
        request: dict = {
            'instType': self.convert_to_instrument_type(marketType),
        }
        response = self.publicGetPublicUnderlying(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             [
        #                 "BTC-USD",
        #                 "ETH-USD"
        #             ]
        #         ],
        #         "msg": ""
        #     }
        #
        underlyings = self.safe_list(response, 'data', [])
        return underlyings[0]

    def fetch_greeks(self, symbol: str, params={}) -> Greeks:
        """
        fetches an option contracts greeks, financial metrics used to measure the factors that affect the price of an options contract

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-option-market-data

        :param str symbol: unified symbol of the market to fetch greeks for
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `greeks structure <https://docs.ccxt.com/?id=greeks-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        marketId = market['id']
        optionParts = marketId.split('-')
        request: dict = {
            'uly': market['info']['uly'],
            'instFamily': market['info']['instFamily'],
            'expTime': self.safe_string(optionParts, 2),
        }
        response = self.publicGetPublicOptSummary(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "askVol": "0",
        #                 "bidVol": "0",
        #                 "delta": "0.5105464486882039",
        #                 "deltaBS": "0.7325502184143025",
        #                 "fwdPx": "37675.80158694987186",
        #                 "gamma": "-0.13183515090501083",
        #                 "gammaBS": "0.000024139685826358558",
        #                 "instId": "BTC-USD-240329-32000-C",
        #                 "instType": "OPTION",
        #                 "lever": "4.504428015946619",
        #                 "markVol": "0.5916253554539876",
        #                 "realVol": "0",
        #                 "theta": "-0.0004202992014012855",
        #                 "thetaBS": "-18.52354631567909",
        #                 "ts": "1699586421976",
        #                 "uly": "BTC-USD",
        #                 "vega": "0.0020207455080045846",
        #                 "vegaBS": "74.44022302387287",
        #                 "volLv": "0.5948549730405797"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        for i in range(0, len(data)):
            entry = data[i]
            entryMarketId = self.safe_string(entry, 'instId')
            if entryMarketId == marketId:
                return self.parse_greeks(entry, market)
        return None

    def fetch_all_greeks(self, symbols: Strings = None, params={}) -> List[Greeks]:
        """
        fetches all option contracts greeks, financial metrics used to measure the factors that affect the price of an options contract

        https://www.okx.com/docs-v5/en/#public-data-rest-api-get-option-market-data

        :param str[] [symbols]: unified symbols of the markets to fetch greeks for, all markets are returned if not assigned
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str params['uly']: Underlying, either uly or instFamily is required
        :param str params['instFamily']: Instrument family, either uly or instFamily is required
        :returns dict: a `greeks structure <https://docs.ccxt.com/?id=greeks-structure>`
        """
        self.load_markets()
        request: dict = {}
        symbols = self.market_symbols(symbols, None, True, True, True)
        symbolsLength = None
        if symbols is not None:
            symbolsLength = len(symbols)
        if (symbols is None) or (symbolsLength != 1):
            uly = self.safe_string(params, 'uly')
            if uly is not None:
                request['uly'] = uly
            instFamily = self.safe_string(params, 'instFamily')
            if instFamily is not None:
                request['instFamily'] = instFamily
            if (uly is None) and (instFamily is None):
                raise BadRequest(self.id + ' fetchAllGreeks() requires either a uly or instFamily parameter')
        market = None
        if symbols is not None:
            if symbolsLength == 1:
                market = self.market(symbols[0])
                marketId = market['id']
                optionParts = marketId.split('-')
                request['uly'] = market['info']['uly']
                request['instFamily'] = market['info']['instFamily']
                request['expTime'] = self.safe_string(optionParts, 2)
        params = self.omit(params, ['uly', 'instFamily'])
        response = self.publicGetPublicOptSummary(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "askVol": "0",
        #                 "bidVol": "0",
        #                 "delta": "0.5105464486882039",
        #                 "deltaBS": "0.7325502184143025",
        #                 "fwdPx": "37675.80158694987186",
        #                 "gamma": "-0.13183515090501083",
        #                 "gammaBS": "0.000024139685826358558",
        #                 "instId": "BTC-USD-240329-32000-C",
        #                 "instType": "OPTION",
        #                 "lever": "4.504428015946619",
        #                 "markVol": "0.5916253554539876",
        #                 "realVol": "0",
        #                 "theta": "-0.0004202992014012855",
        #                 "thetaBS": "-18.52354631567909",
        #                 "ts": "1699586421976",
        #                 "uly": "BTC-USD",
        #                 "vega": "0.0020207455080045846",
        #                 "vegaBS": "74.44022302387287",
        #                 "volLv": "0.5948549730405797"
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        return self.parse_all_greeks(data, symbols)

    def parse_greeks(self, greeks: dict, market: Market = None) -> Greeks:
        #
        #     {
        #         "askVol": "0",
        #         "bidVol": "0",
        #         "delta": "0.5105464486882039",
        #         "deltaBS": "0.7325502184143025",
        #         "fwdPx": "37675.80158694987186",
        #         "gamma": "-0.13183515090501083",
        #         "gammaBS": "0.000024139685826358558",
        #         "instId": "BTC-USD-240329-32000-C",
        #         "instType": "OPTION",
        #         "lever": "4.504428015946619",
        #         "markVol": "0.5916253554539876",
        #         "realVol": "0",
        #         "theta": "-0.0004202992014012855",
        #         "thetaBS": "-18.52354631567909",
        #         "ts": "1699586421976",
        #         "uly": "BTC-USD",
        #         "vega": "0.0020207455080045846",
        #         "vegaBS": "74.44022302387287",
        #         "volLv": "0.5948549730405797"
        #     }
        #
        timestamp = self.safe_integer(greeks, 'ts')
        marketId = self.safe_string(greeks, 'instId')
        symbol = self.safe_symbol(marketId, market)
        return {
            'symbol': symbol,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'delta': self.safe_number(greeks, 'delta'),
            'gamma': self.safe_number(greeks, 'gamma'),
            'theta': self.safe_number(greeks, 'theta'),
            'vega': self.safe_number(greeks, 'vega'),
            'rho': None,
            'bidSize': None,
            'askSize': None,
            'bidImpliedVolatility': self.safe_number(greeks, 'bidVol'),
            'askImpliedVolatility': self.safe_number(greeks, 'askVol'),
            'markImpliedVolatility': self.safe_number(greeks, 'markVol'),
            'bidPrice': None,
            'askPrice': None,
            'markPrice': None,
            'lastPrice': None,
            'underlyingPrice': None,
            'info': greeks,
        }

    def close_position(self, symbol: str, side: OrderSide = None, params={}) -> Order:
        """
        closes open positions for a market

        https://www.okx.com/docs-v5/en/#order-book-trading-trade-post-close-positions

        :param str symbol: Unified CCXT market symbol
        :param str [side]: 'buy' or 'sell', leave in net mode
        :param dict [params]: extra parameters specific to the okx api endpoint
        :param str [params.clientOrderId]: a unique identifier for the order
        :param str [params.marginMode]: 'cross' or 'isolated', default is 'cross
        :param str [params.code]: *required in the case of closing cross MARGIN position for Single-currency margin* margin currency

 EXCHANGE SPECIFIC PARAMETERS
        :param boolean [params.autoCxl]: whether any pending orders for closing out needs to be automatically canceled when close position via a market order. False or True, the default is False
        :param str [params.tag]: order tag a combination of case-sensitive alphanumerics, all numbers, or all letters of up to 16 characters
        :returns dict[]: `A list of position structures <https://docs.ccxt.com/?id=position-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        clientOrderId = self.safe_string(params, 'clientOrderId')
        code = self.safe_string(params, 'code')
        marginMode = None
        marginMode, params = self.handle_margin_mode_and_params('closePosition', params, 'cross')
        request: dict = {
            'instId': market['id'],
            'mgnMode': marginMode,
        }
        if side is not None:
            if (side == 'buy'):
                request['posSide'] = 'long'
            elif side == 'sell':
                request['posSide'] = 'short'
            else:
                request['posSide'] = side
        if clientOrderId is not None:
            request['clOrdId'] = clientOrderId
        if code is not None:
            currency = self.currency(code)
            request['ccy'] = currency['id']
        response = self.privatePostTradeClosePosition(self.extend(request, params))
        #
        #    {
        #        "code": "1",
        #        "data": [
        #            {
        #                "clOrdId":"e847386590ce4dBCe903bbc394dc88bf",
        #                "ordId":"",
        #                "sCode":"51000",
        #                "sMsg":"Parameter posSide error ",
        #                "tag":"e847386590ce4dBC"
        #            }
        #        ],
        #        "inTime": "1701877077101064",
        #        "msg": "All operations failed",
        #        "outTime": "1701877077102579"
        #    }
        #
        data = self.safe_list(response, 'data', [])
        order = self.safe_dict(data, 0)
        return self.parse_order(order, market)

    def fetch_option(self, symbol: str, params={}) -> Option:
        """
        fetches option data that is commonly found in an option chain

        https://www.okx.com/docs-v5/en/#order-book-trading-market-data-get-ticker

        :param str symbol: unified market symbol
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: an `option chain structure <https://docs.ccxt.com/?id=option-chain-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        response = self.publicGetMarketTicker(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "instType": "OPTION",
        #                 "instId": "BTC-USD-241227-60000-P",
        #                 "last": "",
        #                 "lastSz": "0",
        #                 "askPx": "",
        #                 "askSz": "0",
        #                 "bidPx": "",
        #                 "bidSz": "0",
        #                 "open24h": "",
        #                 "high24h": "",
        #                 "low24h": "",
        #                 "volCcy24h": "0",
        #                 "vol24h": "0",
        #                 "ts": "1711176035035",
        #                 "sodUtc0": "",
        #                 "sodUtc8": ""
        #             }
        #         ]
        #     }
        #
        result = self.safe_list(response, 'data', [])
        chain = self.safe_dict(result, 0, {})
        return self.parse_option(chain, None, market)

    def fetch_option_chain(self, code: str, params={}) -> OptionChain:
        """
        fetches data for an underlying asset that is commonly found in an option chain

        https://www.okx.com/docs-v5/en/#order-book-trading-market-data-get-tickers

        :param str code: base currency to fetch an option chain for
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param str [params.uly]: the underlying asset, can be obtained from fetchUnderlyingAssets()
        :returns dict: a list of `option chain structures <https://docs.ccxt.com/?id=option-chain-structure>`
        """
        self.load_markets()
        currency = self.currency(code)
        request: dict = {
            'uly': currency['code'] + '-USD',
            'instType': 'OPTION',
        }
        response = self.publicGetMarketTickers(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "msg": "",
        #         "data": [
        #             {
        #                 "instType": "OPTION",
        #                 "instId": "BTC-USD-240323-52000-C",
        #                 "last": "",
        #                 "lastSz": "0",
        #                 "askPx": "",
        #                 "askSz": "0",
        #                 "bidPx": "",
        #                 "bidSz": "0",
        #                 "open24h": "",
        #                 "high24h": "",
        #                 "low24h": "",
        #                 "volCcy24h": "0",
        #                 "vol24h": "0",
        #                 "ts": "1711176207008",
        #                 "sodUtc0": "",
        #                 "sodUtc8": ""
        #             },
        #         ]
        #     }
        #
        result = self.safe_list(response, 'data', [])
        return self.parse_option_chain(result, None, 'instId')

    def parse_option(self, chain: dict, currency: Currency = None, market: Market = None) -> Option:
        #
        #     {
        #         "instType": "OPTION",
        #         "instId": "BTC-USD-241227-60000-P",
        #         "last": "",
        #         "lastSz": "0",
        #         "askPx": "",
        #         "askSz": "0",
        #         "bidPx": "",
        #         "bidSz": "0",
        #         "open24h": "",
        #         "high24h": "",
        #         "low24h": "",
        #         "volCcy24h": "0",
        #         "vol24h": "0",
        #         "ts": "1711176035035",
        #         "sodUtc0": "",
        #         "sodUtc8": ""
        #     }
        #
        marketId = self.safe_string(chain, 'instId')
        market = self.safe_market(marketId, market)
        timestamp = self.safe_integer(chain, 'ts')
        return {
            'info': chain,
            'currency': None,
            'symbol': market['symbol'],
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'impliedVolatility': None,
            'openInterest': None,
            'bidPrice': self.safe_number(chain, 'bidPx'),
            'askPrice': self.safe_number(chain, 'askPx'),
            'midPrice': None,
            'markPrice': None,
            'lastPrice': self.safe_number(chain, 'last'),
            'underlyingPrice': None,
            'change': None,
            'percentage': None,
            'baseVolume': self.safe_number(chain, 'volCcy24h'),
            'quoteVolume': None,
        }

    def fetch_convert_quote(self, fromCode: str, toCode: str, amount: Num = None, params={}) -> Conversion:
        """
        fetch a quote for converting from one currency to another

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-estimate-quote

        :param str fromCode: the currency that you want to sell and convert from
        :param str toCode: the currency that you want to buy and convert into
        :param float [amount]: how much you want to trade in units of the from currency
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `conversion structure <https://docs.ccxt.com/?id=conversion-structure>`
        """
        self.load_markets()
        request: dict = {
            'baseCcy': fromCode.upper(),
            'quoteCcy': toCode.upper(),
            'rfqSzCcy': fromCode.upper(),
            'rfqSz': self.number_to_string(amount),
            'side': 'sell',
        }
        response = self.privatePostAssetConvertEstimateQuote(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "baseCcy": "ETH",
        #                 "baseSz": "0.01023052",
        #                 "clQReqId": "",
        #                 "cnvtPx": "2932.40104429",
        #                 "origRfqSz": "30",
        #                 "quoteCcy": "USDT",
        #                 "quoteId": "quoterETH-USDT16461885104612381",
        #                 "quoteSz": "30",
        #                 "quoteTime": "1646188510461",
        #                 "rfqSz": "30",
        #                 "rfqSzCcy": "USDT",
        #                 "side": "buy",
        #                 "ttlMs": "10000"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        result = self.safe_dict(data, 0, {})
        fromCurrencyId = self.safe_string(result, 'baseCcy', fromCode)
        fromCurrency = self.currency(fromCurrencyId)
        toCurrencyId = self.safe_string(result, 'quoteCcy', toCode)
        toCurrency = self.currency(toCurrencyId)
        return self.parse_conversion(result, fromCurrency, toCurrency)

    def create_convert_trade(self, id: str, fromCode: str, toCode: str, amount: Num = None, params={}) -> Conversion:
        """
        convert from one currency to another

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-convert-trade

        :param str id: the id of the trade that you want to make
        :param str fromCode: the currency that you want to sell and convert from
        :param str toCode: the currency that you want to buy and convert into
        :param float [amount]: how much you want to trade in units of the from currency
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `conversion structure <https://docs.ccxt.com/?id=conversion-structure>`
        """
        self.load_markets()
        request: dict = {
            'quoteId': id,
            'baseCcy': fromCode,
            'quoteCcy': toCode,
            'szCcy': fromCode,
            'sz': self.number_to_string(amount),
            'side': 'sell',
        }
        response = self.privatePostAssetConvertTrade(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "baseCcy": "ETH",
        #                 "clTReqId": "",
        #                 "fillBaseSz": "0.01023052",
        #                 "fillPx": "2932.40104429",
        #                 "fillQuoteSz": "30",
        #                 "instId": "ETH-USDT",
        #                 "quoteCcy": "USDT",
        #                 "quoteId": "quoterETH-USDT16461885104612381",
        #                 "side": "buy",
        #                 "state": "fullyFilled",
        #                 "tradeId": "trader16461885203381437",
        #                 "ts": "1646188520338"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        result = self.safe_dict(data, 0, {})
        fromCurrencyId = self.safe_string(result, 'baseCcy', fromCode)
        fromCurrency = self.currency(fromCurrencyId)
        toCurrencyId = self.safe_string(result, 'quoteCcy', toCode)
        toCurrency = self.currency(toCurrencyId)
        return self.parse_conversion(result, fromCurrency, toCurrency)

    def fetch_convert_trade(self, id: str, code: Str = None, params={}) -> Conversion:
        """
        fetch the data for a conversion trade

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-get-convert-history

        :param str id: the id of the trade that you want to fetch
        :param str [code]: the unified currency code of the conversion trade
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: a `conversion structure <https://docs.ccxt.com/?id=conversion-structure>`
        """
        self.load_markets()
        request: dict = {
            'clTReqId': id,
        }
        response = self.privateGetAssetConvertHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "clTReqId": "",
        #                 "instId": "ETH-USDT",
        #                 "side": "buy",
        #                 "fillPx": "2932.401044",
        #                 "baseCcy": "ETH",
        #                 "quoteCcy": "USDT",
        #                 "fillBaseSz": "0.01023052",
        #                 "state": "fullyFilled",
        #                 "tradeId": "trader16461885203381437",
        #                 "fillQuoteSz": "30",
        #                 "ts": "1646188520000"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        result = self.safe_dict(data, 0, {})
        fromCurrencyId = self.safe_string(result, 'baseCcy')
        toCurrencyId = self.safe_string(result, 'quoteCcy')
        fromCurrency = None
        toCurrency = None
        if fromCurrencyId is not None:
            fromCurrency = self.currency(fromCurrencyId)
        if toCurrencyId is not None:
            toCurrency = self.currency(toCurrencyId)
        return self.parse_conversion(result, fromCurrency, toCurrency)

    def fetch_convert_trade_history(self, code: Str = None, since: Int = None, limit: Int = None, params={}) -> List[Conversion]:
        """
        fetch the users history of conversion trades

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-get-convert-history

        :param str [code]: the unified currency code
        :param int [since]: the earliest time in ms to fetch conversions for
        :param int [limit]: the maximum number of conversion structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param int [params.until]: timestamp in ms of the latest conversion to fetch
        :returns dict[]: a list of `conversion structures <https://docs.ccxt.com/?id=conversion-structure>`
        """
        self.load_markets()
        request: dict = {}
        request, params = self.handle_until_option('after', request, params)
        if since is not None:
            request['before'] = since
        if limit is not None:
            request['limit'] = limit
        response = self.privateGetAssetConvertHistory(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "clTReqId": "",
        #                 "instId": "ETH-USDT",
        #                 "side": "buy",
        #                 "fillPx": "2932.401044",
        #                 "baseCcy": "ETH",
        #                 "quoteCcy": "USDT",
        #                 "fillBaseSz": "0.01023052",
        #                 "state": "fullyFilled",
        #                 "tradeId": "trader16461885203381437",
        #                 "fillQuoteSz": "30",
        #                 "ts": "1646188520000"
        #             }
        #         ],
        #         "msg": ""
        #     }
        #
        rows = self.safe_list(response, 'data', [])
        return self.parse_conversions(rows, code, 'baseCcy', 'quoteCcy', since, limit)

    def parse_conversion(self, conversion: dict, fromCurrency: Currency = None, toCurrency: Currency = None) -> Conversion:
        #
        # fetchConvertQuote
        #
        #     {
        #         "baseCcy": "ETH",
        #         "baseSz": "0.01023052",
        #         "clQReqId": "",
        #         "cnvtPx": "2932.40104429",
        #         "origRfqSz": "30",
        #         "quoteCcy": "USDT",
        #         "quoteId": "quoterETH-USDT16461885104612381",
        #         "quoteSz": "30",
        #         "quoteTime": "1646188510461",
        #         "rfqSz": "30",
        #         "rfqSzCcy": "USDT",
        #         "side": "buy",
        #         "ttlMs": "10000"
        #     }
        #
        # createConvertTrade
        #
        #     {
        #         "baseCcy": "ETH",
        #         "clTReqId": "",
        #         "fillBaseSz": "0.01023052",
        #         "fillPx": "2932.40104429",
        #         "fillQuoteSz": "30",
        #         "instId": "ETH-USDT",
        #         "quoteCcy": "USDT",
        #         "quoteId": "quoterETH-USDT16461885104612381",
        #         "side": "buy",
        #         "state": "fullyFilled",
        #         "tradeId": "trader16461885203381437",
        #         "ts": "1646188520338"
        #     }
        #
        # fetchConvertTrade, fetchConvertTradeHistory
        #
        #     {
        #         "clTReqId": "",
        #         "instId": "ETH-USDT",
        #         "side": "buy",
        #         "fillPx": "2932.401044",
        #         "baseCcy": "ETH",
        #         "quoteCcy": "USDT",
        #         "fillBaseSz": "0.01023052",
        #         "state": "fullyFilled",
        #         "tradeId": "trader16461885203381437",
        #         "fillQuoteSz": "30",
        #         "ts": "1646188520000"
        #     }
        #
        timestamp = self.safe_integer_2(conversion, 'quoteTime', 'ts')
        fromCoin = self.safe_string(conversion, 'baseCcy')
        fromCode = self.safe_currency_code(fromCoin, fromCurrency)
        to = self.safe_string(conversion, 'quoteCcy')
        toCode = self.safe_currency_code(to, toCurrency)
        return {
            'info': conversion,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'id': self.safe_string_n(conversion, ['clQReqId', 'tradeId', 'quoteId']),
            'fromCurrency': fromCode,
            'fromAmount': self.safe_number_2(conversion, 'baseSz', 'fillBaseSz'),
            'toCurrency': toCode,
            'toAmount': self.safe_number_2(conversion, 'quoteSz', 'fillQuoteSz'),
            'price': self.safe_number_2(conversion, 'cnvtPx', 'fillPx'),
            'fee': None,
        }

    def fetch_convert_currencies(self, params={}) -> Currencies:
        """
        fetches all available currencies that can be converted

        https://www.okx.com/docs-v5/en/#funding-account-rest-api-get-convert-currencies

        :param dict [params]: extra parameters specific to the exchange API endpoint
        :returns dict: an associative dictionary of currencies
        """
        self.load_markets()
        response = self.privateGetAssetConvertCurrencies(params)
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             {
        #                 "ccy": "BTC",
        #                 "max": "",
        #                 "min": ""
        #             },
        #         ],
        #         "msg": ""
        #     }
        #
        result: dict = {}
        data = self.safe_list(response, 'data', [])
        for i in range(0, len(data)):
            entry = data[i]
            id = self.safe_string(entry, 'ccy')
            code = self.safe_currency_code(id)
            result[code] = {
                'info': entry,
                'id': id,
                'code': code,
                'networks': None,
                'type': None,
                'name': None,
                'active': None,
                'deposit': None,
                'withdraw': None,
                'fee': None,
                'precision': None,
                'limits': {
                    'amount': {
                        'min': self.safe_number(entry, 'min'),
                        'max': self.safe_number(entry, 'max'),
                    },
                    'withdraw': {
                        'min': None,
                        'max': None,
                    },
                    'deposit': {
                        'min': None,
                        'max': None,
                    },
                },
                'created': None,
            }
        return result

    def handle_errors(self, httpCode: int, reason: str, url: str, method: str, headers: dict, body: str, response, requestHeaders, requestBody):
        if not response:
            return None  # fallback to default error handler
        #
        #    {
        #        "code": "1",
        #        "data": [
        #            {
        #                "clOrdId": "",
        #                "ordId": "",
        #                "sCode": "51119",
        #                "sMsg": "Order placement failed due to insufficient balance. ",
        #                "tag": ""
        #            }
        #        ],
        #        "msg": ""
        #    },
        #    {
        #        "code": "58001",
        #        "data": [],
        #        "msg": "Incorrect trade password"
        #    }
        #
        code = self.safe_string(response, 'code')
        if (code != '0') and (code != '2'):  # 2 means that bulk operation partially succeeded
            feedback = self.id + ' ' + body
            data = self.safe_list(response, 'data', [])
            for i in range(0, len(data)):
                error = data[i]
                errorCode = self.safe_string(error, 'sCode')
                message = self.safe_string(error, 'sMsg')
                self.throw_exactly_matched_exception(self.exceptions['exact'], errorCode, feedback)
                self.throw_broadly_matched_exception(self.exceptions['broad'], message, feedback)
            self.throw_exactly_matched_exception(self.exceptions['exact'], code, feedback)
            raise ExchangeError(feedback)  # unknown message
        return None

    def fetch_margin_adjustment_history(self, symbol: Str = None, type: Str = None, since: Num = None, limit: Num = None, params={}) -> List[MarginModification]:
        """
        fetches the history of margin added or reduced from contract isolated positions

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-bills-details-last-7-days
        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-bills-details-last-3-months

        :param str [symbol]: not used by okx fetchMarginAdjustmentHistory
        :param str [type]: "add" or "reduce"
        :param int [since]: the earliest time in ms to fetch margin adjustment history for
        :param int [limit]: the maximum number of entries to retrieve
        :param dict params: extra parameters specific to the exchange api endpoint
        :param boolean [params.auto]: True if fetching auto margin increases
        :returns dict[]: a list of `margin structures <https://docs.ccxt.com/?id=margin-loan-structure>`
        """
        self.load_markets()
        auto = self.safe_bool(params, 'auto')
        if type is None:
            raise ArgumentsRequired(self.id + ' fetchMarginAdjustmentHistory() requires a type argument')
        isAdd = type == 'add'
        subType = '160' if isAdd else '161'
        if auto:
            if isAdd:
                subType = '162'
            else:
                raise BadRequest(self.id + ' cannot fetch margin adjustments for type ' + type)
        request: dict = {
            'subType': subType,
            'mgnMode': 'isolated',
        }
        until = self.safe_integer(params, 'until')
        params = self.omit(params, 'until')
        if since is not None:
            request['startTime'] = since
        if limit is not None:
            request['limit'] = limit
        if until is not None:
            request['endTime'] = until
        response = None
        now = self.milliseconds()
        oneWeekAgo = now - 604800000
        threeMonthsAgo = now - 7776000000
        if (since is None) or (since > oneWeekAgo):
            response = self.privateGetAccountBills(self.extend(request, params))
        elif since > threeMonthsAgo:
            response = self.privateGetAccountBillsArchive(self.extend(request, params))
        else:
            raise BadRequest(self.id + ' fetchMarginAdjustmentHistory() cannot fetch margin adjustments older than 3 months')
        #
        #    {
        #        code: '0',
        #        data: [
        #            {
        #                bal: '67621.4325135010619812',
        #                balChg: '-10.0000000000000000',
        #                billId: '691293628710342659',
        #                ccy: 'USDT',
        #                clOrdId: '',
        #                execType: '',
        #                fee: '0',
        #                fillFwdPx: '',
        #                fillIdxPx: '',
        #                fillMarkPx: '',
        #                fillMarkVol: '',
        #                fillPxUsd: '',
        #                fillPxVol: '',
        #                fillTime: '1711089244850',
        #                from: '',
        #                instId: 'XRP-USDT-SWAP',
        #                instType: 'SWAP',
        #                interest: '0',
        #                mgnMode: 'isolated',
        #                notes: '',
        #                ordId: '',
        #                pnl: '0',
        #                posBal: '73.12',
        #                posBalChg: '10.00',
        #                px: '',
        #                subType: '160',
        #                sz: '10',
        #                tag: '',
        #                to: '',
        #                tradeId: '0',
        #                ts: '1711089244699',
        #                type: '6'
        #            }
        #        ],
        #        msg: ''
        #    }
        #
        data = self.safe_list(response, 'data')
        modifications = self.parse_margin_modifications(data)
        return self.filter_by_symbol_since_limit(modifications, symbol, since, limit)

    def fetch_positions_history(self, symbols: Strings = None, since: Int = None, limit: Int = None, params={}) -> List[Position]:
        """
        fetches historical positions

        https://www.okx.com/docs-v5/en/#trading-account-rest-api-get-positions-history

        :param str [symbols]: unified market symbols
        :param int [since]: timestamp in ms of the earliest position to fetch
        :param int [limit]: the maximum amount of records to fetch, default=100, max=100
        :param dict params: extra parameters specific to the exchange api endpoint
        :param str [params.marginMode]: "cross" or "isolated"

 EXCHANGE SPECIFIC PARAMETERS
        :param str [params.instType]: margin, swap, futures or option
        :param str [params.type]: the type of latest close position 1: close position partially, 2：close all, 3：liquidation, 4：partial liquidation; 5：adl, is it is the latest type if there are several types for the same position
        :param str [params.posId]: position id, there is attribute expiration, the posid will be expired if it is more than 30 days after the last full close position, then position will use new posid
        :param str [params.before]: timestamp in ms of the earliest position to fetch based on the last update time of the position
        :param str [params.after]: timestamp in ms of the latest position to fetch based on the last update time of the position
        :returns dict[]: a list of `position structures <https://docs.ccxt.com/?id=position-structure>`
        """
        self.load_markets()
        marginMode = self.safe_string(params, 'marginMode')
        instType = self.safe_string_upper(params, 'instType')
        params = self.omit(params, ['until', 'marginMode', 'instType'])
        if limit is None:
            limit = 100
        request: dict = {
            'limit': limit,
        }
        if symbols is not None:
            symbolsLength = len(symbols)
            if symbolsLength == 1:
                market = self.market(symbols[0])
                request['instId'] = market['id']
        if marginMode is not None:
            request['mgnMode'] = marginMode
        if instType is not None:
            request['instType'] = instType
        response = self.privateGetAccountPositionsHistory(self.extend(request, params))
        #
        #    {
        #        code: '0',
        #        data: [
        #            {
        #                cTime: '1708735940395',
        #                ccy: 'USDT',
        #                closeAvgPx: '0.6330444444444444',
        #                closeTotalPos: '27',
        #                direction: 'long',
        #                fee: '-1.69566',
        #                fundingFee: '-11.870404179341788',
        #                instId: 'XRP-USDT-SWAP',
        #                instType: 'SWAP',
        #                lever: '3.0',
        #                liqPenalty: '0',
        #                mgnMode: 'cross',
        #                openAvgPx: '0.623',
        #                openMaxPos: '15',
        #                pnl: '27.11999999999988',
        #                pnlRatio: '0.0241732402722634',
        #                posId: '681423155054862336',
        #                realizedPnl: '13.553935820658092',
        #                triggerPx: '',
        #                type: '2',
        #                uTime: '1711088748170',
        #                uly: 'XRP-USDT'
        #            },
        #            ...
        #        ],
        #        msg: ''
        #    }
        #
        data = self.safe_list(response, 'data')
        positions = self.parse_positions(data, symbols, params)
        return self.filter_by_since_limit(positions, since, limit)

    def fetch_long_short_ratio_history(self, symbol: Str = None, timeframe: Str = None, since: Int = None, limit: Int = None, params={}) -> List[LongShortRatio]:
        """
        fetches the long short ratio history for a unified market symbol

        https://www.okx.com/docs-v5/en/#trading-statistics-rest-api-get-contract-long-short-ratio

        :param str symbol: unified symbol of the market to fetch the long short ratio for
        :param str [timeframe]: the period for the ratio
        :param int [since]: the earliest time in ms to fetch ratios for
        :param int [limit]: the maximum number of long short ratio structures to retrieve
        :param dict [params]: extra parameters specific to the exchange API endpoint
        :param int [params.until]: timestamp in ms of the latest ratio to fetch
        :returns dict[]: an array of `long short ratio structures <https://docs.ccxt.com/?id=long-short-ratio-structure>`
        """
        self.load_markets()
        market = self.market(symbol)
        request: dict = {
            'instId': market['id'],
        }
        until = self.safe_string_2(params, 'until', 'end')
        params = self.omit(params, 'until')
        if until is not None:
            request['end'] = until
        if timeframe is not None:
            request['period'] = timeframe
        if since is not None:
            request['begin'] = since
        if limit is not None:
            request['limit'] = limit
        response = self.publicGetRubikStatContractsLongShortAccountRatioContract(self.extend(request, params))
        #
        #     {
        #         "code": "0",
        #         "data": [
        #             ["1729323600000", "0.9398602814619824"],
        #             ["1729323300000", "0.9398602814619824"],
        #             ["1729323000000", "0.9398602814619824"],
        #         ],
        #         "msg": ""
        #     }
        #
        data = self.safe_list(response, 'data', [])
        result = []
        for i in range(0, len(data)):
            entry = data[i]
            result.append({
                'timestamp': self.safe_string(entry, 0),
                'longShortRatio': self.safe_string(entry, 1),
            })
        return self.parse_long_short_ratio_history(result, market)

    def parse_long_short_ratio(self, info: dict, market: Market = None) -> LongShortRatio:
        timestamp = self.safe_integer(info, 'timestamp')
        symbol = None
        if market is not None:
            symbol = market['symbol']
        return {
            'info': info,
            'symbol': symbol,
            'timestamp': timestamp,
            'datetime': self.iso8601(timestamp),
            'timeframe': None,
            'longShortRatio': self.safe_number(info, 'longShortRatio'),
        }
